# Indanol

> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/Indanol
> Markdown URL: https://mediated.wiki/source/Indanol.md
> Source: https://en.wikipedia.org/wiki/Indanol
> Source revision: 1344147547
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)

{{Chembox
|Section1={{Chembox Identifiers
| index1_label = 1
| index2_label = 2
| index4_label = 4
| index5_label = 5
| CASNo1 = 6351-10-6
| CASNo1_Comment = racemic
| CASNo2 = 4254-29-9
| CASNo4 = 1641-41-4
| CASNo5 = 1470-94-6 
| Beilstein = 1:2042960,
| ChEBI1 = 16697
| ChEMBL1 = 4564909 
| ChEBI5 = 59311
| ChEMBL5 = 3218378 
| ChemSpiderID1 = 21394
| ChemSpiderID2 = 70326
| ChemSpiderID4 = 66840
| ChemSpiderID5 = 14390
| DTXSID4 = DTXSID00167708
| DTXSID5 = DTXSID0051732
| EC_number1 = 228-755-3
| EC_number2 = 224-230-8
| EC_number4 = 216-691-9
| EC_number5 = 216-006-3
| KEGG1 = C01710
| PubChem1 = 22819
| PubChem2 = 77936
| PubChem4 = 74233
| PubChem5 = 15118
| UNII5 = 9Z94H6F15T
| UNII1 = LHG5BD7LOR
| UNII2 = B77NA7SM29
| UNII4 = 7PJT17BE05
| SMILES1 = OC1CCc2ccccc21
| InChI1=1S/C9H10O/c10-9-6-5-7-3-1-2-4-8(7)9/h1-4,9-10H,5-6H2
| InChIKey1 = YIAPLDFPUUJILH-UHFFFAOYSA-N
| SMILES2 = OC1Cc2ccccc2C1
| InChI2 = 1S/C9H10O/c10-9-5-7-3-1-2-4-8(7)6-9/h1-4,9-10H,5-6H2
| InChIKey2 = KMGCKSAIIHOKCX-UHFFFAOYSA-N
| SMILES4 = Oc1cccc2c1CCC2
| InChI4=1S/C9H10O/c10-9-6-2-4-7-3-1-5-8(7)9/h2,4,6,10H,1,3,5H2
| InChIKey4 = DPHNJPUOMLRELT-UHFFFAOYSA-N
| SMILES5 = Oc1ccc2c(c1)CCC2
| InChI5=1S/C9H10O/c10-9-5-4-7-2-1-3-8(7)6-9/h4-6,10H,1-3H2
| InChIKey5 = PEHSSTUGJUBZBI-UHFFFAOYSA-N
 }}
|Section2={{Chembox Properties
| C=9|H=10|O=1
 }}
|Section8={{Chembox Related
 }}
}}

'''Indanols''' are a class of [organic compound](/source/organic_compound)s, some of which are useful in medicine or industry. They are [hydroxy](/source/hydroxy_group) derivatives of the parent compound called [indane](/source/indane) (also known as indan).

==Isomers==
<gallery packed heights="100px">
File:1-indanol.svg|1-indanol (racemic), [m.p.](/source/melting_point) 54.8; R enantiomer, m.p. 67-68°C
File:2-indanol.svg|2-indanol, m.p. 68-69 °C
File:4-indanol.svg|4-indanol, m.p. 42 °C
File:5-indanol.svg|5-indanol, m.p. 58 °C
</gallery>

Five [isomer](/source/isomer)s are possible, two of which are [phenol](/source/phenol)s (4- and 5-indanols).  Three isomers feature hydroxyl group on the five-membered ring, including an [enantiomer](/source/enantiomer)ic pair of 1-indanol.  1-Indanol can be produced by reduction of [1-indanone](/source/1-Indanone).<ref>{{cite journal |title=(S)-Tetrahydro-1-Methyl-3,3-Diphenyl-1H,3H-Pyrrolo-&#91;1,2-c&#93;&#91;1,3,2&#93;Oxazaborole-Borane Complex |journal=Organic Syntheses |date=1997 |volume=74 |page=50 |doi=10.15227/orgsyn.074.0050}}</ref>  5-indanol can be prepared by [sulfonation](/source/sulfonation) of indane, following by base cleavage of the indane-5-sulfonate.<ref>{{cite book |last1=Fiege |first1=Helmut |last2=Voges |first2=Heinz-Werner |last3=Hamamoto |first3=Toshikazu |last4=Umemura |first4=Sumio |last5=Iwata |first5=Tadao |last6=Miki |first6=Hisaya |last7=Fujita |first7=Yasuhiro |last8=Buysch |first8=Hans-Josef |last9=Garbe |first9=Dorothea |last10=Paulus |first10=Wilfried |title=Ullmann's Encyclopedia of Industrial Chemistry |chapter=Phenol Derivatives |date=2000 |doi=10.1002/14356007.a19_313 |isbn=978-3-527-30385-4 }}</ref>

==References==
<references />

*
Category:Secondary alcohols

---
Adapted from the Wikipedia article [Indanol](https://en.wikipedia.org/wiki/Indanol) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/Indanol?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.