# Stipitatic acid

> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/Stipitatic_acid
> Markdown URL: https://mediated.wiki/source/Stipitatic_acid.md
> Source: https://en.wikipedia.org/wiki/Stipitatic_acid
> Source revision: 1245735883
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)

{{Chembox
| Name = Stipitatic acid
| ImageFile = Stipitatic acid.svg
| ImageSize = 150px
| ImageName = Chemical structure of stipitatic acid
| ImageAlt = Chemical structure of stipitatic acid
| PIN = 3,6-Dihydroxy-5-oxocyclohepta-1,3,6-triene-1-carboxylic acid
| OtherNames = 
|Section1={{Chembox Identifiers
| CASNo = 4440-39-5
| CASNo_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 35DNB4NP54
| Beilstein = 2723909
| ChEBI = 15957
| ChemSpiderID = 19955692
| KEGG = C01853
| PubChem = 20501
| SMILES = C1=C(C=C(C(=CC1=O)O)O)C(=O)O
| StdInChI = 1S/C8H6O5/c9-5-1-4(8(12)13)2-6(10)7(11)3-5/h1-3,10-11H,(H,12,13) }}
|Section2={{Chembox Properties
| C=8 | H=6 | O=5
| Appearance = 
| Density = 
| MeltingPt = 
| BoilingPt = 
| Solubility = }}
|Section3={{Chembox Hazards
| MainHazards = 
| FlashPt = 
| AutoignitionPt = }}
}}

'''Stipitatic acid''' is a [tropolone](/source/tropolone) derivative isolated from ''[Talaromyces stipitatus](/source/Talaromyces_stipitatus)'' (''Penicillium stipitatum'').<ref>{{cite journal |last1=Davison |first1=J. |last2=al Fahad |first2=A. |last3=Cai |first3=M. |last4=Song |first4=Z. |last5=Yehia |first5=S. Y. |last6=Lazarus |first6=C. M. |last7=Bailey |first7=A. M. |last8=Simpson |first8=T. J. |last9=Cox |first9=R. J. |title=Genetic, molecular, and biochemical basis of fungal tropolone biosynthesis |journal=Proceedings of the National Academy of Sciences |date=15 May 2012 |volume=109 |issue=20 |pages=7642–7647 |doi=10.1073/pnas.1201469109|doi-access=free |pmid=22508998 |pmc=3356636 }}</ref>

==References==
{{reflist}}

Category:Tropolones
Category:Tropones
Category:Aromatic compounds

{{aromatic-stub}}

---
Adapted from the Wikipedia article [Stipitatic acid](https://en.wikipedia.org/wiki/Stipitatic_acid) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/Stipitatic_acid?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.