# HIE-124

> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/HIE-124
> Markdown URL: https://mediated.wiki/source/HIE-124.md
> Source: https://en.wikipedia.org/wiki/HIE-124
> Source revision: 1330282442
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)

{{Short description|Chemical compound}}
{{Infobox drug
| drug_name = HIE-124
| image = HIE-124_structure.svg
| image_class = skin-invert-image
| width = 
| caption = 

<!-- Clinical data -->
| pronounce = 
| tradename = 
| Drugs.com = 
| MedlinePlus = 
| licence_CA = 
| licence_EU = 
| DailyMedID = 
| licence_US = 
| pregnancy_AU = 
| pregnancy_category = 
| dependency_liability = 
| addiction_liability = 
| routes_of_administration = 
| class = 
| ATC_prefix = 
| ATC_suffix = 

<!-- Legal status -->
| legal_status = 

<!-- Pharmacokinetic data -->
| bioavailability = 
| protein_bound = 
| metabolism = 
| metabolites = 
| onset = 
| elimination_half-life = 
| duration_of_action = 
| excretion = 

<!-- Identifiers -->
| CAS_number = 805326-00-5
| CAS_supplemental = 
| PubChem = 11447815
| IUPHAR_ligand = 
| DrugBank = 
| ChemSpiderID = 9622668
| UNII = JS6A6EQZ44
| KEGG = 
| ChEBI = 
| ChEMBL = 450014
| NIAID_ChemDB = 
| PDB_ligand = 
| synonyms = 

<!-- Chemical data -->
| IUPAC_name = Ethyl 8-oxo-6,7-dihydro-5H-[1,3]thiazolo[3,2-a][1,3]diazepine-3-carboxylate
| C=10 | H=12 | N=2 | O=3 | S=1
| SMILES = O=C(C1=CSC(N1CCC2)=NC2=O)OCC
| StdInChI = 1S/C10H12N2O3S/c1-2-15-9(14)7-6-16-10-11-8(13)4-3-5-12(7)10/h6H,2-5H2,1H3
| StdInChIKey = UXGPDPNGDCOQBY-UHFFFAOYSA-N
}}

'''HIE-124''' is an investigational [nonbenzodiazepine](/source/nonbenzodiazepine) drug being researched for its short acting [hypnotic](/source/hypnotic) effects.<ref>{{cite journal | vauthors = Kadi A, El-Kashef H, Abdel-Aziz A, Hassan G, Tettey J, Grant M, Lehmann J, El-Subbagh H | title = Synthesis, ultra-short acting hypnotic activity, and metabolic profile of ethyl 8-oxo-5,6,7,8-tetrahydro-thiazolo[3,2-a] [1,3]diazepin-3-carboxylate (HIE-124) | journal = Archiv der Pharmazie | volume = 341 | issue = 2 | pages = 81–89 | date = February 2008 | pmid = 18214840 | doi = 10.1002/ardp.200700132 | s2cid = 12263886 }}</ref>

== References ==
{{Reflist}}

{{sedative-stub}}

Category:Ethyl esters
Category:Diazepines
Category:Thiazoles
Category:Nonbenzodiazepines

---
Adapted from the Wikipedia article [HIE-124](https://en.wikipedia.org/wiki/HIE-124) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/HIE-124?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.