# Cortagen

> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/Cortagen
> Markdown URL: https://mediated.wiki/source/Cortagen.md
> Source: https://en.wikipedia.org/wiki/Cortagen
> Source revision: 1338108455
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)

{{cs1 config|name-list-style=vanc|display-authors=6}}
{{Infobox drug
| image = Cortagen_structure.png
| image_class = skin-invert-image
| width = 260
<!-- Clinical data -->
| tradename = 
| pregnancy_category = 
| routes_of_administration = 
| class = 
| ATC_prefix = 
| ATC_suffix = 
| ATC_supplemental = <!-- Legal status -->
| legal_status = <!-- Pharmacokinetic data -->
| bioavailability = 
| protein_bound = 
| metabolism = 
| metabolites = 
| onset = 
| elimination_half-life = 
| duration_of_action = 
| excretion = <!-- Identifiers -->
| CAS_number = 
| PubChem = 18439621
| IUPHAR_ligand = 
| DrugBank = 
| ChemSpiderID = 16364972
| UNII = 
| KEGG = 
| ChEBI = 
| ChEMBL = 
| NIAID_ChemDB = 
| PDB_ligand = <!-- Chemical and physical data -->
| IUPAC_name = <nowiki>(2S)-1-[(2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-4-carboxybutanoyl]amino]-3-carboxypropanoyl]pyrrolidine-2-carboxylic acid</nowiki>
| C = 17
| H = 26
| N = 4
| O = 9
| StdInChI = 1S/C17H26N4O9/c1-8(18)14(26)19-9(4-5-12(22)23)15(27)20-10(7-13(24)25)16(28)21-6-2-3-11(21)17(29)30/h8-11H,2-7,18H2,1H3,(H,19,26)(H,20,27)(H,22,23)(H,24,25)(H,29,30)/t8-,9-,10-,11-/m0/s1
| StdInChIKey = PLTRIMAUDDQYRV-NAKRPEOUSA-N
| SMILES = C[C@@H](C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)N1CCC[C@H]1C(=O)O)N
}}

'''Cortagen''' is a [tetrapeptide](/source/tetrapeptide) with the sequence '''AEDP''' or Ala-Glu-Asp-Pro. It was originally identified as a primary active component of Cortexin, a mixture of peptides derived from cow brain cortex tissue. It is claimed to stimulate nerve growth and enhance repair of damaged nerves.<ref>{{cite journal | vauthors = Turchaninova LN, Kolosova LI, Malinin VV, Moiseeva AB, Nozdrachev AD, Khavinson VK | title = Effect of tetrapeptide cortagen on regeneration of sciatic nerve | journal = Bulletin of Experimental Biology and Medicine | volume = 130 | issue = 12 | pages = 1172–1174 | date = December 2000 | doi = 10.1023/A:1017532001908 | pmid = 11276314 }}</ref><ref>{{cite journal | vauthors = Anisimov SV, Khavinson VK, Anisimov VN | title = Elucidation of the effect of brain cortex tetrapeptide Cortagen on gene expression in mouse heart by microarray | journal = Neuro Endocrinology Letters | date = 2004 | volume = 25 | issue = 1–2 | pages = 87–93 | pmid = 15159690 }}</ref><ref>{{cite journal | vauthors = Zarubina IV, Shabanov PD | title = [Cortexin and cortagen as correcting agents in functional and metabolic disorders in the brain in chronic ischemia] | journal = Eksperimental'naia i Klinicheskaia Farmakologiia | date = 2011 | volume = 74 | issue = 2 | pages = 8–15 | pmid = 21476278 }}</ref><ref>{{cite journal | vauthors = Zarubina IV, Shabanov PD | title = Neuroprotective Effects of Peptides during Ischemic Preconditioning | journal = Bulletin of Experimental Biology and Medicine | volume = 160 | issue = 4 | pages = 448–451 | date = February 2016 | pmid = 26902350 | doi = 10.1007/s10517-016-3193-9 }}</ref>

== See also ==
* [Epitalon](/source/Epitalon)
* [GHK-Cu](/source/GHK-Cu)
* [GPE](/source/Gly-Pro-Glu)
* [KPV tripeptide](/source/KPV_tripeptide)
* [Livagen](/source/Livagen)
* [Pinealon](/source/Pinealon)
* [Vladimir Khavinson](/source/Vladimir_Khavinson)

== References ==
{{Reflist}}

Category:Tricarboxylic acids
Category:Tetrapeptides

---
Adapted from the Wikipedia article [Cortagen](https://en.wikipedia.org/wiki/Cortagen) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/Cortagen?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.
