{{Short description|Chemical compound}} {{cs1 config|name-list-style=vanc|display-authors=6}} {{Infobox drug | drug_name = | INN = | type = <!-- empty --> | IUPAC_name = 2-(Ethylamino)-1-(4-methylphenyl)-1-pentanone | image = 4-MEAP.svg | image_class = skin-invert-image | alt = | caption = <!-- Clinical data --> | pronounce = | tradename = | Drugs.com = | MedlinePlus = | pregnancy_AU = <!-- A/B1/B2/B3/C/D/X --> | pregnancy_AU_comment = | pregnancy_US = <!-- A/B/C/D/X/N --> | pregnancy_category = | routes_of_administration = | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> | legal_AU_comment = | legal_BR = F2 | legal_BR_comment = <ref>{{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-07-24 |title=RDC Nº 804 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 804 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-804-de-24-de-julho-de-2023-498447451 |url-status=live |archive-url=https://web.archive.org/web/20230827163149/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-804-de-24-de-julho-de-2023-498447451 |archive-date=2023-08-27 |access-date=2023-08-27 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-07-25}}</ref> | legal_CA = Schedule I | legal_DE = NpSG | legal_NZ = <!-- Class A, B, C --> | legal_UK = Class B | legal_US = Schedule I | legal_UN = <!-- N I, II, III, IV / P I, II, III, IV--> | legal_status = <!-- Free text --> <!-- Pharmacokinetic data -->| bioavailability = | protein_bound = | metabolism = | metabolites = | onset = | elimination_half-life = | duration_of_action = | excretion = <!-- Identifiers --> | CAS_number = 746540-82-9 | CAS_supplemental = <br>18297-05-7 (HCl) | UNII_Ref = {{fdacite|correct|FDA}} | UNII = R2APU4QOW0 | class = | ATCvet = | ATC_prefix = <!-- 'none' if uncategorised --> | ATC_suffix = | PubChem = 205601 | DrugBank = | ChemSpiderID = 178132 | synonyms = 4‑MEAP; 4‑MEAPP; ''N''-Ethyl-4'-methylnorpentedrone; 2-(Ethylamino)-1-(4-methylphenyl)-1-pentanone; 4-Methyl-alpha-ethylaminopentiophenone; 4‑methyl‑NEP <!-- Chemical and physical data -->| C = 14 | H = 21 | N = 1 | O = 1 | smiles = CC1=CC=C(C(C(CCC)NCC)=O)C=C1 | StdInChI = 1S/C14H21NO/c1-4-6-13(15-5-2)14(16)12-9-7-11(3)8-10-12/h7-10,13,15H,4-6H2,1-3H3 | StdInChIKey = IKIANZXWCBSIGA-UHFFFAOYSA-N }}
'''4-Methyl-α-ethylaminopentiophenone''' ('''4-MEAP''') is a designer drug of the cathinone class.<ref>{{cite journal | vauthors = Varma A, Patel N, Ford L, Jones R, Vale JA | title = Misuse of 2-(ethylamino)-1-(4-methylphenyl)-1-pentanone (4-MEAP), a synthetic cathinone | journal = Clinical Toxicology | volume = 55 | issue = 3 | pages = 231–232 | date = March 2017 | pmid = 28074662 | doi = 10.1080/15563650.2016.1271132 | s2cid = 40402609 }}</ref><ref>{{cite journal | vauthors = Rojkiewicz M, Kuś P, Kusz J, Książek M | title = Spectroscopic and crystallographic characterization of two cathinone derivatives: 1-(4-fluorophenyl)-2-(methylamino)pentan-1-one (4-FPD) hydrochloride and 1-(4-methylphenyl)-2-(ethylamino)pentan-1-one (4-MEAP) hydrochloride | journal = Forensic Toxicology | volume = 36 | issue = 1 | pages = 141–150 | year = 2018 | pmid = 29367865 | pmc = 5754380 | doi = 10.1007/s11419-017-0393-6 }}</ref> It is a higher homolog of 4-methylpentedrone (4-MPD) with an ethyl group in place of the methyl group. 4-MEAP has been found in samples of drugs sold as 4-MPD.<ref>{{cite journal | vauthors = Hamby D, Burnett A, Jablonsky M, Twamley B, Kavanagh PV, Gardner EA | title = Identification of 2-(ethylamino)-1-(4-methylphenyl)-1-pentanone (4-MEAP), a New "Legal High" Sold by an Internet Vendor as 4-Methyl Pentedrone | journal = Journal of Forensic Sciences | volume = 60 | issue = 3 | pages = 721–6 | date = May 2015 | pmid = 25923458 | doi = 10.1111/1556-4029.12712 | s2cid = 19336157 }}</ref>
In the United States, 4-MEAP is a Schedule I Controlled Substance.<ref name="DEA-Apr-2019">{{cite web | title = Schedules of Controlled Substances: Temporary Placement of N-Ethylhexedrone, α-PHP, 4-MEAP, MPHP, PV8, and 4-Chloro-α-PVP in Schedule I | url = https://www.deadiversion.usdoj.gov/fed_regs/rules/2019/fr0501.htm | publisher = Drug Enforcement Administration | access-date = 2019-07-31 | archive-date = 2021-04-30 | archive-url = https://web.archive.org/web/20210430020931/https://www.deadiversion.usdoj.gov/fed_regs/rules/2019/fr0501.htm | url-status = dead }}</ref><ref>{{cite journal | vauthors = Varma A, Patel N, Ford L, Jones R, Vale JA | title = Misuse of 2-(ethylamino)-1-(4-methylphenyl)-1-pentanone (4-MEAP), a synthetic cathinone | journal = Clinical Toxicology | volume = 55 | issue = 3 | pages = 231–232 | date = March 2017 | pmid = 28074662 | doi = 10.1080/15563650.2016.1271132 }}</ref>
== See also ==
* N-Ethylpentedrone * Pentedrone
== References == {{reflist}}
{{Stimulants}}
{{DEFAULTSORT:Methyl-α-ethylaminopentiophenone, 4-}} Category:Designer drugs Category:Cathinones