{{Chembox | ImageFile = P-Methylacetophenon.svg | ImageSize = | ImageAlt = | IUPACName = 1-(4-methylphenyl)ethanone | OtherNames = ''p''-Methylacetophenone; ''p''-Acetyltoluene |Section1={{Chembox Identifiers | CASNo = 122-00-9 | CASNo_Ref = {{Cascite|correct|CAS}} | ChEBI = 178626 | ChEMBL = 271871 | ChemSpiderID = 8186 | EC_number = 204-514-8 | UNII = AX66V0KX3Y | PubChem = 8500 | StdInChI=1S/C9H10O/c1-7-3-5-9(6-4-7)8(2)10/h3-6H,1-2H3 | StdInChIKey = GNKZMNRKLCTJAY-UHFFFAOYSA-N | SMILES = CC1=CC=C(C=C1)C(=O)C }} |Section2={{Chembox Properties | C=9|H=10|O = 1 | MolarMass = | RefractIndex = | Appearance = white or colorless oil | Density = 1.006 g/cm<sup>3</sup> | MeltingPtC = 28 | MeltingPt_notes = | BoilingPtC = 224 | BoilingPt_notes = | Solubility = }} |Section3={{Chembox Hazards | GHS_ref=[https://pubchem.ncbi.nlm.nih.gov/compound/8500#section=Safety-and-Hazards] | GHSPictograms = {{GHS07}} | GHSSignalWord = Warning | HPhrases = {{H-phrases|302|315}} | PPhrases = {{P-phrases|264|270|280|301+317|302+352|321|330|332+317|362+364|501}} | MainHazards = | FlashPt = | AutoignitionPt = }} }} '''4-Methylacetophenone''' is an organic compound with the formula {{chem2|CH3C6H4C(O)CH3}}. It is related to acetophenone with a methyl group at the 4-position. Two isomers, 2-methylacetophenone and 3-methylacetophenone, are also known. It is a fragrance of commercial significance.<ref>{{cite book |last1=Panten |first1=Johannes |last2=Surburg |first2=Horst |title=Ullmann's Encyclopedia of Industrial Chemistry |chapter=Flavors and Fragrances, 3. Aromatic and Heterocyclic Compounds |date=2016 |pages=1–45 |doi=10.1002/14356007.t11_t02 |isbn=978-3-527-30673-2 }}</ref>

==Synthesis and reactions== It is prepared by acetylation of toluene.<ref>{{cite book |last1=Röper |first1=Michael |last2=Gehrer |first2=Eugen |last3=Narbeshuber |first3=Thomas |last4=Siegel |first4=Wolfgang |title=Ullmann's Encyclopedia of Industrial Chemistry |chapter=Acylation and Alkylation |date=2000 |doi=10.1002/14356007.a01_185 |isbn=978-3-527-30385-4 }}</ref>

Oxidation with hot nitric acid followed by potassium permanganate gives terephthalic acid.<ref>{{cite journal |title=Terephthalic Acid |journal=Organic Syntheses |date=1946 |volume=26 |page=95 |doi=10.15227/orgsyn.026.0095|author=C. F. Koelsch}}</ref> It undergoes most of the reactions of acetophenone: reduction to the alcohol followed by dehydration gives 4-methylstyrene.

==Occurrence== 4-Methylacetophenone occurs naturally in some woods.

==References== <references />

{{DEFAULTSORT:Methylacetophenone, 4-}} Category:Acetophenones Category:Acetyl compounds