{{Short description|Chemical compound}} {{Drugbox | verifiedrevid = 452179546 | image = 4-Methyl-AET.svg | image_class = skin-invert-image | width = 200px
<!-- Clinical data --> | tradename = | pregnancy_category = | routes_of_administration = | ATC_prefix = None | ATC_suffix =
<!-- Legal status --> | legal_status = Illegal in Singapore
<!-- Pharmacokinetic data --> | bioavailability = | protein_bound = | metabolism = | onset = | elimination_half-life = | duration_of_action = | excretion =
<!-- Identifiers --> | CAS_number = 28289-30-7 | CAS_number_Ref = {{Cascite|correct|CAS}} | PubChem = 57466062 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = SBF4N6JJ4L | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 26234938 | synonyms = 4-Methyl-AET; 4-Methyl-αET; 4-Me-AET; 4-Me-αET
<!-- Chemical data --> | IUPAC_name = 1-(4-methyl-1''H''-indol-3-yl)butan-2-amine | C=13 | H=18 | N=2 | SMILES = Cc2c1c(CC(N)CC)c[nH]c1ccc2 | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C13H18N2/c1-3-11(14)7-10-8-15-12-6-4-5-9(2)13(10)12/h4-6,8,11,15H,3,7,14H2,1-2H3 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = XKHCIOVNXOVPIK-UHFFFAOYSA-N }}
'''4-Methyl-α-ethyltryptamine''' ('''4-Me-αET''') is a drug of the tryptamine and α-alkyltryptamine families.<ref name="pmid5658327">{{cite book | vauthors = Cerletti A, Taeschler M, Weidmann H | title = Pharmacology, Behavior, and Clinical Aspects, Proceedings of a Symposium held at the College of Physicians and Surgeons, Columbia University, New York | chapter = Pharmacologic studies on the structure-activity relationship of hydroxyindole alkylamines | series = Advances in Pharmacology | volume = 6 | issue = Pt B | pages = 233–46 | date = 1968 | pmid = 5658327 | doi = 10.1016/s1054-3589(08)60322-1 | isbn = 978-0-12-032906-9 }}</ref> It is a designer drug and has been sold online as a "research chemical".<ref>{{cite journal| vauthors = Chapman SJ |title=PeakAL: Protons I Have Known and Loved, Too — Another Fifty Shades of Grey-Market Spectra|journal=Blotter|date=1 Mar 2018|issue=5|doi=10.16889/isomerdesign-5|url=https://isomerdesign.com/doi/5/index.php|access-date=3 April 2018|doi-access=free|url-access=subscription}}</ref>
==Chemistry== ===Analogues=== Analogues of 4-methyl-AET include α-ethyltryptamine (AET), 4-methyl-AMT, 4-methyl-DMT, 5-fluoro-AET, 7-methyl-AET, 7-chloro-AMT, and RS134-49 (4-methyl-THPI), among others.<ref name="TiHKAL">{{CiteTiHKAL}}</ref>
==Society and culture== ===Legal status=== ====Singapore==== 4-Me-AET is illegal in Singapore.<ref>{{cite web|title=Misuse of Drugs Act - Singapore Statutes Online|url=https://sso.agc.gov.sg/Act/MDA1973|website=sso.agc.gov.sg}}</ref>
== See also == * Substituted α-alkyltryptamine
== References == {{Reflist}}
{{Tryptamines}}
{{DEFAULTSORT:Methyl-alpha-ethyltryptamine, 4-}}
Category:Alpha-Alkyltryptamines Category:Ethyl compounds Category:Methyl compounds