{{Short description|Chemical compound}} {{Drugbox | verifiedrevid = 451350040 | IUPAC_name = 1-(5,6,7,8-Tetrahydronaphthalen-2-yl)propan-2-amine | image = 6-APT structure.svg | image_class = skin-invert-image | width = 250px

<!--Clinical data--> | tradename = | pregnancy_category = | legal_status = Uncontrolled (but may be covered under the Federal Analogue Act in the United States and under similar bills in other countries) | routes_of_administration = Oral

<!--Pharmacokinetic data--> | bioavailability = | metabolism = | elimination_half-life = | excretion =

<!--Identifiers--> | CAS_number = 3160-20-1 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = F26UB8P44X | ATC_prefix = none | ATC_suffix = | ChEMBL = 331488 | PubChem = 14964398 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 23204045

<!--Chemical data--> | C=13 | H=19 | N=1 | smiles = CC(CC1=CC2=C(CCCC2)C=C1)N | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C13H19N/c1-10(14)8-11-6-7-12-4-2-3-5-13(12)9-11/h6-7,9-10H,2-5,8,14H2,1H3 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = UTVKUFYOPJCDPE-UHFFFAOYSA-N }}

'''6-(2-Aminopropyl)tetralin''' ('''6-APT'''), also sometimes called '''tetralinylaminopropane''' ('''TAP'''), is a drug of the amphetamine class which acts as a selective serotonin releasing agent (SSRA).<ref name="pmid8246240">{{cite journal | vauthors = Monte AP, Marona-Lewicka D, Cozzi NV, Nichols DE | title = Synthesis and pharmacological examination of benzofuran, indan, and tetralin analogues of 3,4-(methylenedioxy)amphetamine | journal = Journal of Medicinal Chemistry | volume = 36 | issue = 23 | pages = 3700–3706 | date = November 1993 | pmid = 8246240 | doi = 10.1021/jm00075a027 }}</ref> It has IC<sub>50</sub> values of 121&nbsp;nM, 6,436&nbsp;nM, and 3,371&nbsp;nM for inhibiting the reuptake of serotonin, dopamine, and norepinephrine, respectively.<ref name="pmid8246240" /> Though it possesses an appreciable ''in vitro'' profile, in animal drug discrimination studies it was not found to substitute for MMAI or amphetamine and to only partially substitute for MBDB.<ref name="pmid8246240" /> This parallels Alexander Shulgin's finding that EDMA (the 1,4-benzodioxine analogue of 6-APT) is limitedly active,<ref name="isbn0-9630096-0-5">{{cite book | vauthors = Shulgin A, Shulgin A | date = 13 May 2016 | chapter = EDMA · 3,4-Ethylenedioxy-N-methylamphetamine | title = Pihkal: A Chemical Love Story | publisher = Transform Press | isbn = 978-0-9630096-0-9 | chapter-url = http://isomerdesign.com/PiHKAL/read.php?domain=pk&id=110}}</ref> and appears to indicate that the pharmacokinetics of both EDMA and 6-APT may not be favorable.<ref name="pmid8246240" />

== See also == * 2-Aminotetralin * 5-APDI * Naphthylaminopropane * TH-PVP * 2C-G-4

== References == {{Reflist}}

{{Entactogens}} {{Monoamine releasing agents}} {{Phenethylamines}} {{Chemical classes of psychoactive drugs}}

Category:Substituted amphetamines Category:Tetralins Category:Serotonin releasing agents Category:Entactogens