# CX157

> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/CX157
> Markdown URL: https://mediated.wiki/source/CX157.md
> Source: https://en.wikipedia.org/wiki/CX157
> Source revision: 1329175259
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)

{{short description|Chemical compound}}
{{Drugbox
| verifiedrevid = 396516252
| IUPAC_name = 3-fluoro-7-(2,2,2-trifluoroethoxy)phenoxathiine 10,10-dioxide
| image = CX157 structure.svg
| image_class = skin-invert-image

<!--Clinical data-->
| tradename =  
| pregnancy_category =  
| legal_status = Uncontrolled
| routes_of_administration = Oral

<!--Pharmacokinetic data-->
| bioavailability =  
| metabolism =  
| elimination_half-life =  
| excretion =  

<!--Identifiers-->
| CAS_number = 205187-53-7 
| CAS_number_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = O6L62LZJ0Q
| ATC_prefix = none
| ATC_suffix =  
| PubChem = 18687754
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 13701383

<!--Chemical data-->
| C = 14 | H = 8 | F = 4 | O = 4 | S = 1
| smiles = FC(F)(F)COc2cc3Oc1cc(F)ccc1S(=O)(=O)c3cc2
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C14H8F4O4S/c15-8-1-3-12-10(5-8)22-11-6-9(21-7-14(16,17)18)2-4-13(11)23(12,19)20/h1-6H,7H2
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = PDIMOTRDGUQMNY-UHFFFAOYSA-N
}}

'''CX157''' (proposed trade name '''TriRima''', formerly '''Tyrima''') is a [selective](/source/binding_selectivity) and [reversible inhibitor of MAO-A](/source/reversible_inhibitor_of_monoamine_oxidase_A) (RIMA).<ref>{{cite conference |vauthors=Fielding R, Mielach F, Free J, Pande A |title=Pharmacokinetics and oral bioavailability of CX157, a reversible selective MAO-A inhibitor, in primates |year=2007 |conference=2007 AAPS Annual Meeting & Exposition |url=http://www.aapsj.org/abstracts/AM_2007/AAPS2007-001233.PDF |accessdate=2009-06-14 |archive-url=https://web.archive.org/web/20110526192425/http://www.aapsj.org/abstracts/AM_2007/AAPS2007-001233.PDF |archive-date=2011-05-26 |url-status=dead }}</ref> As of 2007 it was in [phase II](/source/phases_of_clinical_research) [clinical trial](/source/clinical_trial)s for the treatment of [depression](/source/clinical_depression).<ref>{{ClinicalTrialsGov|NCT00739908}|A Study of CX157 (TriRima) for the Treatment of Depression (CX157-200)}}</ref> In 2013, work on the drug was terminated.[http://adisinsight.springer.com/drugs/800025697]

==References==
{{Reflist|2}}

{{Monoamine metabolism modulators}}

Category:Reversible inhibitors of MAO-A
Category:Monoamine oxidase inhibitors
Category:Abandoned drugs
Category:Sulfur heterocycles
Category:Trifluoromethyl compounds
Category:Fluoroarenes
Category:Sulfones
Category:Oxygen heterocycles
Category:Heterocyclic compounds with 3 rings

{{nervous-system-drug-stub}}

---
Adapted from the Wikipedia article [CX157](https://en.wikipedia.org/wiki/CX157) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/CX157?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.