# Bexirestrant

> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/Bexirestrant
> Markdown URL: https://mediated.wiki/source/Bexirestrant.md
> Source: https://en.wikipedia.org/wiki/Bexirestrant
> Source revision: 1330132479
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)

{{Short description|Chemical compound}}
{{cs1 config|name-list-style=vanc|display-authors=6}}
{{Infobox drug
| drug_name         = 
| INN               = 
| type              = <!-- empty -->
| image             = Bexirestrant.svg
| image_class       = skin-invert-image
| width             = 
| alt               = 
| caption           = 
| image2            = 
| width2            = 
| alt2              = 
| caption2          = 
| imageL            = 
| widthL            = 
| altL              = 
| imageR            = 
| widthR            = 
| altR              = 
| captionLR         = 

<!-- Clinical data -->
| pronounce         = 
| tradename         = 
| Drugs.com         = 
| MedlinePlus       = 
| licence_CA        = <!-- Health Canada may use generic or brand name (generic name preferred) -->
| licence_EU        = <!-- EMA uses INN (or special INN_EMA) -->
| DailyMedID        = <!-- DailyMed may use generic or brand name (generic name preferred) -->
| licence_US        = <!-- FDA may use generic or brand name (generic name preferred) -->
| pregnancy_AU      = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_AU_comment = 
| pregnancy_category= 
| dependency_liability = 
| addiction_liability = 
| routes_of_administration = 
| class             = 
| ATCvet            = 
| ATC_prefix        = <!-- 'none' if uncategorised -->
| ATC_suffix        = 
| ATC_supplemental  = 

<!-- Legal status -->
| legal_AU          = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled -->
| legal_AU_comment  = 
| legal_BR          = <!-- OTC, A1, A2, A3, B1, B2, C1, C2, C3, C5, D1, D2, E, F1, F2, F3, F4 -->
| legal_BR_comment  = 
| legal_CA          = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_CA_comment  = 
| legal_DE          = <!-- Anlage I, II, III or Unscheduled -->
| legal_DE_comment  = 
| legal_NZ          = <!-- Class A, B, C -->
| legal_NZ_comment  = 
| legal_UK          = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM / Class A, B, C -->
| legal_UK_comment  = 
| legal_US          = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_US_comment  = 
| legal_EU          = 
| legal_EU_comment  = 
| legal_UN          = <!-- N I, II, III, IV / P I, II, III, IV -->
| legal_UN_comment  = 
| legal_status      = <!-- For countries not listed above -->

<!-- Pharmacokinetic data -->
| bioavailability   = 
| protein_bound     = 
| metabolism        = 
| metabolites       = 
| onset             = 
| elimination_half-life = 
| duration_of_action= 
| excretion         = 

<!-- Identifiers -->
| CAS_number        = 2505067-70-7
| CAS_supplemental  = 
| PubChem           = 155770216
| PubChemSubstance  = 
| IUPHAR_ligand     = 
| DrugBank          = 
| ChemSpiderID      = 115010413
| UNII              = BB35H436NB
| KEGG              = 
| ChEBI             = 
| ChEMBL            = 5095057
| NIAID_ChemDB      = 
| PDB_ligand        = 
| synonyms          = SCO-120

<!-- Chemical and physical data -->
| IUPAC_name        = <nowiki>(2S)-3-(3,5-difluorophenyl)-2-[4-[(E)-3-[3-(fluoromethyl)azetidin-1-yl]prop-1-enyl]phenyl]-4-methyl-2H-chromen-7-ol</nowiki>
| C= 29
| H= 26
| F= 3
| N= 1
| O= 2
| molecular_weight  = 
| SMILES            = CC1=C([C@@H](OC2=C1C=CC(=C2)O)C3=CC=C(C=C3)/C=C/CN4CC(C4)CF)C5=CC(=CC(=C5)F)F
| Jmol              = 
| StdInChI          = InChI=1S/C29H26F3NO2/c1-18-26-9-8-25(34)14-27(26)35-29(28(18)22-11-23(31)13-24(32)12-22)21-6-4-19(5-7-21)3-2-10-33-16-20(15-30)17-33/h2-9,11-14,20,29,34H,10,15-17H2,1H3/b3-2+/t29-/m0/s1
| StdInChI_comment  = 
| StdInChIKey       = DVZLOPUYTKPWHJ-MPWQXXDYSA-N
| density           = 
| density_notes     = 
| melting_point     = 
| melting_high      = 
| melting_notes     = 
| boiling_point     = 
| boiling_notes     = 
| solubility        = 
| sol_units         = 
| specific_rotation = 
}}

'''Bexirestrant''' is a [selective estrogen receptor degrader](/source/selective_estrogen_receptor_degrader) (SERD) which is being evaluated for the treatment of [breast cancer](/source/breast_cancer). This orally bioavailable compound has demonstrated potent activity against both wild-type and mutant forms of the estrogen receptor (ER), addressing a critical need in overcoming resistance to current endocrine therapies.<ref name="Min_2024">{{cite journal | vauthors = Min J, Liu X, Peng R, Chen CC, Wang W, Guo RT | title = New generation estrogen receptor-targeted agents in breast cancer: present situation and future prospectives | journal = Acta Materia Medica | volume = 3 | issue = 1 | pages = 57–71 | date = February 2024 | pmid = 39373009 | pmc = 11450757 | doi = 10.15212/amm-2024-0006 }}</ref>

It is structurally characterized by an E-[alkene](/source/alkene) linked to an [azetidine](/source/azetidine) core.

== References ==
{{reflist}}

{{antineoplastic-drug-stub}}

Category:Antineoplastic drugs
Category:Selective estrogen receptor degraders
Category:Azetidines
Category:Benzopyrans
Category:Organofluorides
Category:Fluorobenzene derivatives
Category:Phenols
Category:Vinylbenzenes

---
Adapted from the Wikipedia article [Bexirestrant](https://en.wikipedia.org/wiki/Bexirestrant) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/Bexirestrant?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.