# Fustin

> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/Fustin
> Markdown URL: https://mediated.wiki/source/Fustin.md
> Source: https://en.wikipedia.org/wiki/Fustin
> Source revision: 1152729688
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)

{{chembox
| Watchedfields = changed
| verifiedrevid = 424693354
| Name = Fustin
| ImageFile = Fustin.svg
| ImageSize = 200px
| IUPACName = (2''R'',3''R'')-3,3′,4′,7-Tetrahydroxyflavan-4-one
| SystematicName = (2''R'',3''R'')-2-(3,4-Dihydroxyphenyl)-3,7-dihydroxy-2,3-dihydro-4''H''-1-benzopyran-4-one
| OtherNames = 2,3-Dihydrofisetin<br>3,7,3',4'-Tetrahydroxyflavanone<br>2,3-Dihydrofisetin<br>3′,4′,7-Trihydroxyflavanol
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 20725-03-5
| ChEBI = 5202
| ChEMBL = 470267
| ChemSpiderID = 4476304
| EINECS = 243-989-6
| KEGG = C01378
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 4994C1X19A
| PubChem = 5317435
| StdInChI=1S/C15H12O6/c16-8-2-3-9-12(6-8)21-15(14(20)13(9)19)7-1-4-10(17)11(18)5-7/h1-6,14-18,20H/t14-,15+/m0/s1
| StdInChIKey = FNUPUYFWZXZMIE-LSDHHAIUSA-N
| SMILES = C1=CC(=C(C=C1[C@@H]2[C@H](C(=O)C3=C(O2)C=C(C=C3)O)O)O)O
  }}
|Section2={{Chembox Properties
| C=15|H=12|O=6
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
  }}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
  }}
}}

'''Fustin''', sometimes called "dihydrofisetin", is a [flavanonol](/source/flavanonol), a type of flavonoid. It can be found in [young fustic](/source/young_fustic) (''Cotinus coggygria'')<ref>{{cite journal | doi = 10.1007/s00216-009-2767-z| pmid = 19352635| title = Phytochemical analysis of young fustic (Cotinus coggygria heartwood) and identification of isolated colourants in historical textiles| journal = Analytical and Bioanalytical Chemistry| volume = 394| issue = 3| pages = 871| year = 2009| last1 = Valianou| first1 = Lemonia| last2 = Stathopoulou| first2 = Konstantina| last3 = Karapanagiotis| first3 = Ioannis| last4 = Magiatis| first4 = Prokopios| last5 = Pavlidou| first5 = Eleni| last6 = Skaltsounis| first6 = Alexios-Leandros| last7 = Chryssoulakis| first7 = Yannis| s2cid = 22188491}}</ref> and in the lacquer tree (''[Toxicodendron vernicifluum](/source/Toxicodendron_vernicifluum)'').<ref name="Park">{{cite journal | doi = 10.1038/emm.2007.35| title = Protective effects of fustin, a flavonoid from Rhus verniciflua Stokes, on 6-hydroxydopamine-induced neuronal cell death| journal = Experimental & Molecular Medicine| volume = 39| issue = 3| pages = 316| year = 2007| last1 = Park| first1 = Byung Chul| last2 = Lee| first2 = Yong Soo| last3 = Park| first3 = Hee-Juhn| last4 = Kwak| first4 = Mi-Kyoung| last5 = Yoo| first5 = Bong Kyu| last6 = Kim| first6 = Joo Young| last7 = Kim| first7 = Jung-Ae| pmid = 17603285| doi-access = free}}</ref>

Fustin shows protective effects on 6-hydroxydopamine-induced neuronal cell death.<ref name="Park"/>

Unlike [fisetin](/source/fisetin), fustin has no double bond in the C-ring. This makes fustin a [flavan](/source/flavan), with two [stereocenter](/source/stereocenter)s and four [stereoisomer](/source/stereoisomer)s.

==References==
{{reflist}}

{{flavanonol}}

Category:Flavanonols
Category:Catechols

---
Adapted from the Wikipedia article [Fustin](https://en.wikipedia.org/wiki/Fustin) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/Fustin?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.