# Idose

> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/Idose
> Markdown URL: https://mediated.wiki/source/Idose.md
> Source: https://en.wikipedia.org/wiki/Idose
> Source revision: 1324547394
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)

{{for|the audio software|I-Doser}}
{{chembox
| Verifiedfields = changed
| Watchedfields  = changed
| verifiedrevid  = 451730222
| Reference = <ref>''[Merck Index](/source/Merck_Index)'', 11th Edition, '''4818'''</ref>
| ImageFile = Idose.png
| ImageClass = skin-invert 
| ImageFile1 = D-Idose-chain-3D-balls.png
| ImageClass1 = bg-transparent  
| ImageSize = 180px
| IUPACName = Idose<br>
''ido''-Hexose<ref>{{Cite web |date=1996 |title=Nomenclature of Carbohydrates (Recommendations 1996) - Appendix |url=https://iupac.qmul.ac.uk/2carb/app.html |access-date=2025-11-28 |website=iupac.qmul.ac.uk}}</ref>
| SystematicName = (3''S'',4''R'',5''R'',6''R'')-6-(Hydroxymethyl)oxane-2,3,4,5-tetrol
| Section1 = {{Chembox Identifiers
| CASNo = 5978-95-0
| CASNo_Comment = natural enantiomer (D)
| CASNo1 = 2152-76-3
| CASNo1_Comment = racemate
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 2YL114VI04
| PubChem = 441034
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 389853
| SMILES = O[C@@H]1[C@@H](O)[C@H](OC(O)[C@H]1O)CO
| InChI = 1/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3+,4-,5+,6?/m1/s1
| InChIKey = WQZGKKKJIJFFOK-YIDFTEPTBS
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3+,4-,5+,6?/m1/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = WQZGKKKJIJFFOK-YIDFTEPTSA-N
}}
| Section2 = {{Chembox Properties
| C=6
| H=12
| O=6
| Appearance = white solid
| Density = 
| MeltingPtC = 132
| Solubility = 
}}
| Section3 = {{Chembox Hazards
| MainHazards = 
}}
}}

'''Idose''' is a [hexose](/source/hexose), a six carbon [monosaccharide](/source/monosaccharide). It has an [aldehyde](/source/aldehyde) group and is thus an [aldose](/source/aldose). Idose is not found in nature, but its oxidized derivative [iduronic acid](/source/iduronic_acid), is a component of [dermatan sulfate](/source/dermatan_sulfate) and [heparan sulfate](/source/heparan_sulfate), which are [glycosaminoglycan](/source/glycosaminoglycan)s. The first and third [hydroxyl](/source/hydroxyl)s point the opposite way from the second and fourth. It is made by [aldol condensation](/source/aldol_condensation) of <small>D</small>- and <small>L</small>-[glyceraldehyde](/source/glyceraldehyde). <small>L</small>-Idose is a C-5 [epimer](/source/epimer) of <small>D</small>-[glucose](/source/glucose).

It can be identified by [mass spectrometry](/source/mass_spectrometry).<ref>{{cite journal |doi=10.1007/s13361-014-1072-z |title=Complete Hexose Isomer Identification with Mass Spectrometry |date=2015 |last1=Nagy |first1=Gabe |last2=Pohl |first2=Nicola L. B. |journal=Journal of the American Society for Mass Spectrometry |volume=26 |issue=4 |pages=677–685 |pmid=25652933 |bibcode=2015JASMS..26..677N}}</ref>

==References==
<references/>

{{Carbohydrates}}

Category:Aldohexoses
Category:Pyranoses

{{Ether-stub}}

---
Adapted from the Wikipedia article [Idose](https://en.wikipedia.org/wiki/Idose) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/Idose?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.