# Methyl caffeate

> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/Methyl_caffeate
> Markdown URL: https://mediated.wiki/source/Methyl_caffeate.md
> Source: https://en.wikipedia.org/wiki/Methyl_caffeate
> Source revision: 1193526220
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)

{{chembox
| Watchedfields = 
| verifiedrevid = 
| Name = Methyl caffeate
| ImageFile = Methyl caffeate.svg 
| ImageCaption = Chemical structure of methyl caffeate
| PIN = Methyl (2''E'')-3-(3,4-dihydroxyphenyl)prop-2-enoate
| OtherNames = Caffeic acid [methyl](/source/methyl) [ester](/source/ester)<br>methylcaffeate<br>Methyl 3,4-dihydroxycinnamate
|Section1={{Chembox Identifiers
| CASNo = 3843-74-1
| CASNo_Ref = {{cascite|correct|CAS}}
| ChEBI = 
| ChEBI_Ref = 
| ChEMBL = 
| ChEMBL_Ref = 
| ChemSpiderID = 600455
| SMILES = COC(=O)/C=C/C1=CC(=C(C=C1)O)O
| InChI = 1/C10H10O4/c1-14-10(13)5-3-7-2-4-8(11)9(12)6-7/h2-6,11-12H,1H3/b5-3+
| InChIKey = OCNYGKNIVPVPPX-HWKANZROBE
| StdInChI = 1S/C10H10O4/c1-14-10(13)5-3-7-2-4-8(11)9(12)6-7/h2-6,11-12H,1H3/b5-3+
| StdInChIKey = OCNYGKNIVPVPPX-HWKANZROSA-N
| DrugBank = 
| DrugBank_Ref = 
| KEGG = 
| KEGG_Ref = 
| PubChem = 689075
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = N79173B9HF
  }}
|Section2={{Chembox Properties
| C=10 | H=10 | O=4
| Density = <!--g/cm<sup>3</sup>-->
| MeltingPt = <!--&nbsp;°C-->
| BoilingPt = 
| LambdaMax = 
  }}
|Section8={{Chembox Related
| OtherCompounds = [Caffeic acid](/source/Caffeic_acid), [Ethyl caffeate](/source/Ethyl_caffeate)
 }}
}}

'''Methyl caffeate''' is an ester of [caffeic acid](/source/caffeic_acid), a naturally occurring phenolic compound. It is an [α-glucosidase](/source/Alpha-glucosidase) inhibitor.<ref>{{cite journal|title=Methyl Caffeate as an α-Glucosidase Inhibitor from Solanum torvum Fruits and the Activity of Related Compounds|journal=Bioscience, Biotechnology, and Biochemistry|volume=74|issue=4|pages=741–745|doi=10.1271/bbb.90789|pmid=20378981|year=2014|last1=Takahashi|first1=Keisuke|last2=Yoshioka|first2=Yasuyuki|last3=Kato|first3=Eisuke|last4=Katsuki|first4=Shigeki|last5=Iida|first5=Osamu|last6=Hosokawa|first6=Keizo|last7=Kawabata|first7=Jun|s2cid=23067847|doi-access=free|hdl=2115/53430|hdl-access=free}}</ref> Its physical form is a powder.

== Natural occurrences ==
Methyl caffeate can be found in the fruit of ''[Solanum torvum](/source/Solanum_torvum)''.<ref name=Gandhi>{{cite journal | doi = 10.1016/j.ejphar.2011.09.159| title = Antihyperglycemic activity and antidiabetic effect of methyl caffeate isolated from Solanum torvum Swartz. Fruit in streptozotocin induced diabetic rats| year = 2011| last1 = Gandhi| first1 = Gopalsamy Rajiv| last2 = Ignacimuthu| first2 = Savarimuthu| last3 = Paulraj| first3 = Michael Gabriel| last4 = Sasikumar| first4 = Ponnusamy| journal = European Journal of Pharmacology| volume = 670| issue = 2–3| pages = 623–631| pmid = 21963451}}</ref>

== Health effect ==
Methyl caffeate shows an [antidiabetic](/source/Anti-diabetic_medication) effect in [streptozotocin](/source/streptozotocin)-induced diabetic rats.<ref name=Gandhi/>

== References ==
{{Reflist}}

{{Hydroxycinnamic acid}}

{{DEFAULTSORT:Methyl caffeate}}
Category:O-methylated hydroxycinnamic acids
Category:Hydroxycinnamic acid esters
Category:Catechols

{{aromatic-stub}}

---
Adapted from the Wikipedia article [Methyl caffeate](https://en.wikipedia.org/wiki/Methyl_caffeate) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/Methyl_caffeate?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.