# Chlorophyll c

> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/Chlorophyll_c
> Markdown URL: https://mediated.wiki/source/Chlorophyll_c.md
> Source: https://en.wikipedia.org/wiki/Chlorophyll_c
> Source revision: 1354309622
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)

{{DISPLAYTITLE:Chlorophyll ''c''}}
'''Chlorophyll ''c''''' refers to forms of [chlorophyll](/source/chlorophyll) found in certain marine algae, including the photosynthetic [Chromista](/source/Chromista) (e.g. [diatoms](/source/diatoms) and [brown algae](/source/brown_algae)) and [dinoflagellates](/source/dinoflagellates).<ref name=foundin>{{cite web |last=Speer |first=B. R. |title=Photosynthetic Pigments |url=http://www.ucmp.berkeley.edu/glossary/gloss3/pigments.html |access-date=2 August 2014}}</ref><ref name="MolMech"/><ref name=SPDC>{{cite journal |vauthors=Dougherty RC, Strain HH, Svec WA, Uphaus RA, Katz JJ |title=The structure, properties, and distribution of chlorophyll c |journal=[Journal of the American Chemical Society](/source/Journal_of_the_American_Chemical_Society) |volume=92 |issue=9 |pages=2826–33 |date=May 1970 |pmid=5439971 |doi=10.1021/ja00712a037|bibcode=1970JAChS..92.2826D }}</ref> These pigments are characterized by their unusual chemical structure, with a [porphyrin](/source/porphyrin) as opposed to the [chlorin](/source/chlorin) (which has a reduced ring D) as the core; they also do not have an isoprenoid tail. Both these features stand out from the other chlorophylls commonly found in algae and plants.<ref name=MolMech>{{cite book|author1-link=Robert E. Blankenship |last=Blankenship |first=Robert E. |name-list-style=vanc |title=Molecular Mechanisms of Photosynthesis |date=February 2002 |publisher=[Wiley](/source/Wiley_(publisher))-Blackwell}}</ref>

It has a blue-green color and is an [accessory pigment](/source/accessory_pigment), particularly significant in its absorption of light in the 447&ndash;520&nbsp;nm wavelength region.<ref name="SPDC" /> Like [chlorophyll ''a''](/source/chlorophyll_a) and [chlorophyll ''b''](/source/chlorophyll_b), it helps the organism gather light and passes a quanta of excitation energy through the light harvesting antennae to the [photosynthetic reaction centre](/source/photosynthetic_reaction_centre).<ref name=MolMech/>

Chlorophyll ''c'' can be further divided into chlorophyll ''c''<sub>1</sub>, chlorophyll ''c''<sub>2</sub>,<ref name="SPDC"/> and chlorophyll ''c''<sub>3</sub>,<ref name=c3>{{cite journal |vauthors=Fookes CJ, Jeffrey SW |title=The structure of chlorophyll ''c<sub>3</sub>'', a novel marine photosynthetic pigment |journal=J. Chem. Soc., Chem. Commun. |date=1989 |issue=23 |pages=1827–28 |doi=10.1039/C39890001827}}</ref> plus at least eight other more recently found subtypes.<ref name=CurrentStat>{{cite journal |last1=Zapata |first1=Manuel |last2=Garrido |first2=José L. |last3=Jeffrey |first3=Shirley W. |name-list-style=vanc |title=Chlorophyll c Pigments: Current Status |journal=Chlorophylls and Bacteriochlorophylls: Advances in Photosynthesis and Respiration |year=2006 |volume=25 |pages=39–53 |doi=10.1007/1-4020-4516-6_3 |series=Advances in Photosynthesis and Respiration |isbn=978-1-4020-4515-8}}</ref>

