# Metralindole

> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/Metralindole
> Markdown URL: https://mediated.wiki/source/Metralindole.md
> Source: https://en.wikipedia.org/wiki/Metralindole
> Source revision: 1338234472
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)

{{Short description|Chemical compound}}
{{Drugbox
| image = Metralindole structure.svg
| image_class = skin-invert-image
| width = 250px

<!--Clinical data-->
| tradename =  
| pregnancy_category =  
| legal_status = Rx-only
| routes_of_administration = Oral
| class = [Monoamine oxidase inhibitor](/source/Monoamine_oxidase_inhibitor) (MAOI); [Reversible inhibitor of MAO-A](/source/Reversible_inhibitor_of_MAO-A) (RIMA)
| ATC_prefix = None
| ATC_suffix = 

<!--Pharmacokinetic data-->
| bioavailability =  
| metabolism =  
| elimination_half-life =  
| excretion =  

<!--Identifiers-->
| index2_label = HCl 
| CAS_number2_Ref = {{cascite|correct|CAS}}
| CAS_number2 = 53734-79-5
| UNII2_Ref = {{fdacite|correct|FDA}}
| UNII2 = M15TM76Y3L
| CAS_number = 54188-38-4
| PubChem = 68713
| ChemSpiderID = 61964
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 2QW3FL6OPA

<!--Chemical data-->
| IUPAC_name = 2,4,5,6-tetrahydro-9-methoxy-4-methyl-1''H''-3,4,6a-triazafluoranthene
| C=15 | H=17 | N=3 | O=1 
| SMILES = CN1CCN2C3=C(C=C(C=C3)OC)C4=C2C1=NCC4
}}

'''Metralindole''' ('''Inkazan''') is a [reversible inhibitor of monoamine oxidase A](/source/reversible_inhibitor_of_monoamine_oxidase_A) (RIMA) which was investigated in [Russia](/source/Russia) as a potential [antidepressant](/source/antidepressant).<ref name="pmid1884793">{{cite journal | vauthors = Andreeva NI, Golovina SM, Faermark MF, Shvarts GI, Mashkovskiĭ MD | title = [The comparative influence of pyrazidol, inkazan and other antidepressant monoamine oxidase inhibitors on the pressor effect of tyramine] | language = ru | journal = Farmakologiia i Toksikologiia | volume = 54 | issue = 2 | pages = 38–40 | year = 1991 | pmid = 1884793 }}</ref>  It is [structurally](/source/chemical_structure) and [pharmacologically](/source/pharmacology) related to [pirlindole](/source/pirlindole).

== See also ==
* [Substituted β-carboline § Related compounds](/source/Substituted_%CE%B2-carboline)
* [Pirlindole](/source/Pirlindole)
* [Tetrindole](/source/Tetrindole)
* [List of Russian drugs](/source/List_of_Russian_drugs)

== References ==
{{Reflist}}

{{Antidepressants}}
{{Anxiolytics}}
{{Monoamine metabolism modulators}}
{{Tryptamines}}

Category:Antidepressants
Category:beta-Carbolines
Category:N,N-Dialkyltryptamines
Category:5-Methoxytryptamines
Category:Monoamine oxidase inhibitors
Category:Reversible inhibitors of MAO-A
Category:Russian drugs

{{nervous-system-drug-stub}}

---
Adapted from the Wikipedia article [Metralindole](https://en.wikipedia.org/wiki/Metralindole) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/Metralindole?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.