# Tiomesterone

> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/Tiomesterone
> Markdown URL: https://mediated.wiki/source/Tiomesterone.md
> Source: https://en.wikipedia.org/wiki/Tiomesterone
> Source revision: 1329021084
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)

{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 444438134
| IUPAC_name = ''S''-[(1''S'',7''R'',8''S'',9''S'',10''R'',13''S'',14''S'',17''S'')-1-acetylsulfanyl-17-hydroxy-10,13,17-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1''H''-cyclopenta[a]phenanthren-7-yl] ethanethioate
| image = Tiomesterone structure.svg
| image_class = skin-invert-image
| width = 250

<!--Clinical data-->
| tradename = Emdabol, Embadol, Emdabolin, Protabol
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B            / C / D / X -->
| pregnancy_category = 
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = 
| legal_UK = 
| legal_US = 
| legal_status = 
| routes_of_administration = [Oral](/source/Oral_administration)

<!--Pharmacokinetic data-->
| bioavailability = 
| protein_bound = 
| metabolism = 
| elimination_half-life = 
| excretion =

<!-- Identifiers -->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 2205-73-4
| CAS_supplemental = 
| ATC_prefix = 
| ATC_suffix = 
| ATC_supplemental = 
| PubChem = 16626
| IUPHAR_ligand = 
| DrugBank_Ref = 
| DrugBank = 
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 15763
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = W5K3712F4H
| KEGG = 
| ChEBI = 
| ChEMBL = 

<!--Chemical data-->
| C=24 | H=34 | O=4 | S=2
| SMILES=CC(=O)S[C@@H]1CC2=CC(=O)C[C@@H]([C@@]2([C@@H]3[C@@H]1[C@@H]4CC[C@]([C@]4(CC3)C)(C)O)C)SC(=O)C
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C24H34O4S2/c1-13(25)29-19-11-15-10-16(27)12-20(30-14(2)26)24(15,5)18-6-8-22(3)17(21(18)19)7-9-23(22,4)28/h10,17-21,28H,6-9,11-12H2,1-5H3/t17-,18-,19+,20-,21-,22-,23-,24-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = YUOZKOLALXNELS-SQVYRKCQSA-N
| synonyms = Thiomesterone; Thiomestrone; StA 307
}}

'''Tiomesterone''' ([INN](/source/International_Nonproprietary_Name), [JAN](/source/Japanese_Accepted_Name); '''thiomesterone''' ([BAN](/source/British_Approved_Name)); also known as '''1α,7α-bis(acetylthio)-17α-methylandrost-4-en-17β-ol-3-one'''; developmental code '''StA 307'''; brand names '''Emdabol''', '''Embadol''', '''Emdabolin''', and '''Protabol''') is a [synthetic](/source/synthetic_compound), [orally active](/source/oral_administration) [anabolic-androgenic steroid](/source/anabolic-androgenic_steroid) (AAS) and a [17α-alkylated](/source/17%CE%B1-alkylated_anabolic_steroid) [derivative](/source/chemical_derivative) of [testosterone](/source/testosterone).<ref name="Elks2014">{{cite book | vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PR2|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|page=1188}}</ref> It was described in 1963.<ref name="Elks2014" />

==References==
{{Reflist|2}}

{{Androgens and antiandrogens}}
{{Androgen receptor modulators}}

Category:Androgens
Category:Androstanes
Category:Hepatotoxins
Category:Thioesters

{{Androgen-stub}}
{{genito-urinary-drug-stub}}

---
Adapted from the Wikipedia article [Tiomesterone](https://en.wikipedia.org/wiki/Tiomesterone) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/Tiomesterone?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.