==Chlorophyll ''c''<sub>1</sub>==

'''Chlorophyll''' '''''c''<sub>1</sub>''' is a common form of chlorophyll ''c''. It differs from chlorophyll ''c''<sub>2</sub> in its C8 group, having an ethyl group instead of vinyl group (C-C single bond instead of C=C double bond).
Its [absorption maxima](/source/Absorption_band) are around 444, 577, 626&nbsp;nm and 447, 579, 629&nbsp;nm in [diethyl ether](/source/diethyl_ether) and [acetone](/source/acetone) respectively.<ref name=Fawley>{{cite journal | vauthors = Fawley MW | title = A new form of chlorophyll C involved in light-harvesting | journal = Plant Physiology | volume = 91 | issue = 2 | pages = 727–32 | date = October 1989 | pmid = 16667093 | pmc = 1062062 | doi = 10.1104/pp.91.2.727 }}</ref>

{{-}}

==Chlorophyll ''c''<sub>2</sub>==

'''Chlorophyll''' '''''c''<sub>2</sub>''' is the most common form of chlorophyll ''c''.<ref name=c1c2compare>{{cite journal| vauthors = Jeffrey SW |title=The Occurrence of Chlorophyll ''c<sub>1</sub>'' and ''c<sub>2</sub>'' in Algae|journal=Journal of Phycology|date=September 1976|volume=12|issue=3|pages=349–354|doi=10.1111/j.1529-8817.1976.tb02855.x|bibcode=1976JPcgy..12..349J |s2cid=83927313 }}</ref> 
Its absorption maxima are around 447, 580, 627&nbsp;nm and 450, 581, 629&nbsp;nm in diethyl ether and acetone respectively.<ref name=Fawley />

{{-}}

==Chlorophyll ''c''<sub>3</sub>==

'''Chlorophyll''' '''''c''<sub>3</sub>''' is a form of chlorophyll ''c'' found in microalga ''[Emiliania huxleyi](/source/Emiliania_huxleyi)'', identified in 1989 by [Shirley Jeffrey](/source/Shirley_Jeffrey).<ref name="c3"/>
Its absorption maxima are around 452, 585, 625&nbsp;nm and 452, 585, 627&nbsp;nm in diethyl ether and acetone respectively.<ref name=Fawley/>
{{-}}

== Biosynthesis ==
Chlorophyll ''c'' synthesis branches off early from the typical [chlorophyllide](/source/chlorophyllide) synthesis pathway, after [divinylprotochlorophyllide (DV-PChlide) is formed](/source/Chlorophyllide). It has been established that DV-PChlide and MV-PChlide are processed directly by a 17<sup>1</sup> oxidase ('''CHLC, chlorophyll ''c'' synthase''') into Chl ''c''<sub>2</sub> and Chl ''c''<sub>1</sub>, respectively.<ref name=":0">{{Cite journal |last1=Jiang |first1=Yanyou |last2=Cao |first2=Tianjun |last3=Yang |first3=Yuqing |last4=Zhang |first4=Huan |last5=Zhang |first5=Jingyu |last6=Li |first6=Xiaobo |date=2023-10-06 |title=A chlorophyll c synthase widely co-opted by phytoplankton |url=https://www.science.org/doi/10.1126/science.adg7921 |journal=Science |volume=382 |issue=6666 |pages=92–98 |doi=10.1126/science.adg7921|pmid=37797009 |bibcode=2023Sci...382...92J |url-access=subscription }}</ref> 
The 17<sup>1</sup> oxidtion was proposed to proceed by "hydroxylation of the 17-propionate reside at the 17<sup>1</sup>-position and successive dehydration to the 17-acrylate residue."<ref name=":0" /><ref>{{cite journal |last1=Xu |first1=M |last2=Kinoshita |first2=Y |last3=Matsubara |first3=S |last4=Tamiaki |first4=H |date=March 2016 |title=Synthesis of chlorophyll-c derivatives by modifying natural chlorophyll-a. |journal=Photosynthesis Research |volume=127 |issue=3 |pages=335–45 |bibcode=2016PhoRe.127..335X |doi=10.1007/s11120-015-0190-1 |pmid=26346903 |s2cid=254944200}}</ref>
An 8-vinyl reductase (elaborating on the promiscuous behavior of ferredoxin-type [3,8-divinyl chlorophyllide reductase](/source/divinyl_chlorophyllide_a_8-vinyl-reductase)) could also convert Chl ''c''<sub>2</sub> into Chl ''c''<sub>1</sub>. The two steps could be swapped for the same effect.<ref>{{cite journal |last1=Ito |first1=Hisashi |last2=Tanaka |first2=Ayumi |title=Evolution of a New Chlorophyll Metabolic Pathway Driven by the Dynamic Changes in Enzyme Promiscuous Activity |journal=Plant and Cell Physiology |date=March 2014 |volume=55 |issue=3 |pages=593–603 |doi=10.1093/pcp/pct203 |pmid=24399236|hdl=2115/58225 |hdl-access=free }}</ref>

