# ML-007

> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/ML-007
> Markdown URL: https://mediated.wiki/source/ML-007.md
> Source: https://en.wikipedia.org/wiki/ML-007
> Source revision: 1295519874
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)

{{Short description|Experimental muscarinic drug}}
{{cs1 config|name-list-style=vanc|display-authors=6}}
{{Infobox drug
| drug_name = 
| image = 
| width = 
| caption =

<!-- Clinical data -->
| pronounce = 
| tradename = 
| Drugs.com = 
| MedlinePlus = 
| licence_CA = 
| licence_EU = 
| DailyMedID = 
| licence_US = 
| pregnancy_AU = 
| pregnancy_category = 
| dependency_liability = 
| addiction_liability = 
| routes_of_administration = [Oral](/source/Oral_administration)<ref name="AdisInsight" />
| class = [Muscarinic acetylcholine](/source/Muscarinic_acetylcholine_receptor) [M<sub>1</sub>](/source/M1_receptor) and [M<sub>4</sub> receptor](/source/M4_receptor) [agonist](/source/agonist)<ref name="AdisInsight" />
| ATC_prefix = 
| ATC_suffix =

<!-- Legal status -->
| legal_status =

<!-- Pharmacokinetic data -->
| bioavailability = 
| protein_bound = 
| metabolism = 
| metabolites = 
| onset = 
| elimination_half-life = 
| duration_of_action = 
| excretion =

<!-- Identifiers -->
| CAS_number = 
| CAS_supplemental = 
| PubChem = 
| PubChemSubstance = 
| IUPHAR_ligand = 
| DrugBank = 
| ChemSpiderID = 
| UNII = 
| KEGG = 
| ChEBI = 
| ChEMBL = 
| NIAID_ChemDB = 
| PDB_ligand = 
| synonyms = ML007; ML-007/PAC; ML007/PAC

<!-- Chemical data -->
| IUPAC_name = 
| C= | H= | N= | O= 
| SMILES = 
| StdInChI = 
| StdInChIKey = 
}}

'''ML-007''' is a [selective](/source/binding_selectivity) [muscarinic acetylcholine](/source/muscarinic_acetylcholine_receptor) [M<sub>1</sub>](/source/M1_receptor) and [M<sub>4</sub> receptor](/source/M4_receptor) [agonist](/source/agonist) which is under development for the treatment of [schizophrenia](/source/schizophrenia), [psychotic disorder](/source/psychotic_disorder)s, and [dyskinesia](/source/dyskinesia)s.<ref name="AdisInsight">{{cite web | title=ML 007 | work = AdisInsight | publisher =  Springer Nature Switzerland AG | date=9 January 2024 | url=https://adisinsight.springer.com/drugs/800062983 | access-date=21 October 2024}}</ref><ref name="Synapse">{{cite web | title=Delving into the Latest Updates on ML-007 with Synapse | website=Synapse | date=19 September 2024 | url=https://synapse.patsnap.com/drug/b28f987442e14a1b9abeed7005e6dbff | access-date=21 October 2024}}</ref><ref name="YohnHarveyBrannan2024">{{cite journal | vauthors = Yohn SE, Harvey PD, Brannan SK, Horan WP | title=The potential of muscarinic M1 and M4 receptor activators for the treatment of cognitive impairment associated with schizophrenia | journal=Frontiers in Psychiatry | publisher=Frontiers Media SA | volume=15 | date=4 October 2024 | issn=1664-0640 | doi=10.3389/fpsyt.2024.1421554 | doi-access=free | page=| pmid=39483736 | pmc=11525114 }}</ref><ref name="WalkerHuckstepBecker2024">{{cite journal | vauthors = Walker LC, Huckstep KL, Becker HC, Langmead CJ, Lawrence AJ | title = Targeting muscarinic receptors for the treatment of alcohol use disorders: Opportunities and hurdles for clinical development | journal = British Journal of Pharmacology | volume = 181 | issue = 22 | pages = 4385–4398 | date = November 2024 | pmid = 37005377 | doi = 10.1111/bph.16081 | doi-access = free }}</ref> It is being developed in [combination](/source/combination_drug) with a [peripherally selective](/source/peripherally_selective_drug) [muscarinic acetylcholine receptor antagonist](/source/muscarinic_antagonist) (also known as ML-007/peripherally acting anticholinergic or ML-007/PAC).<ref name="WalkerHuckstepBecker2024" /><ref name="YohnHarveyBrannan2024" /> The drug is taken [by mouth](/source/oral_administration).<ref name="AdisInsight" />

As of January 2024, ML-007 is in [phase 1](/source/Phases_of_clinical_research) [clinical trial](/source/clinical_trial)s for schizophrenia, psychotic disorders, and dyskinesias.<ref name="AdisInsight" /><ref name="Synapse" /><ref name="YohnHarveyBrannan2024" /> It is under development by MapLight Therapeutics.<ref name="AdisInsight" /><ref name="Synapse" /> The drug is a [small molecule](/source/small_molecule), but its [chemical structure](/source/chemical_structure) does not seem to have been disclosed.<ref name="WalkerHuckstepBecker2024" /><ref name="AdisInsight" /><ref name="Synapse" />

== See also ==
* [Emraclidine](/source/Emraclidine)
* [NBI-1117568](/source/NBI-1117568)
* [NS-136](/source/NS-136)
* [Xanomeline/trospium](/source/Xanomeline%2Ftrospium)

== References ==
{{Reflist}}

{{Muscarinic acetylcholine receptor modulators}}

Category:Combination drugs
Category:Drugs with undisclosed chemical structures
Category:Experimental drugs
Category:Experimental drugs developed for schizophrenia
Category:M1 receptor agonists
Category:M4 receptor agonists

{{Nervous-system-drug-stub}}

---
Adapted from the Wikipedia article [ML-007](https://en.wikipedia.org/wiki/ML-007) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/ML-007?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.