# Phaclofen

> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/Phaclofen
> Markdown URL: https://mediated.wiki/source/Phaclofen.md
> Source: https://en.wikipedia.org/wiki/Phaclofen
> Source revision: 1330452063
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)

{{Short description|GABAB receptor antagonist}}
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 449584465
| ImageFile = Phaclofen.svg
| ImageClass = skin-invert-image
| ImageSize=
| IUPACName=[3-amino-2-(4-chlorophenyl)propyl]phosphonic acid
| OtherNames=
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|??}}
| CASNo=108351-35-5
| PubChem=1641
| IUPHAR_ligand = 1091
| SMILES=C1=CC(=CC=C1C(CN)CP(=O)(O)O)Cl
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 1579
| InChI = 1/C9H13ClNO3P/c10-9-3-1-7(2-4-9)8(5-11)6-15(12,13)14/h1-4,8H,5-6,11H2,(H2,12,13,14)
| InChIKey = VSGNGLJPOGUDON-UHFFFAOYAO
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C9H13ClNO3P/c10-9-3-1-7(2-4-9)8(5-11)6-15(12,13)14/h1-4,8H,5-6,11H2,(H2,12,13,14)
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = VSGNGLJPOGUDON-UHFFFAOYSA-N
  }}
|Section2={{Chembox Properties
| Formula=C<sub>9</sub>H<sub>13</sub>ClNO<sub>3</sub>P
| MolarMass=249.631 g/mol
| Appearance=
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
  }}
|Section3={{Chembox Hazards
| MainHazards=
| FlashPt=
| AutoignitionPt =
  }}
}}

'''Phaclofen''', or '''phosphonobaclofen''', is a selective [antagonist](/source/Receptor_antagonist) for the [GABA<sub>B</sub> receptor](/source/GABAB_receptor).<ref>{{cite journal |title = Phaclofen: a peripheral and central baclofen antagonist |vauthors = Kerrn D, Ong J, Prager R, Gynther B, Curtis D |journal = Brain Research |volume = 405 |date = 3 March 1987 |issue = 1 |pages = 150–154 |doi=10.1016/0006-8993(87)90999-1|pmid = 3032346 |s2cid = 29595421 }}</ref> It was the first selective GABA<sub>B</sub> antagonist discovered, but its utility was limited by the fact that it does not cross the blood brain barrier.<ref>{{cite journal |journal=J Med Chem |title=Phosphinic acid analogues of GABA. 2. Selective, orally active GABAB antagonists |pmid=7650685 |date=August 18, 1995 |doi=10.1021/jm00017a016 |vauthors=Froestl W, Mickel SJ, von Sprecher G, Diel PJ, Hall RG, Maier L, Strub D, Melillo V, Baumann PA, Bernasconi R, et. al. |volume=38 |issue=17 |pages=3313–3331 }}</ref>

==References==
{{Reflist|2}}

{{GABAergics}}

Category:GABAB receptor antagonists
Category:Phosphonic acids
Category:4-Chlorophenyl compounds
{{nervous-system-drug-stub}}

---
Adapted from the Wikipedia article [Phaclofen](https://en.wikipedia.org/wiki/Phaclofen) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/Phaclofen?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.