# Confusarin

> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/Confusarin
> Markdown URL: https://mediated.wiki/source/Confusarin.md
> Source: https://en.wikipedia.org/wiki/Confusarin
> Source revision: 1324042268
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)

{{chembox
| ImageFile = Confusarin.svg
| ImageCaption = Chemical structure of confusarin
| PIN =  1,5,6-Trimethoxyphenanthrene-2,7-diol
| OtherNames = 2,7-dihydroxy-3,4,8-trimethoxyphenanthrene
|Section1={{Chembox Identifiers
| CASNo_Ref = {{Cascite|changed|CAS}}
| CASNo = 108909-02-0 
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = CRH455ZW4X
| ChEMBL = 3634642
| ChemSpiderID = 10155793
| InChI = 1/C17H16O5/c1-20-15-11-5-4-9-8-13(19)16(21-2)17(22-3)14(9)10(11)6-7-12(15)18/h4-8,18-19H,1-3H3
| InChIKey = JHNVCKNCEVZGGC-UHFFFAOYAW
| StdInChI = 1S/C17H16O5/c1-20-15-11-5-4-9-8-13(19)16(21-2)17(22-3)14(9)10(11)6-7-12(15)18/h4-8,18-19H,1-3H3
| StdInChIKey = JHNVCKNCEVZGGC-UHFFFAOYSA-N
| PubChem = 11983285
| SMILES = COc3c2c(ccc1c(OC)c(O)ccc12)cc(O)c3OC
  }}
|Section2={{Chembox Properties
| C = 17 | H = 16 | O = 5
| Appearance = 
| Density = 
| MeltingPtC = 
| BoilingPtC = 
| Solubility =
  }}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPtC = 
| AutoignitionPt =
  }}
}}

'''Confusarin''' is a phenanthrenoid found in the orchids ''[Eria confusa](/source/Eria_confusa)''<ref>{{cite journal | doi = 10.1016/S0031-9422(00)82363-8 | title = Confusarin and confusaridin two phenanthrene derivatives of the orchid Eria Confusa | date = 1987 | last1 = Majumder | first1 = P.L. | last2 = Kar | first2 = Amita | journal = Phytochemistry | volume = 26 | issue = 4 | pages = 1127–1129 | bibcode = 1987PChem..26.1127M }}</ref> and ''[Bulbophyllum reptans](/source/Bulbophyllum_reptans)''.<ref>{{cite journal | doi = 10.1016/S0031-9422(98)00609-8 | title = Dimeric phenanthrenes from the orchid Bulbophyllum reptans | date = 1999 | last1 = Majumder | first1 = P.L | last2 = Pal | first2 = S. | last3 = Majumder | first3 = S. | journal = Phytochemistry | volume = 50 | issue = 5 | pages = 891–897 | bibcode = 1999PChem..50..891M }}</ref> It can also be synthesized.<ref>{{cite journal | doi = 10.1016/j.tet.2007.09.052 | title = Total synthesis of two natural phenanthrenes: Confusarin and a regioisomer | date = 2007 | last1 = Radix | first1 = Sylvie | last2 = Barret | first2 = Roland | journal = Tetrahedron | volume = 63 | issue = 50 | pages = 12379–12387 }}</ref>

== References ==
{{reflist}}

== External links ==
* [https://web.archive.org/web/20150711030832/http://kanaya.naist.jp/knapsack_jsp/information.jsp?word=C00015258 Confusarin at kanaya.naist.jp/knapsack_jsp]

{{phenanthrenes}}

Category:Phenanthrenoids
Category:Orchids
Category:Methoxy compounds

{{aromatic-stub}}

---
Adapted from the Wikipedia article [Confusarin](https://en.wikipedia.org/wiki/Confusarin) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/Confusarin?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.