# Parafluorofentanyl
> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/Parafluorofentanyl
> Markdown URL: https://mediated.wiki/source/Parafluorofentanyl.md
> Source: https://en.wikipedia.org/wiki/Parafluorofentanyl
> Source revision: 1343957881
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)
{{Short description|Opioid analgesic}}{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 451463728
| IUPAC_name = ''N''-(4-fluorophenyl)-''N''-[1-(2-phenylethyl)piperidin-4-yl]propanamide
| image = Parafluorofentanyl.svg
| image_class = skin-invert-image
| width = 220px
| image2 = P-fluorofentanyl.png
| image_class2 = bg-transparent
| width2 = 220px
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_BR = F1
| legal_CA = Schedule I
| legal_UK = Class A
| legal_US = Schedule I
| legal_DE = Anlage I
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 90736-23-5
| ATC_prefix = none
| ATC_suffix =
| PubChem = 62300
| KEGG = C22769
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 56096
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 61074
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = I45R05QM0Z
| C=22 | H=27 | F=1 | N=2 | O=1
| smiles = Fc1ccc(cc1)N(C(=O)CC)C3CCN(CCc2ccccc2)CC3
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C22H27FN2O/c1-2-22(26)25(20-10-8-19(23)9-11-20)21-13-16-24(17-14-21)15-12-18-6-4-3-5-7-18/h3-11,21H,2,12-17H2,1H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = KXUBAVLIJFTASZ-UHFFFAOYSA-N
| synonyms = 4-Fluorofentanyl; ''para''-Fluorofentanyl; pFF
}}
'''Parafluorofentanyl''' ('''4-fluorofentanyl''', '''''para''-fluorofentanyl''', '''pFF''') is an [opioid](/source/opioid) [analgesic](/source/analgesic) [analogue](/source/analog_(chemistry)) of [fentanyl](/source/fentanyl) developed by [Janssen Pharmaceuticals](/source/Janssen_Pharmaceuticals) in the 1960s.[{{ cite patent | country = US | status = patent | number = 3164600 }}]
Parafluorofentanyl was sold briefly on the US black market in the early 1980s,{{citation needed|date=September 2015}} before the introduction of the [Federal Analog Act](/source/Federal_Analog_Act) which for the first time attempted to control entire families of drugs based on their structural similarity rather than scheduling each drug individually as they appeared.[{{cite journal | vauthors = Henderson GL | title = Designer drugs: past history and future prospects | journal = Journal of Forensic Sciences | volume = 33 | issue = 2 | pages = 569–75 | date = March 1988 | doi = 10.1520/JFS11976J | pmid = 3286815 }}] Parafluorofentanyl is made by the same synthetic route as fentanyl, but by substituting [''para''-fluoroaniline](/source/4-Fluoroaniline) for [aniline](/source/aniline) in the synthesis.[{{cite journal | vauthors = Ulens C, Van Boven M, Daenens P, Tytgat J | title = Interaction of p-fluorofentanyl on cloned human opioid receptors and exploration of the role of Trp-318 and His-319 in μ-opioid receptor selectivity | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 294 | issue = 3 | pages = 1024–33 | date = September 2000 | doi = 10.1016/S0022-3565(24)39167-0 | pmid = 10945855 | url = http://jpet.aspetjournals.org/content/294/3/1024.full.pdf }}]
Side effects of [fentanyl](/source/fentanyl) analogs are similar to those of fentanyl itself, which include [itching](/source/itching), [nausea](/source/nausea), and potentially serious [respiratory depression](/source/respiratory_depression), which can be life-threatening. Fentanyl analogs have killed thousands of people throughout Europe and the former Soviet republics since the most recent resurgence in use began in [Estonia](/source/Estonia) in the early 2000s, and novel derivatives continue to appear.[{{cite journal | vauthors = Mounteney J, Giraudon I, Denissov G, Griffiths P | title = Fentanyls: Are we missing the signs? Highly potent and on the rise in Europe | journal = The International Journal on Drug Policy | volume = 26 | issue = 7 | pages = 626–31 | date = July 2015 | pmid = 25976511 | doi = 10.1016/j.drugpo.2015.04.003 | url = http://www.ijdp.org/article/S0955-3959%2815%2900097-3/abstract | url-access = subscription }}]
In 2020, the Drug Enforcement Agency warned about the increasing prevalence of parafluorofentanyl in Arizona.[{{Cite web |url=https://www.abc15.com/news/dea-warns-of-newly-encountered-fentanyl-like-drug-in-arizona |title=DEA warns of newly encountered fentanyl-like drug in Arizona |date=December 28, 2020 |website=KNXV}}][{{Cite web |url=https://ktar.com/story/3775298/dea-in-arizona-warns-of-extremely-dangerous-form-of-fentanyl/ |title=DEA in Arizona warns of 'extremely dangerous' form of fentanyl |date=December 29, 2020 |website=KTAR.com}}]
== See also ==
* [3-Methylbutyrfentanyl](/source/3-Methylbutyrfentanyl)
* [3-Methylfentanyl](/source/3-Methylfentanyl)
* [4-Fluorobutyrfentanyl](/source/4-Fluorobutyrfentanyl)
* [4-Fluoroisobutyrfentanyl](/source/4-Fluoroisobutyrfentanyl)
* [α-Methylfentanyl](/source/%CE%B1-Methylfentanyl)
* [Acetylfentanyl](/source/Acetylfentanyl)
* [Butyrfentanyl](/source/Butyrfentanyl)
* [Furanylfentanyl](/source/Furanylfentanyl)
* [Orthofluorofentanyl](/source/Orthofluorofentanyl)
* [List of fentanyl analogues](/source/List_of_fentanyl_analogues)
== References ==
{{Reflist}}
{{Opioidergics}}
Category:Synthetic opioids
Category:Piperidines
Category:4-Fluorophenyl compounds
Category:Propionamides
Category:Anilides
Category:Mu-opioid receptor agonists
Category:Designer drugs
Category:Fentanyl
---
Adapted from the Wikipedia article [Parafluorofentanyl](https://en.wikipedia.org/wiki/Parafluorofentanyl) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/Parafluorofentanyl?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.