# Prosidol

> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/Prosidol
> Markdown URL: https://mediated.wiki/source/Prosidol.md
> Source: https://en.wikipedia.org/wiki/Prosidol
> Source revision: 1332213778
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)

{{Short description|Chemical compound}}
{{Drugbox
| verifiedrevid = 449872111
| IUPAC_name = 1-(2-ethoxyethyl)-4-phenylpiperidin-4-yl propionate
| image = Prosidol.svg
| image_class = skin-invert-image
| width = 160
| image2 = Prosidol ball-and-stick.png
| image_class2 = bg-transparent 
| width2 = 200

<!--Clinical data-->
| tradename =  
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B            / C / D / X -->
| pregnancy_category =  
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = <!-- Schedule I -->
| legal_UK = <!-- Class A -->
| legal_US = <!-- Schedule I -->
| legal_status =  
| routes_of_administration =  

<!--Pharmacokinetic data-->
| bioavailability =  
| protein_bound =  
| metabolism =  
| elimination_half-life =  
| excretion =  

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number =  164231-04-3
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = CV69EOR0N2
| ATC_prefix = none
| ATC_suffix =  
| PubChem = 10402849
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =  
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 8578287

<!--Chemical data-->
| C=18 | H=27 | N=1 | O=3 
| smiles = O=C(OC2(c1ccccc1)CCN(CCOCC)CC2)CC
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C18H27NO3/c1-3-17(20)22-18(16-8-6-5-7-9-16)10-12-19(13-11-18)14-15-21-4-2/h5-9H,3-4,10-15H2,1-2H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = IOLPYQBYMPDUNK-UHFFFAOYSA-N
| synonyms =  
}}

'''Prosidol''' is an [opioid](/source/opioid) [analgesic](/source/analgesic) that is an [analogue](/source/analog_(chemistry)) of [prodine](/source/prodine). It was originally discovered by J.F. MacFarlan and Co. in the 1950s.<ref>{{cite patent | country = US | number = 2960507 | title = Piperidine compounds }}</ref> It was further developed in Russia in the 1990s during research into the related drug [pethidine](/source/pethidine).<ref name="pmid7802322">{{cite journal | vauthors = Osipova NA, Novikov GA, Vetsheva MS, Prokhorov BM, Beresnev VA, Loseva NA, Zemskaia SI, Smolina TA | title = [First experience in the use of a new Russian narcotic analgesic prosidol in oncology] | language = ru | journal = Anesteziologiia I Reanimatologiia | issue = 4 | pages = 53–7 | date = 1994 | pmid = 7802322 }}</ref>

Prosidol has seen some clinical use, but is still a relatively new drug and does not yet have an extensive history of use. It produces similar effects to other opioids, such as [analgesia](/source/analgesia) and [sedation](/source/sedation), along with side effects such as [nausea](/source/nausea), [itching](/source/itching), [vomiting](/source/vomiting) and [respiratory depression](/source/respiratory_depression) which may be harmful or fatal.<ref name="pmid8975562">{{cite journal | vauthors = Osipova NA | title = [The problem of opioid tolerance and dependence during clinical use thereof] | language = ru | journal = Anesteziologiia I Reanimatologiia | issue = 4 | pages = 17–21 | date = 1996 | pmid = 8975562 }}</ref><ref name="pmid11757313">{{cite journal | vauthors = Abuzarova GR | title = [Prosidol, an original Russian opioid, in the treatment of pain syndromes] | language = ru | journal = Anesteziologiia I Reanimatologiia | issue = 5 | pages = 74–7 | date = 2001 | pmid = 11757313 }}</ref>

== References ==
{{Reflist|2}}

{{Opioidergics}}

Category:4-Phenylpiperidines
Category:Synthetic opioids
Category:Propionate esters
Category:Ethers
Category:Mu-opioid receptor agonists

{{analgesic-stub}}

---
Adapted from the Wikipedia article [Prosidol](https://en.wikipedia.org/wiki/Prosidol) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/Prosidol?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.