# Protokylol

> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/Protokylol
> Markdown URL: https://mediated.wiki/source/Protokylol.md
> Source: https://en.wikipedia.org/wiki/Protokylol
> Source revision: 1341026717
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)

{{Short description|Chemical compound}}
{{Drugbox
| IUPAC_name = <nowiki>4-[2-[[2-(1,3-Benzodioxol-5-yl)-1-methyl-ethyl]amino]-1-hydroxy-ethyl]benzene-1,2-diol</nowiki>
| image = Protokylol.svg
| image_class = skin-invert-image

<!--Clinical data-->
| tradename = Ventaire
| pregnancy_category = 
| legal_status = Rx-only
| routes_of_administration = 
| class = [β-Adrenergic receptor agonist](/source/%CE%B2-Adrenergic_receptor_agonist); [Bronchodilator](/source/Bronchodilator)

<!--Pharmacokinetic data-->
| bioavailability = 
| metabolism = 
| elimination_half-life = 
| excretion =

<!--Identifiers-->
| CAS_number = 136-70-9
| ATC_prefix = None
| ATC_suffix = 
| PubChem = 4969
| ChemSpiderID = 4798
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 8Y5Y4EEO2V
| ChEMBL = 1201273

<!--Chemical data-->
| C=18 | H=21 | N=1 | O=5 
| smiles = O1c2ccc(cc2OC1)CC(NCC(O)c3ccc(O)c(O)c3)C
}}

'''Protokylol''', sold under the brand name '''Ventaire''', is a [β-adrenergic receptor](/source/beta-adrenergic_receptor) [agonist](/source/agonist) used as a [bronchodilator](/source/bronchodilator) in Europe and the United States.<ref name="isbn3-88763-075-0">{{cite book | author = Swiss Pharmaceutical Society | title = Index Nominum 2000: International Drug Directory (Book with CD-ROM) | publisher = Medpharm Scientific Publishers | location = Boca Raton | year = 2000 | isbn = 3-88763-075-0 | url = https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA894}}</ref>{{failed verification|date=February 2020}}

It is methylenedioxyphenyl-[isoproterenol](/source/isoproterenol).

The [Para-Methoxyamphetamine](/source/Para-Methoxyamphetamine) (PMA) analog is twice the potency as the [tenamfetamine](/source/tenamfetamine) analog.<ref name="BielSchwarz1954">{{cite journal| vauthors = Biel JH, Schwarz EG, Sprengeler EP, Leiser HA, Friedman HL |title=Bronchodilators, N-Substituted Derivatives of 1-(3',4'-Dihydroxyphenyl)-2-aminoethanol (Arterenol)|journal=Journal of the American Chemical Society|volume=76|issue=12|year=1954|pages=3149–3153|issn=0002-7863|doi=10.1021/ja01641a010}}</ref>

==See also==
* [Substituted methylenedioxyphenethylamine](/source/Substituted_methylenedioxyphenethylamine)

== References ==
{{Reflist}}

== External links ==
* {{cite web| url = https://druginfo.nlm.nih.gov/drugportal/name/protokylol | archive-url = https://web.archive.org/web/20200205031156/https://druginfo.nlm.nih.gov/drugportal/name/protokylol | url-status = dead | archive-date = February 5, 2020 | publisher = U.S. National Library of Medicine| work = Drug Information Portal | title = Protokylol }}

{{Asthma_and_copd_rx}}
{{Adrenergics}}
{{Phenethylamines}}
{{Portal bar | Medicine}}

Category:Catechols
Category:Methylenedioxyamphetamines
Category:Phenylethanolamines

{{respiratory-system-drug-stub}}

---
Adapted from the Wikipedia article [Protokylol](https://en.wikipedia.org/wiki/Protokylol) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/Protokylol?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.