{{Chembox | ImageFile = Propane-2-thiol 200.svg | ImageClass = skin-invert | OtherNames = {{ubl|2-Propanethiol|Propane-2-thiol|2-propanthiol|2-propane thiol|Isopropyl mercaptan|Isopropanethiol|Isopropylthiol|2-Mercaptopropane|2-Propylmercaptan|1-Methylethanethiol}} |Section1={{Chembox Identifiers | CASNo = 75-33-2 | Beilstein = 605260 | ChEBI = 8474 | ChEMBL = 1897156 | ChemSpiderID = 6124 | EC_number = 200-861-4 | KEGG = C08391 | PubChem = 6364 | UNNumber = 2402 | UNII = E52LR62ETC | StdInChI=1S/C3H8S/c1-3(2)4/h3-4H,1-2H3 | StdInChIKey = KJRCEJOSASVSRA-UHFFFAOYSA-N | SMILES = CC(C)S }} |Section2={{Chembox Properties | C=3|H=8|S=1 | BoilingPtC = 52.5 | MeltingPtC = -130.7 | Solubility = 4835 g/L<ref>'''See: [https://en.wikipedia.org/wiki/Talk:Isopropyl_mercaptan#Solubility Talkpage]'''</ref> | Density = 0.8143 | VaporPressure = 277.3 mm Hg }} |Section7={{Chembox Hazards | GHS_ref=<ref>{{cite web |title=2-Propanethiol |url=https://pubchem.ncbi.nlm.nih.gov/compound/6364#section=Safety-and-Hazards |website=pubchem.ncbi.nlm.nih.gov |language=en}}</ref> | GHSPictograms = {{GHS02}}{{GHS06}}{{GHS07}} | GHSSignalWord = Danger | HPhrases = {{H-phrases|225|302|315|319|331}} | PPhrases = {{P-phrases|210|233|240|241|242|243|261|264|264+265|270|271|280|301+317|302+352|303+361+353|304+340|305+351+338|316|321|330|332+317|337+317|362+364|370+378|403+233|403+235|405|501}} }} |Section8={{Chembox Related | OtherCompounds = 1-Propanethiol }} }}
'''Isopropyl mercaptan''' is a thiol with the formula C<sub>3</sub>H<sub>8</sub>S. It is a water-white{{Clarify|reason=What does "water-white" mean?|date=July 2024}} liquid with an extremely pungent odor resembling skunk spray or rotten eggs. The pungent smell allows it to be used as an odorizer.<ref>{{Cite journal |last1=Michanowicz |first1=Drew R. |last2=Leventhal |first2=Olivia M. |last3=Domen |first3=Jeremy K. |last4=Williams |first4=Samuel R. |last5=Lebel |first5=Eric D. |last6=Hill |first6=Lee Ann L. |last7=Buonocore |first7=Jonathan J. |last8=Nordgaard |first8=Curtis L. |last9=Bernstein |first9=Aaron S. |last10=Shonkoff |first10=Seth B.C. |date=2023-07-25 |title=Natural gas odorants: A scoping review of health effects |journal=Current Environmental Health Reports |language=en |volume=10 |issue=3 |pages=337–352 |doi=10.1007/s40572-023-00403-w |pmid=37491689 |pmc=10504204 |s2cid=260163457 |issn=2196-5412|doi-access=free }}</ref> The FDA has approved it for use as a food additive for its flavor.<ref>{{Cite web |last=PubChem |title=2-Propanethiol Flavor profile |url=https://pubchem.ncbi.nlm.nih.gov/compound/6364 |access-date=2023-09-15 |website=pubchem.ncbi.nlm.nih.gov |language=en}}</ref> Another use is as a rubber additive.<ref>{{Cite journal |last1=Li |first1=Zhiwei |last2=An |first2=Dong |last3=He |first3=Rizheng |last4=Sun |first4=Zhijian |last5=Li |first5=Jiaxiong |last6=Zhang |first6=Zhiyi |last7=Liu |first7=Yaqing |last8=Wong |first8=Chingping |date=April 2023 |title=The design of crosslinks in different vulcanized systems to improve crack growth resistance for carbon black/graphene oxide/natural rubber composites |url=https://link.springer.com/10.1007/s42114-023-00662-z |journal=Advanced Composites and Hybrid Materials |language=en |volume=6 |issue=2 |doi=10.1007/s42114-023-00662-z |s2cid=258137193 |issn=2522-0128|url-access=subscription }}</ref>
==See also== * 1-Propanethiol
==References== <references/>
Category:Alkanethiols Category:Foul-smelling chemicals