== Structure ==
{| class="wikitable" style="text-align:center;width:100%;"
|-
! style="width:33%;" | Chlorophyll ''c''<sub>1</sub>
! style="width:33%;" | Chlorophyll ''c''<sub>2</sub>
! style="width:33%;" | Chlorophyll ''c''<sub>3</sub>
|-
| valign="top" |{{Chembox
| Name=&nbsp;
| verifiedrevid = 429169129
| ImageFile = Chlorophyll c1.svg
| ImageSize = 
| ImageFile1 = Chlorophyll-c1-3D-balls.png
| ImageAlt1 = Chlorophyll c1 molecule
| IUPACName = [(2E)-3-[14-Ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-9-vinyl-3,4-didehydro-3-phorbinyl-κ2N23,N25]acrylato(2-)]magnesium
| OtherNames = 
|Section1={{Chembox Identifiers
| index1_label = c1
| index2_label = c2
| index3_label = c3
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 11003-45-5
| CASNo1_Ref = {{cascite|correct|CAS}}
| CASNo1 = 18901-56-9
| CASNo2_Ref = {{cascite|correct|CAS}}
| CASNo2 = 27736-03-4
| CASNo3_Ref = {{cascite|correct|CAS}}
| CASNo3 = 111308-93-1

| UNII_Ref = {{fdacite|correct|FDA}}
| UNII= 1A9E276K41
| UNII1_Ref = {{fdacite|correct|FDA}}
| UNII1= 008W2KH70E
| UNII2_Ref = {{fdacite|correct|FDA}}
| UNII2= 8GAP92KIWW
| UNII3_Ref = {{fdacite|correct|FDA}}
| UNII3= FMN10170B8

