# Involutin

> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/Involutin
> Markdown URL: https://mediated.wiki/source/Involutin.md
> Source: https://en.wikipedia.org/wiki/Involutin
> Source revision: 1354160023
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)

{{Chembox
| ImageFile =Involutin.svg
| ImageSize = 200px
| Name=Involutin
| PIN=(4''S'',5''R'')-5-(3,4-Dihydroxyphenyl)-3,4-dihydroxy-2-(4-hydroxyphenyl)cyclopent-2-en-1-one
| OtherNames=
|Section1={{Chembox Identifiers
| ChemSpiderID = 68023767                                     
| CASNo= 13677-78-6
| CASNo_Ref = {{Cascite|changed|??}}
| PubChem=71435043
| SMILES =O[C@H]1[C@H](C(=O)C(=C1O)C1=CC=C(O)C=C1)C1=CC=C(O)C(O)=C1
| StdInChI=1S/C17H14O6/c18-10-4-1-8(2-5-10)13-15(21)14(17(23)16(13)22)9-3-6-11(19)12(20)7-9/h1-7,13,16,18-20,22-23H
| StdInChIKey = JDHDWVVITVZZFY-UHFFFAOYSA-N
}}
|Section2={{Chembox Properties
| C=17 | H=14 | O=6
| Appearance=
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
  }}
|Section3={{Chembox Hazards
| MainHazards=
| FlashPt=
| AutoignitionPt =
  }}
}}

'''Involutin''' is an [organic compound](/source/organic_compound) that can be found in mushrooms belonging to the genus ''[Paxillus](/source/Paxillus).'' It is part of a class of compounds known as diarylcyclopentenones. It is derived from [atromentin](/source/atromentin) which was shown from 3′,3″,5′,5″-''d4''-atromentin (deuterated atromentin) feeding studies and observing the deuterated incorporation into two atromentin derivatives (i.e., an increase in monoisotopic mass by 4 mass units), [gyrocyanin](/source/gyrocyanin) and its oxidation product gyroporin.<ref>{{cite journal | pmid = 26496685| year = 2015| last1 = Braesel| first1 = J| title = Three Redundant Synthetases Secure Redox-Active Pigment Production in the Basidiomycete Paxillus involutus| journal = Chemistry & Biology| volume = 22| issue = 10| pages = 1325–34| last2 = Götze| first2 = S| last3 = Shah| first3 = F| last4 = Heine| first4 = D| last5 = Tauber| first5 = J| last6 = Hertweck| first6 = C| last7 = Tunlid| first7 = A| last8 = Stallforth| first8 = P| last9 = Hoffmeister| first9 = D| doi = 10.1016/j.chembiol.2015.08.016| doi-access = free}}</ref> It has been shown to be a Fe<sup>3+</sup>-reductant and presumed to be involved in [Fenton chemistry](/source/Fenton_chemistry) for the initial attack of dead plant matter.<ref>{{cite journal | pmc = 4644656| year = 2015| last1 = Shah| first1 = F| title = Involutin is an Fe3+ Reductant Secreted by the Ectomycorrhizal Fungus Paxillus involutus during Fenton-Based Decomposition of Organic Matter| journal = Applied and Environmental Microbiology| volume = 81| issue = 24| pages = 8427–8433| last2 = Schwenk| first2 = D| last3 = Nicolás| first3 = C| last4 = Persson| first4 = P| last5 = Hoffmeister| first5 = D| last6 = Tunlid| first6 = A| doi = 10.1128/AEM.02312-15| pmid=26431968}}</ref>

==References==
<references />

Category:Polyphenols
Category:Cyclopentenes

{{phenol-stub}}

---
Adapted from the Wikipedia article [Involutin](https://en.wikipedia.org/wiki/Involutin) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/Involutin?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.