{{Chembox | ImageFile = 3-Aminopentane.png | ImageSize = | ImageAlt = | PIN = Pentan-3-amine | OtherNames = |Section1={{Chembox Identifiers | CASNo = 616-24-0 | PubChem = 12019 | EINECS = 210-471-6 | ChEBI = 84248 | ChEMBL = 14178 | DTXSID = DTXSID8060662 | UNII = 3N2IT605HV | ChemSpiderID = 11524 | SMILES = CCC(CC)N | StdInChI=1S/C5H13N/c1-3-5(6)4-2/h5H,3-4,6H2,1-2H3 | StdInChIKey = PQPFFKCJENSZKL-UHFFFAOYSA-N }} |Section2={{Chembox Properties | C=5|H=13|N=1 | MolarMass = | Appearance = Colorless liquid | Density = 0.7479 g/cm<sup>3</sup> | MeltingPtC = | BoilingPtC = 89 | Solubility = }} |Section3={{Chembox Hazards | GHSPictograms = {{GHS02}}{{GHS05}} | GHSSignalWord = Danger | HPhrases = {{H-phrases|225|314}} | PPhrases = {{P-phrases|210|233|240|241|242|243|260|264|280|301+330+331|303+361+353|304+340|305+351+338|310|321|363|370+378|403+235|405|501}} | MainHazards = | FlashPt = | AutoignitionPt = }} }} '''3-Aminopentane''' is the organic compound with the formula (CH<sub>3</sub>CH<sub>2</sub>)<sub>2</sub>CHNH<sub>2</sub>. It is a colorless liquid. It is of interest for producing soluble imides and imines without introducing a chiral center.<ref>{{cite journal|title=Very soluble and Photostable perylene Fluorescent Dyes|last1=Demmig|first1=Stefan|last2=Langhals|first2=Heinz|journal=Chemische Berichte|year=1988|volume=121|page=225–30|doi=10.1002/cber.19881210205|url=http://nbn-resolving.de/urn:nbn:de:bvb:19-epub-3688-5|url-access=subscription}}</ref>
==Safety== The {{LD50}} (rat, oral or dermal) for primary alkylamines is 100-1 mg/kg.<ref name=Ullmann>{{Ullmann|first1=Karsten|last1=Eller|first2=Erhard|last2=Henkes|first3=Roland|last3=Rossbacher|first4=Hartmut|last4=Höke|title=Amines, Aliphatic|year=2005|doi=10.1002/14356007.a02_001}}</ref>{{clarify|What does 100-1 mean?|date=September 2025}}
==See also== * 1-Aminopentane
==References== <references />
{{DEFAULTSORT:Aminopentane, 3-}} Category:Alkylamines