# Butinazocine

> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/Butinazocine
> Markdown URL: https://mediated.wiki/source/Butinazocine.md
> Source: https://en.wikipedia.org/wiki/Butinazocine
> Source revision: 1329170585
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)

{{Short description|Chemical compound}}
{{Drugbox
| IUPAC_name               = 10-(3-butyn-1-yl)-13,13-dimethyl-10-azatricyclo[7.3.1.0<sup>2,7</sup>]trideca-2,4,6-triene-1,4-diol
| image                    = Butinazocine structure.svg
| image_class = skin-invert-image
| CAS_number               = 93821-75-1
| CAS_supplemental         = <br />79810-24-5 ([hydrochloride](/source/hydrochloride))
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = W11ET455ZI
| ATC_prefix               = None
| ATC_suffix               = 
| PubChem                  = 189903
| ChEMBL = 2106183
| ChemSpiderID             = 164930
| C = 18 | H = 23 | N = 1 | O = 2
| smiles                   = OC1=CC=C2C([C@]3(C(C)(C)[C@@H](C2)N(CC3)CCC#C)O)=C1
| StdInChI                 = 1S/C18H23NO2/c1-4-5-9-19-10-8-18(21)15-12-14(20)7-6-13(15)11-16(19)17(18,2)3/h1,6-7,12,16,20-21H,5,8-11H2,2-3H3
| StdInChIKey              = YEFFVIUQXXNVGG-UHFFFAOYSA-N
| bioavailability          = 
| protein_bound            = 
| metabolism               = 
| elimination_half-life    = 
| excretion                = 
| pregnancy_category       = 
| legal_status             = 
| routes_of_administration = 
}}

'''Butinazocine''' ([INN](/source/International_Nonproprietary_Name)) is an [opioid](/source/opioid) [analgesic](/source/analgesic) of the [benzomorphan](/source/benzomorphan) family which was never marketed.<ref name="Macdonald1997">{{cite book | vauthors = Macdonald F | title = Dictionary of Pharmacological Agents | url = https://books.google.com/books?id=DeX7jgInYFMC&pg=PA340 | accessdate = 22 April 2012 | year = 1997 | publisher = CRC Press | isbn = 978-0-412-46630-4 | pages = 340–341}}</ref>

== See also ==
* [Benzomorphan](/source/Benzomorphan)

== References ==
{{Reflist}}

{{Analgesics}}
{{Opioidergics}}

Category:Benzomorphans
Category:Opioids

---
Adapted from the Wikipedia article [Butinazocine](https://en.wikipedia.org/wiki/Butinazocine) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/Butinazocine?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.