# Buphenine

> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/Buphenine
> Markdown URL: https://mediated.wiki/source/Buphenine.md
> Source: https://en.wikipedia.org/wiki/Buphenine
> Source revision: 1328688816
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)

{{Short description|Medication}}
{{Drugbox
| image = Buphenine.svg
| image_class = skin-invert-image
| width = 

<!-- Clinical data -->
| tradename = Arlidin
| Drugs.com = {{drugs.com|international|buphenine}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =  
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =  
| routes_of_administration =  

<!-- Pharmacokinetic data -->
| bioavailability =  
| protein_bound =  
| metabolism =  
| elimination_half-life =  
| excretion =  

<!-- Identifiers -->
| CAS_number = 447-41-6
| ATC_prefix = C04
| ATC_suffix = AA02
| ATC_supplemental = {{ATC|G02|CA02}}
| PubChem = 4567
| DrugBank =  
| ChemSpiderID = 4407
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 695DKH33EI
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 114655
| synonyms = Nylidrin

<!-- Chemical data -->
| IUPAC_name = 4-<nowiki>{1-hydroxy-2-[(1-methyl-3-phenylpropyl)amino]propyl}phenol</nowiki>
| C=19 | H=25 | N=1 | O=2 
| SMILES = OC(c1ccc(O)cc1)C(NC(C)CCc2ccccc2)C
}}

'''Buphenine''', also known as '''nylidrin''' and sold under the brand name '''Arlidin''', is a [β<sub>2</sub> adrenoreceptor agonist](/source/Beta2-adrenergic_agonist)<ref name="pmid2857689">{{cite journal |vauthors=Mittag TW, Tormay A, Messenger M, Podos SM |title=Ocular hypotension in the rabbit. Receptor mechanisms of pirbuterol and nylidrin |journal=Invest Ophthalmol Vis Sci |volume=26 |issue=2 |pages=163–9 |date=February 1985 |pmid=2857689 |url=http://www.iovs.org/cgi/pmidlookup?view=long&pmid=2857689 |url-status=dead |archiveurl=https://archive.today/20130415011509/http://www.iovs.org/cgi/pmidlookup?view=long&pmid=2857689 |archivedate=2013-04-15 }}</ref> that acts as a [vasodilator](/source/vasodilator).<ref>{{cite journal| vauthors=Freedman L| title=Arlidin: a new vasodilative sympathomimetic drug | journal=Angiology | year= 1955 | volume= 6 | issue= 1 | pages= 52–8 | pmid=14350296 | doi=10.1177/000331975500600106| s2cid=46317963 }}</ref>

It was developed as a chemical derivative of [oxilofrine](/source/oxilofrine), and first reported in the literature in 1950.<ref>{{cite journal| vauthors=Külz F, Schneider M| title=Über neue gefäßerweiternde Sympathomimetika |language=German |trans-title=On new vasodilative sympathomimetics | journal=Klin Wochenschr | year= 1950 | volume= 28 | issue=31–32 | pages= 535–7| doi=10.1007/BF01481535 | pmid=14775050 }}</ref>

==See also==
* [Isoxsuprine](/source/Isoxsuprine)

==References==
{{Reflist}}

{{Other gynecologicals}}
{{Peripheral vasodilators}}
{{Adrenergic receptor modulators}}
{{Ionotropic glutamate receptor modulators}}

Category:Beta-Hydroxyamphetamines
Category:Beta2-adrenergic agonists
Category:NMDA receptor antagonists
Category:4-Hydroxyphenyl compounds
Category:Tocolytics

{{cardiovascular-drug-stub}}
{{genito-urinary-drug-stub}}
Category:Cerebral vasodilators

---
Adapted from the Wikipedia article [Buphenine](https://en.wikipedia.org/wiki/Buphenine) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/Buphenine?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.