{{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = | Reference = | Name = 3′-Hydroxyechinenone | ImageFile = 3'-Hydroxyechinenone.svg | ImageSize = 250px | ImageAlt = | IUPACName = (3′''R'')-3′-Hydroxy-β,β-caroten-4-one | SystematicName = 3-{(1''E'',3''E'',5''E'',7''E'',9''E'',11''E'',13''E'',15''E'',17''E'')-18-[(4''R'')-4-Hydroxy-2,6,6-trimethylcyclohex-1-en-1-yl]-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonen-1-yl}-2,4,4-trimethylcyclohex-2-en-1-one | OtherNames = LMPR01070098; 3'-OH-Echinenone; C15965 |Section1={{Chembox Identifiers | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | UNII_Ref = {{fdacite|correct|FDA}} | UNII = | ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL = | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | CASNo_Ref = {{cascite|correct|CAS}} | CASNo = | PubChem = 16061233 | ChEBI_Ref = {{ebicite|changed|EBI}} | ChEBI = 80214 | KEGG = C15965 | ChemSpiderID = 17220910 | SMILES = CC1=C(C(C[C@@H](C1)O)(C)C)/C=C/C(=C/C=C/C(=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/C2=C(C(=O)CCC2(C)C)C)/C)/C | StdInChI = 1S/C40H54O2/c1-29(17-13-19-31(3)21-23-36-33(5)27-35(41)28-40(36,9)10)15-11-12-16-30(2)18-14-20-32(4)22-24-37-34(6)38(42)25-26-39(37,7)8/h11-24,35,41H,25-28H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,29-15+,30-16+,31-19+,32-20+/t35-/m1/s1 | StdInChIKey = ZRCXVNZZDQGBQT-BANQPSJHSA-N }} |Section2={{Chembox Properties | C=40|H=54|O=2 | Appearance = | Density = | MeltingPtC = | MeltingPt_notes = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}

'''3′-Hydroxyechinenone''' is a keto-carotenoid pigment found in cyanobacteria and microalgae.<ref name="Grung et al. 1989"/> Carotenoids belong to a larger class of phytochemicals known as terpenoids. The chemical formula of canthaxanthin is C<sub>40</sub>H<sub>54</sub>O<sub>2</sub>. It is found non-covalently bound in the orange carotenoid protein (OCP), which is a soluble protein involved in photoprotection and non-photochemical quenching of photosynthesis.<ref name="KirilovskyKerfeld2013" />

==References== {{reflist| refs= <ref name="KirilovskyKerfeld2013">{{cite journal|last1=Kirilovsky|first1=Diana|last2=Kerfeld|first2=Cheryl A.|title=The orange carotenoid protein: A blue-green light photoactive protein|journal=Photochemical & Photobiological Sciences|volume=12|issue=7|year=2013|pages=1135–43|issn=1474-905X|doi=10.1039/c3pp25406b|pmid=23396391|doi-access=free}}</ref> <ref name="Grung et al. 1989">{{cite journal|title=Primary and secondary carotenoids in two races of the green alga ''Botryococcus braunii''|journal=Biochemical Systematics and Ecology|volume=17|issue=4|year=1989|pages=263–269|doi=10.1016/0305-1978(89)90001-x | last1 = Grung | first1 = Merete | last2 = Metzger | first2 = Pierre | last3 = Liaaen-jensen | first3 = Synnove|authorlink3=Synnøve Liaaen Jensen}}</ref> }}

{{DEFAULTSORT:Hydroxyechinenone, 3'-}} Category:Carotenoids Category:Cyclohexenes