# Fructone

> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/Fructone
> Markdown URL: https://mediated.wiki/source/Fructone.md
> Source: https://en.wikipedia.org/wiki/Fructone
> Source revision: 1352323603
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)

{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 436706508
| ImageFile = Fructone.svg
| ImageAlt = Skeletal formula of fructone
| ImageFile1 = Fructone-3D-balls.png
| ImageSize1 = 160
| ImageAlt1 = Ball-and-stick model of the fructone molecule
| PIN = Ethyl (2-methyl-1,3-dioxolan-2-yl)acetate
| OtherNames = Ethyl 2-(2-methyl-1,3-dioxolan-2-yl)acetate
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 6413-10-1
| PubChem = 80865
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 72995
| SMILES = CC1(OCCO1)CC(OCC)=O
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C8H14O4/c1-3-10-7(9)6-8(2)11-4-5-12-8/h3-6H2,1-2H3
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = XWEOGMYZFCHQNT-UHFFFAOYSA-N
<!--| InChI = InChI=1/C8H14O4/c1-3-10-7(9)6-8(2)11-4-5-12-8/h3-6H2,1-2H3/i1-12,2-12,3-12,4-12,5-12,6-12,7-12,8-12,9-16,10-16,11-16,12-16-->
| EINECS =229-114-0
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = G5EXI4NID0
}}
|Section2={{Chembox Properties
| Formula = C<sub>8</sub>H<sub>14</sub>O<sub>4</sub>
| MolarMass = 174.19
| Appearance = Clear liquid
| Density = 1.067{{nbsp}}g/cm<sup>3</sup> <sup>(1)</sup>
| MeltingPt = 
| BoilingPt = 207.99 (760{{nbsp}}mmHg)
| Solubility = 1.893{{nbsp}}g/L
}}
|Section3={{Chembox Hazards
| MainHazards = 
| FlashPtC = 97
| AutoignitionPtC = 
}}
}}

'''Fructone''' is the [organic compound](/source/organic_compound) with the formula {{chem2|CH3C(O2C2H4)CH2CO2C2H5}}  It is the [ketal](/source/ketal) derived from the condensation of [ethyl acetoacetate](/source/ethyl_acetoacetate) and [ethylene glycol](/source/ethylene_glycol).  Also known as '''apple ketal''' and '''applinal''', it has a fruity, apple-like smell with pineapple, strawberry, and woody aspects reminiscent of pine trees (described as "sweet, fruity, apple, green, tropical, plum, woody").<ref>{{cite web |title=apple ketal|url=https://scentsandflavors.com/database/9dbb5134-74e3-468e-ae3a-64b41d0d9104|website=Scents and Flavors |publisher=Scents and Flavors |access-date=1 April 2026}}</ref>  It is a commercial fragrance.<ref>{{cite book |doi=10.1002/14356007.t11_t02 |chapter=Flavors and Fragrances, 3. Aromatic and Heterocyclic Compounds |title=Ullmann's Encyclopedia of Industrial Chemistry |date=2016 |last1=Panten |first1=Johannes |last2=Surburg |first2=Horst |pages=1–45 |isbn=978-3-527-30673-2 }}</ref>

== External links ==
* [http://www.iff.co.th/Ingredients.nsf/0/07B538A011C249B18025699300363143 Fructone product page]{{Dead link|date=December 2019 |bot=InternetArchiveBot |fix-attempted=yes }} IFF
* [https://scentsandflavors.com/database/9dbb5134-74e3-468e-ae3a-64b41d0d9104 Extensive data page]

==References==
<references />

Category:Flavors
Category:Dioxolanes
Category:Carboxylate esters
Category:Sweet-smelling chemicals
Category: Perfume ingredients
Category:Ethyl esters

---
Adapted from the Wikipedia article [Fructone](https://en.wikipedia.org/wiki/Fructone) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/Fructone?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.