| PubChem = 25245630
| ChEBI = 38202
| ChemSpiderID = 21865345
| Beilstein = 5801077, 6996880
| SMILES = CCC1=C(C)/C2=C/c3c(C=C)c(C)c4\C=C5/N=C(C(\C=C\C(O)=O)=C/5C)C5=c6c(C(=O)C5C(=O)OC)c(C)c(=CC1=N\2)n6[Mg]n34
| SMILES1 = COC(=O)C9C(=O)c6c(C)c3n7c6c9c2c(C=CC(=O)O)c(C)c1cc5n8c(cc4n([Mg]78n12)c(c=3)c(CC)c4c)c(C=C)c5C
| StdInChI = 1S/C35H32N4O5.Mg/c1-8-19-15(3)22-12-24-17(5)21(10-11-28(40)41)32(38-24)30-31(35(43)44-7)34(42)29-18(6)25(39-33(29)30)14-27-20(9-2)16(4)23(37-27)13-26(19)36-22;/h8,10-14,31H,1,9H2,2-7H3,(H3,36,37,38,39,40,41,42);/q;+2/p-2/b11-10+,22-12-,23-13-,24-12-,25-14-,26-13-,27-14-,32-30-;
| StdInChIKey = DGNIJJSSARBJSH-QRKQXEOSSA-L }}
|Section2={{Chembox Properties
| C=35 | H=30 | O=5 | N=4 | Mg=1
| Appearance = 
| Density = 
| MeltingPt = 
| BoilingPt = 
| Solubility = }}
|Section3={{Chembox Hazards
| MainHazards = 
| FlashPt = 
| AutoignitionPt = }}
}}
| valign="top" |{{Chembox
| Name=&nbsp;
| verifiedrevid = 428811250
| ImageFile = Chlorophyll c2.svg
| ImageSize = 200px
| ImageFile1 = Chlorophyll-c2-3D-balls.png
| ImageAlt1 = Chlorophyll c2 molecule
| IUPACName = [(2E)-3-[21-(Methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-9,14-divinyl-3,4-didehydro-3-phorbinyl-κ2N23,N25]acrylato(2-)]magnesium
| OtherNames = 
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 27736-03-4
| PubChem = 16070018
| ChemSpiderID = 21865346
| ChEBI = 38203
| UNII = 8GAP92KIWW
| Beilstein = 5801049 6996841
| InChI=1S/C35H30N4O5.Mg/c1-8-19-15(3)22-12-24-17(5)21(10-11-28(40)41)32(38-24)30-31(35(43)44-7)34(42)29-18(6)25(39-33(29)30)14-27-20(9-2)16(4)23(37-27)13-26(19)36-22;/h8-14,31H,1-2H2,3-7H3,(H3,36,37,38,39,40,41,42);/q;+2/p-2/b11-10+,22-12?,23-13?,24-12?,25-14?,26-13?,27-14?,32-30?;
| InChIKey = QDRBYWCRXZZVLY-JUQUGTHISA-L
| SMILES = CC1=C(C2=CC3=NC(=CC4=C(C5=C([N-]4)C(=C6C(=C(C(=N6)C=C1[N-]2)C)C=CC(=O)O)C(C5=O)C(=O)OC)C)C(=C3C)C=C)C=C.[Mg+2]
| SMILES1 = COC(=O)C9C(=O)c6c(C)c3n7c6c9c2c(C=CC(=O)O)c(C)c1cc5n8c(cc4n([Mg]78n12)c(c=3)c(C=C)c4c)c(C=C)c5C }}
|Section2={{Chembox Properties
| C=35 | H=28 | O=5 | N=4 | Mg=1
| Appearance = 
| Density = 
| MeltingPt = 
| BoilingPt = 
| Solubility = }}
|Section3={{Chembox Hazards
| MainHazards = 
| FlashPt = 
| AutoignitionPt = }}
}}
| valign="top" |{{Chembox
| Name=&nbsp;
| ImageFile = Chlorophyll c3.svg
| ImageSize = 200px
| ImageFile1 = 
| ImageAlt1 = 
| IUPACName = 
| OtherNames = 
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 111308-93-1
| ChemSpiderID = 32699592
| PubChem = 71587417
| UNII = FMN10170B8
| InChI=1S/C36H30N4O7.Mg/c1-8-18-15(3)21-12-22-16(4)20(10-11-27(41)42)32(39-22)30-31(36(45)47-7)34(43)28-17(5)23(40-33(28)30)13-25-19(9-2)29(35(44)46-6)26(38-25)14-24(18)37-21;/h8-14,31,38,43H,1-2H2,3-7H3,(H,41,42);/q;+2/p-2/b11-10+,21-12?,25-13?,26-14?,32-30?;/t31-;/m1./s1
| InChIKey = CWLZENTWIZFJMW-XUGDHDJXSA-L
| SMILES = CC1=C(C2=NC1=CC3=NC(=C4C(C(=C5C4=NC(=C5C)C=C6C(=C(C(=C2)N6)C(=O)OC)C=C)[O-])C(=O)OC)C(=C3C)C=CC(=O)[O-])C=C.[Mg+2] }}
|Section2={{Chembox Properties
| C=36 | H=28 | O=7 | N=4 | Mg=1
| Appearance = 
| Density = 
| MeltingPt = 
| BoilingPt = 
| Solubility = }}
|Section3={{Chembox Hazards
| MainHazards = 
| FlashPt = 
| AutoignitionPt = }}
}}
|}

== References ==
{{reflist}}

{{tetrapyrroles}}
{{Plant pigments}}

Category:Porphyrins
Category:Photosynthetic pigments
Category:Brown algae
Category:Diatom biology

---
Adapted from the Wikipedia article [Chlorophyll c](https://en.wikipedia.org/wiki/Chlorophyll_c) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/Chlorophyll_c?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.
