# Ethandrostate
> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/Ethandrostate
> Markdown URL: https://mediated.wiki/source/Ethandrostate.md
> Source: https://en.wikipedia.org/wiki/Ethandrostate
> Source revision: 1329020611
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields =
| Watchedfields =
| verifiedrevid =
| IUPAC_name = [(3''S'',8''R'',9''S'',10''R'',13''S'',14''S'',17''R'')-17-ethynyl-17-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[''a'']phenanthren-3-yl] 3-cyclohexylpropanoate
| image = Ethandrostate.svg
| image_class = skin-invert-image
| width =
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration = [By mouth](/source/Oral_administration), [intramuscular injection](/source/intramuscular_injection)
| class = [Estrogen](/source/Estrogen_(medication))
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref =
| CAS_number =
| CAS_supplemental =
| ATC_prefix =
| ATC_suffix =
| ATC_supplemental =
| PubChem = 227055
| IUPHAR_ligand =
| DrugBank_Ref =
| DrugBank =
| ChemSpiderID_Ref =
| ChemSpiderID = 197507
| UNII =
| KEGG =
| ChEBI =
| ChEMBL =
| synonyms = Ethynylandrostenediol 3β-cyclohexanepropionate; 17α-Ethynylandrost-5-ene-3β,17β-diol 3β-cyclohexanepropionate; 17α-Pregn-5-en-20-yne-3β,17β-diol 3β-cyclohexanepropionate; NSC-18216
| C=30 | H=44 | O=3
| SMILES = C[C@]12CC[C@@H](CC1=CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CC[C@]4(C#C)O)C)OC(=O)CCC5CCCCC5
| StdInChI_Ref =
| StdInChI = 1S/C30H44O3/c1-4-30(32)19-16-26-24-12-11-22-20-23(33-27(31)13-10-21-8-6-5-7-9-21)14-17-28(22,2)25(24)15-18-29(26,30)3/h1,11,21,23-26,32H,5-10,12-20H2,2-3H3/t23-,24+,25-,26-,28-,29-,30-/m0/s1
| StdInChIKey_Ref =
| StdInChIKey = VGTIQIQOBZXZAI-IODDZSIWSA-N
}}
'''Ethandrostate''', also known as '''ethinylandrostenediol 3β-cyclohexanepropionate''', is a [synthetic](/source/synthetic_compound) [steroid](/source/steroid)al [estrogen](/source/estrogen_(medication)) and [ester](/source/ester) of [ethinylandrostenediol](/source/ethinylandrostenediol) (17α-ethynyl-5-androstenediol) which was developed and studied in people with certain [cancer](/source/cancer)s like [breast cancer](/source/breast_cancer) and [prostate cancer](/source/prostate_cancer) in the 1950s but was never marketed.[{{cite book|author=Elva G. Shipley|chapter=Anti-gonadotropic steroids, inhibition of ovulation and mating|pages=179–274| veditors = Dorfman RI |title=Bioassay|chapter-url=https://books.google.com/books?id=WS_LBAAAQBAJ&pg=PA179|date=1962|publisher=Elsevier|isbn=978-1-4832-7276-4}}][{{cite journal | vauthors = Boccabella A, Bakritges C | title = Effects of ethandrostate on pituitary and sex organs of rats | journal = Anatomical Record | date = January 1956 | volume = 124 | issue = 2 | pages = 260 }}][{{cite journal| vauthors = Clinton R, Neumann H, Laskowski S, Christiansen R |title=Notes - Esters of 17α-Ethinyl-androstane-3β,17β-diol and 17 α-Ethinylandrost-5-ene-3β, 17β-diol|journal=The Journal of Organic Chemistry|volume=22|issue=4|year=1957|pages=473–475|issn=0022-3263|doi=10.1021/jo01355a627}}][{{cite journal | vauthors = Olson KB, Frawley TF, Stein AA, Shields D | title = Ethandrostate: endocrine effects and studies in treatment of cancer | journal = Cancer | volume = 11 | issue = 3 | pages = 537–45 | date = 1958 | pmid = 13523561 | doi = 10.1002/1097-0142(195805/06)11:3<537::aid-cncr2820110313>3.0.co;2-w | s2cid = 738607 | doi-access = }}] Although far less [potent](/source/potency_(pharmacology)) by weight than [estradiol](/source/estradiol_(medication)) or [estrone](/source/estrone_(medication)), ethandrostate produces [estrogen](/source/estrogen_(medication))ic effects in the [vagina](/source/vagina), [uterus](/source/uterus), and [mammary gland](/source/mammary_gland)s as well as [antigonadotropic](/source/antigonadotropic) and secondary [antiandrogen](/source/antiandrogen)ic effects like [testicular](/source/testicular_atrophy) and [prostate](/source/prostate) [atrophy](/source/atrophy) in both animals and humans.