# Telenzepine

> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/Telenzepine
> Markdown URL: https://mediated.wiki/source/Telenzepine.md
> Source: https://en.wikipedia.org/wiki/Telenzepine
> Source revision: 1329183785
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)

{{Short description|Chemical compound}}
{{Drugbox
| IUPAC_name = 1-methyl-10-[2-(4-methylpiperazin-1-yl)acetyl]-5''H''-thieno[3,4-''b''][1,5]benzodiazepin-4-one
| image = Telenzepine.svg
| image_class = skin-invert-image
| width = 190

<!--Clinical data-->
| tradename =  
| pregnancy_category =  
| legal_status =  
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability = 
| protein_bound = 
| metabolism = 
| elimination_half-life = 
| excretion =

<!--Identifiers-->
| CAS_number = 80880-90-6
| ATC_prefix = None
| ATC_suffix = 
| PubChem = 5387
| DrugBank = 
| ChemSpiderID = 5194
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 0990EG3K10
| ChEMBL = 253978

<!--Chemical data-->
|C=19 |H=22 |N=4 |O=2 |S=1

| smiles = C1CN(C)CCN1CC(=O)N2c3ccccc3NC(=O)c4csc(C)c42
| StdInChI = 1S/C19H22N4O2S/c1-13-18-14(12-26-13)19(25)20-15-5-3-4-6-16(15)23(18)17(24)11-22-9-7-21(2)8-10-22/h3-6,12H,7-11H2,1-2H3,(H,20,25)
| StdInChIKey = VSWPGAIWKHPTKX-UHFFFAOYSA-N
}}

'''Telenzepine''' is a [thienobenzodiazepine](/source/thienobenzodiazepine) acting as selective [M<sub>1</sub>](/source/Muscarinic_acetylcholine_receptor_M1) [antimuscarinic](/source/antimuscarinic). It is used in the treatment of peptic ulcers.<ref name=Eveleigh>{{cite journal | vauthors = Eveleigh P, Hulme EC, Schudt C, Birdsall NJ | title = The existence of stable enantiomers of telenzepine and their stereoselective interaction with muscarinic receptor subtypes | journal = Molecular Pharmacology | volume = 35 | issue = 4 | pages = 477–83 | date = April 1989 | doi = 10.1016/S0026-895X(25)11262-5 | pmid = 2704371 }}</ref> Telenzepine is [atropisomer](/source/atropisomer)ic, in other words the molecule has a stereogenic C–N-axis. In neutral aqueous solution it displays a half-life for racemization of the order of 1000 years. The enantiomers have been resolved. The activity is related to the (+)-isomer which is about 500-fold more active than the (–)-isomer at muscarinic receptors in the rat cerebral cortex.<ref name=Clayden>{{cite journal | vauthors = Clayden J, Moran WJ, Edwards PJ, LaPlante SR | title = The challenge of atropisomerism in drug discovery | journal = Angewandte Chemie | volume = 48 | issue = 35 | pages = 6398–401 | year = 2009 | pmid = 19637174 | doi = 10.1002/anie.200901719 | bibcode = 2009ACIE...48.6398C }}</ref>

== See also ==
* [Pirenzepine](/source/Pirenzepine)

== References ==
{{Reflist}}

== External links ==
{{refbegin}}
* {{cite journal | vauthors = Londong W, Londong V, Meierl A, Voderholzer U | title = Telenzepine is at least 25 times more potent than pirenzepine--a dose response and comparative secretory study in man | journal = Gut | volume = 28 | issue = 7 | pages = 888–95 | date = July 1987 | pmid = 3653758 | pmc = 1433086 | doi = 10.1136/gut.28.7.888 }}
{{refend}}

{{Muscarinic acetylcholine receptor modulators}}
{{Tricyclics}}
{{Benzodiazepines}}
{{Drugs for peptic ulcer and GORD}}

Category:4-Methylpiperazin-1-yl compounds
Category:Carboxamides
Category:Lactams
Category:M1 receptor antagonists
Category:Thienobenzodiazepines

{{gastrointestinal-drug-stub}}

---
Adapted from the Wikipedia article [Telenzepine](https://en.wikipedia.org/wiki/Telenzepine) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/Telenzepine?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.