# Compound NJ2

> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/Compound_NJ2
> Markdown URL: https://mediated.wiki/source/Compound_NJ2.md
> Source: https://en.wikipedia.org/wiki/Compound_NJ2
> Source revision: 1248681543
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)

{{Chembox
| ImageFile = NJ 2.svg
| ImageSize = 250px
| ImageAlt = Structure of compound NJ2, a xanthylium pigment found in wine.
| IUPACName = 6,20-bis(3,4-dihydroxyphenyl)-7,10,16,19-tetrahydroxy-5,21-dioxa-13-oxoniapentacyclo[12.8.0.0<sup>3,12</sup>.0<sup>4,9</sup>.0<sup>17,22</sup>]docosa-1,3(12),4(9),10,13,15,17(22)-heptaene-2-carboxylic acid
| OtherNames = 
|Section1={{Chembox Identifiers
| CASNo = 
| PubChem = 73194534
| SMILES = Oc6ccc(cc6O)C7Oc(c5CC7O)c4c(C(=O)O)c(c(cc1O)[o+]c4cc5O)c(c1CC2O)OC2c(cc3O)ccc3O
| StdInChI=1S/C32H24O13/c33-15-3-1-11(5-19(15)37)28-21(39)7-13-17(35)9-23-25(30(13)44-28)27(32(41)42)26-24(43-23)10-18(36)14-8-22(40)29(45-31(14)26)12-2-4-16(34)20(38)6-12/h1-6,9-10,21-22,28-29,39-40H,7-8H2,(H6-,33,34,35,36,37,38,41,42)/p+1
| StdInChIKey = VVMHZAVGHYVZHM-UHFFFAOYSA-O
  }}
|Section2={{Chembox Properties
| C=32 | H=25 | O=13 | Formula_Charge = +
| Appearance = 
| Density = 
| MeltingPt = 
| BoilingPt = 
| Solubility = 
  }}
|Section3={{Chembox Hazards
| MainHazards = 
| FlashPt = 
| AutoignitionPt = 
  }}
}}

'''Compound NJ2''' is a xanthylium yellowish pigment found in wine.

In model solutions, colorless compounds, such as [catechin](/source/catechin), can give rise to new types of pigments. The first step is the formation of colorless [dimeric](/source/Dimer_(chemistry)) compounds consisting of two [flavanol](/source/flavanol) units linked by carboxy-[methine](/source/methine) bridge. This is followed by the formation of [xanthylium](/source/xanthylium) salt yellowish pigments and their [ethyl ester](/source/ethyl_ester)s, resulting from the dehydration of the colorless dimers, followed by an oxidation process. The loss of a water molecule takes place between two A ring [hydroxyl group](/source/hydroxyl_group)s of the colorless dimers.<ref>{{cite journal | doi = 10.1046/j.1365-2621.2000.00339.x | title = Xanthylium salts formation involved in wine colour changes | date = 2000 | last1 = Es-Safi | first1 = Nour-Eddine | last2 = Le Guernevé | first2 = Christine | last3 = Fulcrand | first3 = Hélène | last4 = Cheynier | first4 = Véronique | last5 = Moutounet | first5 = Michel | journal = International Journal of Food Science & Technology | volume = 35 | pages = 63–74 }}</ref>

== See also ==
* [Wine color](/source/Wine_color)
* [Phenolic content in wine](/source/Phenolic_content_in_wine)

== References ==
{{reflist}}

Category:Polyphenols
Category:Heterocyclic compounds with 5 rings
Category:Carboxylic acids
Category:Oxonium compounds
Category:Catechols

{{aromatic-stub}}

---
Adapted from the Wikipedia article [Compound NJ2](https://en.wikipedia.org/wiki/Compound_NJ2) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/Compound_NJ2?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.