# SDB-005

> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/SDB-005
> Markdown URL: https://mediated.wiki/source/SDB-005.md
> Source: https://en.wikipedia.org/wiki/SDB-005
> Source revision: 1292671672
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)

{{Short description|Chemical compound}}
{{Drugbox
| IUPAC_name = Naphthalen-1-yl 1-pentyl-1''H''-indazole-3-carboxylate
| image = SDB-005_structure.png
| image_class = skin-invert-image
| width = 180

<!--Clinical data-->
| tradename =  
| pregnancy_AU = 
| pregnancy_US = 
| pregnancy_category =  
| legal_AU = 
| legal_CA = Schedule II
| legal_DE = NpSG
| legal_UK = Class B
| legal_US = 
| legal_status = 
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability =  
| protein_bound =  
| metabolism =  
| elimination_half-life =  
| excretion =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 2180934-13-6
| ATC_prefix =  
| ATC_suffix =  
| PubChem =  125181303
| ChemSpiderID      = 30922481
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = Z6XWV5U765
| smiles            = CCCCCN1N=C(C(=O)OC2=CC=CC3=C2C=CC=C3)C2=C1C=CC=C2
| StdInChI          = 1S/C23H22N2O2/c1-2-3-8-16-25-20-14-7-6-13-19(20)22(24-25)23(26)27-21-15-9-11-17-10-4-5-12-18(17)21/h4-7,9-15H,2-3,8,16H2,1H3
| StdInChIKey       = JBVNFKZVDLFOAY-UHFFFAOYSA-N

<!--Chemical data-->
| C=23 | H=22 | N=2 | O=2 
}}

'''SDB-005''' (also known as '''NA-PINAC''' using systematic [EUDA](/source/European_Union_Drugs_Agency) nomenclature)<ref>{{cite journal |vauthors=Pulver B, Fischmann S, Gallegos A, Christie R |date=March 2023 |title=EMCDDA framework and practical guidance for naming synthetic cannabinoids |url=https://www.euda.europa.eu/drugs-library/emcdda-framework-and-practical-guidance-naming-synthetic-cannabinoids_en |journal=Drug Testing and Analysis |volume=15 |issue=3 |pages=255–276 |doi=10.1002/dta.3403 |pmid=36346325|url-access=subscription }}</ref> is an [indazole](/source/indazole)-based [synthetic cannabinoid](/source/synthetic_cannabinoid) that has been sold online as a [designer drug](/source/designer_drug).<ref>{{cite web | url=https://www.caymanchem.com/app/template/Product.vm/catalog/15389 | title=SDB-005 | publisher=Cayman Chemical | access-date=27 June 2015}}</ref> It is presumed to be an agonist of the CB<sub>1</sub> and CB<sub>2</sub> cannabinoid receptors. SDB-005 is the indazole core [analog](/source/structural_analog) of [PB-22](/source/PB-22) where the [8-hydroxyquinoline](/source/8-hydroxyquinoline) has also been replaced with a [naphthalene](/source/naphthalene) group.

The code number SDB-005 was originally used for a different compound, the ''N''-phenyl instead of ''N''-benzyl analogue of [SDB-006](/source/SDB-006). This compound is a potent [agonist](/source/agonist) of the [CB<sub>1</sub> receptor](/source/CB1_receptor) (K<sub>i</sub> = 21 nM) and [CB<sub>2</sub> receptor](/source/CB2_receptor) (K<sub>i</sub> = 140 nM).<ref>{{cite journal | vauthors = Banister SD, Wilkinson SM, Longworth M, Stuart J, Apetz N, English K, Brooker L, Goebel C, Hibbs DE, Glass M, Connor M, McGregor IS, Kassiou M | display-authors = 6 | title = The synthesis and pharmacological evaluation of adamantane-derived indoles: cannabimimetic drugs of abuse | journal = ACS Chemical Neuroscience | volume = 4 | issue = 7 | pages = 1081–92 | date = July 2013 | pmid = 23551277 | pmc = 3715837 | doi = 10.1021/cn400035r }}</ref>

class=skin-invert-image|200px|thumb|left|Original, non designer drug SDB-005{{clear left}}

However, SDB-005 was subsequently used as the name for the indazole-3-carboxylate compound mentioned above when it was sold in Europe as a [designer drug](/source/designer_drug), and was entered into the [EMCDDA](/source/EMCDDA) synthetic drug database under this name.<ref>[https://forum.goeg.at/EwsForum/default.aspx?g=posts&t=205 EWS_EU: Neue Psychoaktive Substanzen, April 2015]</ref> Consequently, there are now two distinct, yet fairly closely related cannabinoid compounds, which may both be referred to under the code SDB-005.

== See also ==
* [5F-PB-22](/source/5F-PB-22)
* [AM-2201](/source/AM-2201)
* [BB-22](/source/QUCHIC)
* [JWH-018](/source/JWH-018)
* [NM-2201](/source/NM-2201)
* [NNE1](/source/NNE1)

== References ==
{{Reflist}}

{{Cannabinoids}}
{{Cannabinoidergics}}

Category:Indazoles
Category:Cannabinoids
Category:Designer drugs

---
Adapted from the Wikipedia article [SDB-005](https://en.wikipedia.org/wiki/SDB-005) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/SDB-005?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.