# Normustine

> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/Normustine
> Markdown URL: https://mediated.wiki/source/Normustine.md
> Source: https://en.wikipedia.org/wiki/Normustine
> Source revision: 1329022941
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)

{{Short description|Nitrogen mustard used as a chemotherapy agent}}
{{Drugbox
| Verifiedfields = 
| Watchedfields = 
| verifiedrevid = 
| IUPAC_name = Bis(2-chloroethyl)carbamic acid
| image = Normustine.svg
| image_class = skin-invert-image
| width = 225px

<!--Clinical data-->
| tradename = 
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B            / C / D / X -->
| pregnancy_category = 
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = 
| legal_UK = 
| legal_US = 
| legal_status = 
| routes_of_administration = 

<!--Pharmacokinetic data-->
| bioavailability = 
| protein_bound = 
| metabolism = 
| elimination_half-life = 
| excretion =

<!-- Identifiers -->
| CAS_number_Ref = 
| CAS_number = 78619-95-1
| CAS_supplemental = 
| class = 
| ATC_prefix = 
| ATC_suffix = 
| ATC_supplemental = 
| PubChem = 18377863
| IUPHAR_ligand = 
| DrugBank_Ref = 
| DrugBank = 
| ChemSpiderID_Ref = 
| ChemSpiderID = 
| UNII = Q2KPX8TH4K
| KEGG = 
| ChEBI = 
| ChEMBL = 

<!--Chemical data-->
| C=5 | H=9 | Cl=2 | N=1 | O=2
| SMILES = C(CCl)N(CCCl)C(=O)O
| StdInChI_Ref = 
| StdInChI = 1S/C5H9Cl2NO2/c6-1-3-8(4-2-7)5(9)10/h1-4H2,(H,9,10)
| StdInChIKey_Ref = 
| StdInChIKey = TTYAKTJQJVVKED-UHFFFAOYSA-N
| synonyms = Bis(2-chloroethyl)carbamic acid
}}

'''Normustine''', also known as '''bis(2-chloroethyl)carbamic acid''', is a [nitrogen mustard](/source/nitrogen_mustard) and [alkylating antineoplastic agent](/source/alkylating_antineoplastic_agent) (i.e., [chemotherapy agent](/source/chemotherapy_agent)).<ref name="BruntonChabner2011">{{cite book| vauthors = Brunton L, Chabner B, Knollman B |title=Goodman and Gilman's The Pharmacological Basis of Therapeutics, Twelfth Edition|url=https://books.google.com/books?id=e_yAOpyyaowC|date=14 January 2011|publisher=McGraw Hill Professional|isbn=978-0-07-176939-6|page=1709}}</ref><ref name="FoxFox2012">{{cite book| vauthors = Fox BW, Fox M |title=Antitumor Drug Resistance|url=https://books.google.com/books?id=m-TrCAAAQBAJ&pg=PA199|date=6 December 2012|publisher=Springer Science & Business Media|isbn=978-3-642-69490-5|pages=199–}}</ref><ref name="Decker2017">{{cite book| vauthors = Decker M |title=Design of Hybrid Molecules for Drug Development|url=https://books.google.com/books?id=gfEbDQAAQBAJ&pg=PA201|date=5 April 2017|publisher=Elsevier Science|isbn=978-0-08-101118-8|pages=201–}}</ref> It is a [metabolite](/source/metabolite) of a number of [antineoplastic agent](/source/antineoplastic_agent)s that have been developed for the treatment of [tumor](/source/tumor)s, including [estramustine phosphate](/source/estramustine_phosphate), [alestramustine](/source/alestramustine), [cytestrol acetate](/source/cytestrol_acetate), and [ICI-85966](/source/ICI-85966) (stilbostat), but only the former of which has actually been marketed.<ref name="BruntonChabner2011" /><ref name="FoxFox2012" /><ref name="Decker2017" />

==References==
{{Reflist}}

{{Chemotherapeutic agents}}

Category:Alkylating antineoplastic agents
Category:Carbamates
Category:Human drug metabolites
Category:Nitrogen mustards
Category:Chloroethyl compounds

{{Antineoplastic-drug-stub}}

---
Adapted from the Wikipedia article [Normustine](https://en.wikipedia.org/wiki/Normustine) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/Normustine?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.