# Dimethyl chlorendate

> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/Dimethyl_chlorendate
> Markdown URL: https://mediated.wiki/source/Dimethyl_chlorendate.md
> Source: https://en.wikipedia.org/wiki/Dimethyl_chlorendate
> Source revision: 1301008184
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)

{{Chembox
 | Watchedfields = changed
| verifiedrevid = 443691896
| ImageFile = DimethylChlorendate.svg
  | PIN = Dimethyl (1''R'',2''R'',3''S'',4''S'')-1,4,5,6,7,7-hexachlorobicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate
 | OtherNames = Dimethyl hexachloroendomethylenetetrahydrophthalate; 1,4,5,6,7,7-Hexachlorobicyclo(2.2.1)hept-5-ene-2,3-dicarboxylic acid dimethyl ester; NSC12446
 
|Section1={{Chembox Identifiers
  | CASNo_Ref = {{cascite|correct|??}}
| CASNo = 1773-89-3
  | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 2T60Q2D44E
  | PubChem = 164881
  | EINECS = 217-202-1 
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 24751856
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C11H8Cl6O4/c1-20-7(18)3-4(8(19)21-2)10(15)6(13)5(12)9(3,14)11(10,16)17/h3-4H,1-2H3/t3-,4+,9-,10+
| SMILES = COC(=O)[C@H]1[C@H]([C@@]2(C(=C([C@]1(C2(Cl)Cl)Cl)Cl)Cl)Cl)C(=O)OC
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = MDHHRPHYYRMIPH-OWEGFZGBSA-N
}}
 
|Section2={{Chembox Properties
   | C=11 | H=8 | Cl=6 | O=4
  | Appearance = 
  | Density = 1.71&nbsp;g/cm<sup>3</sup>
  | MeltingPt = 
  | BoilingPtC = 428.4
| BoilingPt_notes = 
  | Solubility = 
 }}
 
|Section3={{Chembox Hazards
  | MainHazards = 
  | FlashPtC = 162.8
  | AutoignitionPtC = 
 }}
 | Reference = <ref name="PubChem">{{cite web
  | url = https://pubchem.ncbi.nlm.nih.gov/compound/164881
  | title = Dimethyl chlorendate - PubChem Public Chemical Database
  | publisher = PubChem
  | access-date = 2010-12-17
 }}</ref><ref name="ChemIndustry.com">{{cite web
  | url = http://www.chemindustry.com/chemicals/01727938.html
  | title = NSC 12446, CAS Number: 1773-89-3
  | publisher = ChemIndustry.com
  | access-date = 2010-12-17
 }}</ref><ref name="Museum of Learning">{{cite web
  | url = http://www.museumstuff.com/learn/topics/dimethyl_chlorendate
  | title = Dimethyl chlorendate : Define, Explore, Discuss
  | publisher = Museum of Learning
  | access-date = 2010-12-17
 }}</ref><ref name="Chemical Register">{{cite web
  | url = http://www.chemicalregister.com/DIMETHYL_CHLORENDATE/Suppliers/pid268825.htm
  | title = DIMETHYL CHLORENDATE CAS 1773-89-3
  | publisher = Chemical Register
  | access-date = 2010-12-17
 }}</ref>
}}

'''Dimethyl chlorendate''' is a [chlorendic acid](/source/chlorendic_acid) used as a [flame retardant](/source/flame_retardant) additive.

==References==
{{Reflist}}

Category:Organochlorides
Category:Flame retardants
Category:IARC Group 2B carcinogens
Category:Methyl esters

{{organohalide-stub}}

---
Adapted from the Wikipedia article [Dimethyl chlorendate](https://en.wikipedia.org/wiki/Dimethyl_chlorendate) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/Dimethyl_chlorendate?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.