# Vesugen

> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/Vesugen
> Markdown URL: https://mediated.wiki/source/Vesugen.md
> Source: https://en.wikipedia.org/wiki/Vesugen
> Source revision: 1333160400
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)

{{cs1 config|name-list-style=vanc|display-authors=6}}
{{Infobox drug
| image = Vesugen_structure.png
| image_class = skin-invert-image
| width = 220
<!-- Clinical data -->
| tradename = 
| pregnancy_category = 
| routes_of_administration = 
| class = 
| ATC_prefix = 
| ATC_suffix = 
| ATC_supplemental = <!-- Legal status -->
| legal_status = <!-- Pharmacokinetic data -->
| bioavailability = 
| protein_bound = 
| metabolism = 
| metabolites = 
| onset = 
| elimination_half-life = 
| duration_of_action = 
| excretion = <!-- Identifiers -->
| CAS_number = 204271-66-9
| PubChem = 87571363
| IUPHAR_ligand = 
| DrugBank = 
| ChemSpiderID = 16572739
| UNII = 
| KEGG = 
| ChEBI = 159909
| ChEMBL = 
| NIAID_ChemDB = 
| PDB_ligand = <!-- Chemical and physical data -->
| IUPAC_name = (2''S'')-2-<nowiki>[[</nowiki>(2''S'')-4-carboxy-2-<nowiki>[[</nowiki>(2''S'')-2,6-diaminohexanoyl]amino]butanoyl]amino]butanedioic acid
| C = 15
| H = 26
| N = 4
| O = 8
| StdInChI = 1S/C15H26N4O8/c16-6-2-1-3-8(17)13(24)18-9(4-5-11(20)21)14(25)19-10(15(26)27)7-12(22)23/h8-10H,1-7,16-17H2,(H,18,24)(H,19,25)(H,20,21)(H,22,23)(H,26,27)/t8-,9-,10-/m0/s1
| StdInChIKey = LLSUNJYOSCOOEB-GUBZILKMSA-N
| SMILES = C(CCN)C[C@@H](C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)O)N
}}

'''Vesugen''' ('''T-38''') is a [tripeptide](/source/tripeptide) with the sequence '''KED''' or Lys-Glu-Asp. It is one of a number of small peptides developed in Russia in the late 1990s and early 2000s<ref>{{cite patent | inventor = Khavinson VK, Grigor'ev EI, Malinin VV, Ryzhak GA | title = Peptide enhancing resistance of capillaries, pharmaceutical composition based on thereof and method for its use | country = RU | number = 2295970 | url = https://patents.google.com/patent/RU2295970C1/en?oq=RU2295970C1 | assign = SIA Peptaids | gdate = 27 March 2007 }}</ref> which are purported to have anti-aging effects.<ref>{{cite journal | vauthors = Khavinson VK, Linkova NS, Polyakova VO, Kheifets OV, Tarnovskaya SI, Kvetnoy IM | title = Peptides tissue-specifically stimulate cell differentiation during their aging | journal = Bulletin of Experimental Biology and Medicine | volume = 153 | issue = 1 | pages = 148–151 | date = May 2012 | pmid = 22808515 | doi = 10.1007/s10517-012-1664-1 }}</ref><ref>{{cite journal | vauthors = Ashapkin V, Khavinson V, Shilovsky G, Linkova N, Vanuyshin B | title = Gene expression in human mesenchymal stem cell aging cultures: modulation by short peptides | journal = Molecular Biology Reports | volume = 47 | issue = 6 | pages = 4323–4329 | date = June 2020 | pmid = 32399807 | doi = 10.1007/s11033-020-05506-3 }}</ref> Vesugen is claimed to stimulate proliferation and protein synthesis in [fibroblast](/source/fibroblast) cells in the skin and to improve the appearance of skin,<ref>{{cite journal | vauthors = Voicekhovskaya MA, Chalisova NI, Kontsevaya EA, Ryzhak GA | title = Effect of bioregulatory tripeptides on the culture of skin cells from young and old rats | journal = Bulletin of Experimental Biology and Medicine | volume = 152 | issue = 3 | pages = 357–359 | date = January 2012 | pmid = 22803085 | doi = 10.1007/s10517-012-1527-9 }}</ref><ref>{{cite journal | vauthors = Lin'kova NS, Drobintseva AO, Orlova OA, Kuznetsova EP, Polyakova VO, Kvetnoy IM, Khavinson VK | title = Peptide Regulation of Skin Fibroblast Functions during Their Aging In Vitro | journal = Bulletin of Experimental Biology and Medicine | volume = 161 | issue = 1 | pages = 175–178 | date = May 2016 | pmid = 27259496 | doi = 10.1007/s10517-016-3370-x }}</ref> as well as promoting neurotropic effects in brain tissue,<ref>{{cite journal | vauthors = Caputi S, Trubiani O, Sinjari B, Trofimova S, Diomede F, Linkova N, Diatlova A, Khavinson V | title = Effect of short peptides on neuronal differentiation of stem cells | journal = International Journal of Immunopathology and Pharmacology | volume = 33 | date = 2019 | pmid = 30791821 | pmc = 6376556 | doi = 10.1177/2058738419828613 | article-number = 2058738419828613 }}</ref><ref>{{cite journal | vauthors = Khavinson VK, Lin'kova NS, Umnov RS | title = Peptide KED: Molecular-Genetic Aspects of Neurogenesis Regulation in Alzheimer's Disease | journal = Bulletin of Experimental Biology and Medicine | volume = 171 | issue = 2 | pages = 190–193 | date = May 2021 | pmid = 34173097 | doi = 10.1007/s10517-021-05192-6 }}</ref><ref>{{cite journal | vauthors = Kraskovskaya N, Linkova N, Sakhenberg E, Krieger D, Polyakova V, Medvedev D, Krasichkov A, Khotin M, Ryzhak G | title = Short Peptides Protect Fibroblast-Derived Induced Neurons from Age-Related Changes | journal = International Journal of Molecular Sciences | volume = 25 | issue = 21 | article-number = 11363 | date = October 2024 | pmid = 39518916 | pmc = 11546785 | doi = 10.3390/ijms252111363 | doi-access = free }}</ref> giving it a similar pharmacological profile to those claimed for the [matrikine](/source/matrikine) peptides produced by Western cosmetic skincare companies.

== See also ==
* [Cortagen](/source/Cortagen)
* [Epitalon](/source/Epitalon)
* [GHK-Cu](/source/GHK-Cu)
* [KPV tripeptide](/source/KPV_tripeptide)
* [Livagen](/source/Livagen)
* [Pinealon](/source/Pinealon)
* [Vladimir Khavinson](/source/Vladimir_Khavinson)

== References ==
{{Reflist}}

Category:Tricarboxylic acids
Category:Tripeptides

---
Adapted from the Wikipedia article [Vesugen](https://en.wikipedia.org/wiki/Vesugen) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/Vesugen?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.