# Canolol

> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/Canolol
> Markdown URL: https://mediated.wiki/source/Canolol.md
> Source: https://en.wikipedia.org/wiki/Canolol
> Source revision: 1308945413
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)

{{Chembox
| ImageFile = Canolol.svg
| ImageSize = 150px
| ImageAlt = Chemical structure of canolol
| PIN = 4-Ethenyl-2,6-dimethoxyphenol
| OtherNames = 2,6-Dimethoxy-4-vinylphenol <br />4-Vinyl-2,6-dimethoxyphenol<br />4-Vinylsyringol
|Section1={{Chembox Identifiers
| CASNo = 28343-22-8
| CASNo_Ref = {{cascite|correct|CAS}}
| ChEBI = 197097
| ChemSpiderID = 33074
| EC_number = 848-947-6
| PubChem = 35960
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = ZB5OK5EX8B
| StdInChI=1S/C10H12O3/c1-4-7-5-8(12-2)10(11)9(6-7)13-3/h4-6,11H,1H2,2-3H3
| StdInChIKey = QHJGZUSJKGVMTF-UHFFFAOYSA-N
| SMILES = C=Cc1cc(OC)c(O)c(OC)c1
  }}
|Section2={{Chembox Properties
| C=10
| H=12
| O=3
| Appearance = 
| Density = 
| MeltingPt = 
| BoilingPt = 
| Solubility = 
  }}
|Section3={{Chembox Hazards
| GHS_ref=[https://pubchem.ncbi.nlm.nih.gov/compound/35960#section=Safety-and-Hazards]
| GHSPictograms = {{GHS05}}{{GHS07}}
| GHSSignalWord = Danger
| HPhrases = {{H-phrases|315|318|335}}
| PPhrases = {{P-phrases|261|264|264+265|271|280|302+352|304+340|305+354+338|317|319|321|332+317|362+364|403+233|405|501}}
| MainHazards = 
| FlashPt = 
| AutoignitionPt = 
  }}
}}

'''Canolol''' is a phenolic compound found in crude [canola oil](/source/canola_oil).<ref>{{cite journal | doi = 10.1021/jp2022105 | title = Canolol: A Promising Chemical Agent against Oxidative Stress | date = 2011 | last1 = Galano | first1 = Annia | last2 = Francisco-Márquez | first2 = Misaela | last3 = Alvarez-Idaboy | first3 = Juan R. | journal = The Journal of Physical Chemistry B | volume = 115 | issue = 26 | pages = 8590–8596 | pmid = 21619069 }}</ref><ref>{{cite journal | pmid = 18059022 | date = 2008 | last1 = Cao | first1 = X. | last2 = Tsukamoto | first2 = T. | last3 = Seki | first3 = T. | last4 = Tanaka | first4 = H. | last5 = Morimura | first5 = S. | last6 = Cao | first6 = L. | last7 = Mizoshita | first7 = T. | last8 = Ban | first8 = H. | last9 = Toyoda | first9 = T. | last10 = Maeda | first10 = H. | last11 = Tatematsu | first11 = M. | title = 4-Vinyl-2,6-dimethoxyphenol (Canolol) suppresses oxidative stress and gastric carcinogenesis in Helicobacter pylori-infected carcinogen-treated Mongolian gerbils | journal = International Journal of Cancer | volume = 122 | issue = 7 | pages = 1445–1454 | doi = 10.1002/ijc.23245 }}</ref> It is produced by [decarboxylation](/source/decarboxylation) of [sinapic acid](/source/sinapic_acid) during canola seed roasting.<ref>{{cite journal | doi = 10.1039/C3GC40748A | title = Antioxidant canolol production from a renewable feedstock via an engineered decarboxylase | date = 2013 | last1 = Morley | first1 = Krista L. | last2 = Grosse | first2 = Stephan | last3 = Leisch | first3 = Hannes | last4 = Lau | first4 = Peter C. K. | journal = Green Chemistry | volume = 15 | issue = 12 | page = 3312 }}</ref><ref>{{cite journal | doi = 10.1021/jf301738y | title = Isolation and Identification of a Potent Radical Scavenger (Canolol) from Roasted High Erucic Mustard Seed Oil from Nepal and Its Formation during Roasting | date = 2012 | last1 = Shrestha | first1 = Kshitij | last2 = Stevens | first2 = Christian V. | last3 = De Meulenaer | first3 = Bruno | journal = Journal of Agricultural and Food Chemistry | volume = 60 | issue = 30 | pages = 7506–7512 | pmid = 22746294 | bibcode = 2012JAFC...60.7506S }}</ref>

== See also ==
{{Div col|colwidth=16em}}
*[Phenolic content in wine](/source/Phenolic_content_in_wine)
*[Syringaldehyde](/source/Syringaldehyde)
*[Syringol](/source/Syringol)
*[Syringic acid](/source/Syringic_acid)
*[Acetosyringone](/source/Acetosyringone)
*[Sinapyl alcohol](/source/Sinapyl_alcohol)
*[Sinapaldehyde](/source/Sinapaldehyde)
*[Sinapinic acid](/source/Sinapinic_acid)
*[Sinapine](/source/Sinapine)
{{Div col end}}

== References ==
{{reflist}}

Category:O-methylated natural phenols
Category:Vinyl compounds
Category:Vegetable oils

{{phenol-stub}}

---
Adapted from the Wikipedia article [Canolol](https://en.wikipedia.org/wiki/Canolol) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/Canolol?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.