# Renanolone

> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/Renanolone
> Markdown URL: https://mediated.wiki/source/Renanolone.md
> Source: https://en.wikipedia.org/wiki/Renanolone
> Source revision: 1338629461
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)

{{Short description|Chemical compound}}
{{Drugbox
| IUPAC_name        = 3α-hydroxy-5β-pregnane-11,20-dione
| image             = Renanolone.svg
| image_class       = skin-invert-image
| CAS_number        = 565-99-1
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = D8Z6E4IR2J
| ATC_prefix        = none
| ATC_suffix        = 
| PubChem           = 68930
| DrugBank          = 
| ChemSpiderID      = 62156
| C=21 | H=32 | O=3
| smiles            = CC(=O)[C@H]1CC[C@@H]2[C@@]1(CC(=O)[C@H]3[C@H]2CC[C@H]4[C@@]3(CC[C@H](C4)O)C)C
| StdInChI          = 1S/C21H32O3/c1-12(22)16-6-7-17-15-5-4-13-10-14(23)8-9-20(13,2)19(15)18(24)11-21(16,17)3/h13-17,19,23H,4-11H2,1-3H3/t13-,14-,15+,16-,17+,19-,20+,21-/m1/s1
| StdInChIKey       = DUHUCHOQIDJXAT-CSXWOMMHSA-N
| bioavailability   = 
| protein_bound     = 
| metabolism        = 
| elimination_half-life = 
| excretion         = 
| pregnancy_AU      =  <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US      =  <!-- A / B            / C / D / X -->
| pregnancy_category=  
| legal_AU =  <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA =  <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK =  <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US =  <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status      = 
| routes_of_administration = 
}}

'''Renanolone''' ([INN](/source/International_Nonproprietary_Name); also known as '''11-ketopregnanolone''' or '''5β-pregnan-3α-ol-11,20-dione''') is a [synthetic](/source/synthetic_compound){{Citation needed|date=December 2016}} [neuroactive steroid](/source/neuroactive_steroid) which is described as a [general anesthetic](/source/general_anesthetic), but was never introduced for clinical use.<ref name="HillMakin1991">{{cite book | vauthors = Hill RA, Makin HL, Kirk DN, Murphy GM | title = Dictionary of Steroids | url = https://books.google.com/books?id=qw5X0NK1A90C&pg=PA592 | date = 23 May 1991 | publisher = CRC Press | isbn = 978-0-412-27060-4 | page = 592}}</ref> Its [isomer](/source/isomer)s, [alfaxolone](/source/alfaxolone) and [alfadolone](/source/alfadolone), are also general anesthetics, and are known to act as [positive allosteric modulator](/source/positive_allosteric_modulator)s of the [GABA<sub>A</sub> receptor](/source/GABAA_receptor), a property which is likely the case for renanolone as well.

==Chemistry==
{{See also|List of neurosteroids}}

==See also==
* [Alfadolone](/source/Alfadolone)
* [Alfaxolone](/source/Alfaxolone)
* [Ganaxolone](/source/Ganaxolone)
* [Hydroxydione](/source/Hydroxydione)
* [Minaxolone](/source/Minaxolone)
* [Pregnanolone](/source/Pregnanolone)

==References==
{{Reflist}}

{{General anesthetics}}
{{GABAAR PAMs}}

Category:5β-Pregnanes
Category:General anesthetics
Category:Neurosteroids
Category:Secondary alcohols
Category:Diketones
Category:GABAA receptor positive allosteric modulators

{{Pregnanes-stub}}
{{Nervous-system-drug-stub}}

---
Adapted from the Wikipedia article [Renanolone](https://en.wikipedia.org/wiki/Renanolone) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/Renanolone?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.