# Sepetaprost

> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/Sepetaprost
> Markdown URL: https://mediated.wiki/source/Sepetaprost.md
> Source: https://en.wikipedia.org/wiki/Sepetaprost
> Source revision: 1332898082
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)

{{Short description|Chemical compound}}
{{cs1 config|name-list-style=vanc|display-authors=6}}
{{Infobox drug
| drug_name = 
| image = Sepetaprost.svg
| image_class = skin-invert-image
| width = 
| caption =

<!-- Clinical data -->
| pronounce = 
| tradename = 
| Drugs.com = 
| MedlinePlus = 
| licence_CA = 
| licence_EU = 
| DailyMedID = 
| licence_US = 
| pregnancy_AU = 
| pregnancy_category = 
| dependency_liability = 
| addiction_liability = 
| routes_of_administration = 
| class = 
| ATC_prefix = 
| ATC_suffix =

<!-- Legal status -->
| legal_status = Investigational

<!-- Pharmacokinetic data -->
| bioavailability = 
| protein_bound = 
| metabolism = 
| metabolites = 
| onset = 
| elimination_half-life = 
| duration_of_action = 
| excretion =

<!-- Identifiers -->
| CAS_number = 1262873-06-2
| CAS_supplemental = 
| PubChem = 50902259
| IUPHAR_ligand = 9875
| DrugBank = DB12043
| ChemSpiderID = 32698273
| UNII = 79O7855J4G
| KEGG = D12617
| ChEBI = 
| ChEMBL = 4297633
| NIAID_ChemDB = 
| PDB_ligand = 
| synonyms = STN-1012600

<!-- Chemical data -->
| IUPAC_name = propan-2-yl 4-[(3S,5aR,6R,7R,8aS)-6-[(E,3R)-4-(2,5-difluorophenoxy)-3-hydroxybut-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]butanoate
| C=26 | H=36 | F=2 | O=6
| SMILES = CC(C)OC(=O)CCC[C@H]1CC[C@H]2[C@H](C[C@H]([C@@H]2/C=C/[C@H](COC3=C(C=CC(=C3)F)F)O)O)OC1
| StdInChI = 1S/C26H36F2O6/c1-16(2)34-26(31)5-3-4-17-6-9-21-20(23(30)13-24(21)32-14-17)10-8-19(29)15-33-25-12-18(27)7-11-22(25)28/h7-8,10-12,16-17,19-21,23-24,29-30H,3-6,9,13-15H2,1-2H3/b10-8+/t17-,19+,20+,21+,23+,24-/m0/s1
| StdInChIKey = BKVUSNOUTQMSBE-XCMGCKIWSA-N
}}
'''Sepetaprost''' is an [investigational new drug](/source/investigational_new_drug) that is being evaluated for the treatment of [open angle glaucoma](/source/open_angle_glaucoma) and [ocular hypertension](/source/ocular_hypertension).<ref>{{cite web | title = Sepetaprost - Santen Pharmaceutical | url = https://adisinsight.springer.com/drugs/800035556 | work = AdisInsight | publisher = Springer Nature Switzerland AG }}</ref>  It is an agonist of the prostaglandin [EP3](/source/prostaglandin_EP3_receptor) and [F receptors](/source/Prostaglandin_F_receptor).<ref name="Sharif_2023">{{cite journal | vauthors = Sharif NA, Odani-Kawabata N, Lu F, Pinchuk L | title = FP and EP2 prostanoid receptor agonist drugs and aqueous humor outflow devices for treating ocular hypertension and glaucoma | journal = Experimental Eye Research | volume = 229 | issue = | article-number = 109415 | date = April 2023 | pmid = 36803996 | doi = 10.1016/j.exer.2023.109415 }}</ref>

As of 2025 Sepetaprost is registered in Japan as Setaneo<ref>{{Cite web |title=Santen Launches SETANEO® |url=https://www.santen.com/en/news/2025/2025_1/20251023 |url-status=live}}</ref> ophthalmic solution 0.002%, sold by [Santen Pharmaceuticals](/source/Santen_Pharmaceutical).  It is indicated for the treatment of glaucoma and ocular hypertension.

== References ==
{{reflist}}

Category:Oxepanes
Category:Fluoroarenes
Category:Isopropyl esters
Category:Diols

{{Authority control|qid=Q27266770}}
{{Pharma-stub}}

---
Adapted from the Wikipedia article [Sepetaprost](https://en.wikipedia.org/wiki/Sepetaprost) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/Sepetaprost?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.