# DOPF

> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/DOPF
> Markdown URL: https://mediated.wiki/source/DOPF.md
> Source: https://en.wikipedia.org/wiki/DOPF
> Source revision: 1340546338
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)

{{Short description|Substituted amphetamine designer drug}}
{{drugbox
| drug_name = 
| image = DOPF structure.svg
| image_class = skin-invert-image
| width = 250px
| routes_of_administration = Unknown<ref name="TrachselLehmannEnzensperger2013" />
| duration_of_action = Unknown<ref name="TrachselLehmannEnzensperger2013" />
| legal_UK =
| legal_DE = 
| C = 14 | H = 22 | F = 1 | N = 1 | O = 2
| IUPAC_name = 	2-[4-(3-fluoropropyl)-2,5-dimethoxyphenyl]ethanamine
| CAS_number = 
| ChemSpiderID = 129558527
| PubChem = 163192484
| synonyms = DOPF; 2,5-Dimethoxy-4-(3-fluoropropyl)amphetamine; 4-(3-Fluoropropyl)-2,5-dimethoxyamphetamine
| SMILES = COc1cc(CCCF)c(cc1CC(C)N)OC
| StdInChI=1S/C14H22FNO2/c1-10(16)7-12-9-13(17-2)11(5-4-6-15)8-14(12)18-3/h8-10H,4-7,16H2,1-3H3
| StdInChIKey = UIHSFMYQJAKMHD-UHFFFAOYSA-N
}}

'''DOPF''', also known as '''2,5-dimethoxy-4-(3-fluoropropyl)amphetamine''', is a [designer drug](/source/designer_drug) from the [amphetamine](/source/substituted_amphetamine) and [DOx](/source/DOx) families.<ref name="TrachselLehmannEnzensperger2013" /> It was first synthesised by [Alexander Shulgin](/source/Alexander_Shulgin) and [David Nichols](/source/David_E._Nichols) in 1989 but was never published at the time, and was finally disclosed in [Daniel Trachsel](/source/Daniel_Trachsel)'s review of the field in 2013.<ref name="TrachselLehmannEnzensperger2013" /> It has a [binding affinity](/source/binding_affinity) (K<sub>i</sub>) of 9&nbsp;[nM](/source/Nanomolar) at the [serotonin receptor](/source/serotonin_receptor) [5-HT<sub>2A</sub>](/source/5-HT2A) but is not known to have been tested in humans.<ref name="TrachselLehmannEnzensperger2013">{{cite book | vauthors = Trachsel D, Lehmann D, Enzensperger C | title = Phenethylamine Von der Struktur zur Funktion | trans-title = Phenethylamine From structure to function | language = German | page = 778-780 | publisher = Nachtschatten Verlag AG | date = 2013 | isbn = 978-3-03788-700-4 }}</ref> DOPF is a [controlled substance](/source/controlled_substance) in [Canada](/source/Canada) under phenethylamine blanket-ban language.<ref name="CDSA">{{cite web | title=Controlled Drugs and Substances Act | website=Department of Justice Canada | url=https://laws-lois.justice.gc.ca/eng/acts/c-38.8/FullText.html | access-date=19 January 2026}}</ref>

== See also ==
* [DOx (psychedelics)](/source/DOx_(psychedelics))
* [DOBU](/source/DOBU)
* [DOEF](/source/DOEF)
* [DOPR](/source/DOPR)
* [DOTFM](/source/DOTFM)
* [2C-TFE](/source/2C-TFE)
* [2C-T-21](/source/2C-T-21)
* [2C-T-28](/source/2C-T-28)

== References ==
{{Reflist}}

==External links==
* [https://isomerdesign.com/pihkal/explore/10323 DOPF - Isomer Design]

{{Psychedelics}}
{{Serotonin receptor modulators}}
{{Phenethylamines}}

Category:Daniel Trachsel
Category:Designer drugs
Category:DOx (psychedelics)
Category:Methoxy compounds
Category:Organofluorides
Category:Psychedelic phenethylamines
Category:Serotonin receptor modulators

{{Hallucinogen-stub}}

---
Adapted from the Wikipedia article [DOPF](https://en.wikipedia.org/wiki/DOPF) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/DOPF?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.