# RAM-378

> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/RAM-378
> Markdown URL: https://mediated.wiki/source/RAM-378.md
> Source: https://en.wikipedia.org/wiki/RAM-378
> Source revision: 1314859833
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)

{{Short description|Chemical compound}}
{{Drugbox
| verifiedrevid = 451560012
| IUPAC_name = 3,6,14-trihydroxy-4,5α-epoxy-17-(2-phenylethyl)morphinan
| image = RAM-378.svg
| image_class = skin-invert-image
| width = 220

<!--Clinical data-->
| tradename =  
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B            / C / D / X -->
| pregnancy_category =  
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = <!--             / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL         / P       / POM / CD / Class A, B, C -->
| legal_US =  
| legal_status =  
| routes_of_administration =  

<!--Pharmacokinetic data-->
| bioavailability =  
| protein_bound =  
| metabolism =  
| elimination_half-life =  
| excretion =  

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 4778-96-5
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = JD4S8J3CMK
| ATC_prefix =  
| ATC_suffix =  
| PubChem = 5492826
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =  
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID      = 4591168 
| synonyms =  

<!--Chemical data-->
| C=24 | H=27 | N=1 | O=4 
| smiles = C1C[C@]2([C@H]3CC4=C5[C@@]2(CCN3CCC6=CC=CC=C6)[C@H]([C@H]1O)OC5=C(C=C4)O)O
| StdInChI          = 1S/C24H27NO4/c26-17-7-6-16-14-19-24(28)10-8-18(27)22-23(24,20(16)21(17)29-22)11-13-25(19)12-9-15-4-2-1-3-5-15/h1-7,18-19,22,26-28H,8-14H2/t18-,19+,22-,23-,24+/m0/s1
| StdInChIKey       = GAHRZWMAHDWVCL-VKJMTUIMSA-N
}}

'''RAM-378'''<ref>{{cite journal | vauthors = Ben Haddou T, Béni S, Hosztafi S, Malfacini D, Calo G, Schmidhammer H, Spetea M | title = Pharmacological investigations of N-substituent variation in morphine and oxymorphone: opioid receptor binding, signaling and antinociceptive activity | journal = PLOS ONE | volume = 9 | issue = 6 | article-number = e99231 | date = 2014 | pmid = 24919067 | pmc = 4053365 | doi = 10.1371/journal.pone.0099231 | bibcode = 2014PLoSO...999231B | doi-access = free }}</ref>('''7,8-Dihydro-14-hydroxy-N-phenethylnormorphine''') is an [opioid](/source/opioid) [analgesic](/source/analgesic). It is the N-phenethyl derivative of [hydromorphinol](/source/hydromorphinol).

==See also==
* [14-Cinnamoyloxycodeinone](/source/14-Cinnamoyloxycodeinone)
* [14-Phenylpropoxymetopon](/source/14-Phenylpropoxymetopon)
* [7-PET](/source/7-PET)
* [N-Phenethylnormorphine](/source/N-Phenethylnormorphine)
* [N-Phenethyl-14-ethoxymetopon](/source/N-Phenethyl-14-ethoxymetopon)
* [Phenomorphan](/source/Phenomorphan)
* [Ro4-1539](/source/Ro4-1539)

==References==
{{Reflist|2}}

{{Opioidergics}}

Category:4,5-Epoxymorphinans
Category:Semisynthetic opioids

{{Analgesic-stub}}

---
Adapted from the Wikipedia article [RAM-378](https://en.wikipedia.org/wiki/RAM-378) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/RAM-378?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.