# Atromentin

> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/Atromentin
> Markdown URL: https://mediated.wiki/source/Atromentin.md
> Source: https://en.wikipedia.org/wiki/Atromentin
> Source revision: 1354492699
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)

{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 
| Reference = 
| ImageFile = Atromentin_V2.svg
| ImageAlt = 2,5-Dihydroxy-3,6-bis(4-hydroxyphenyl)-1,4-benzoquinone
| ImageCaption = Structural formula of atromentin
| PIN = 1<sup>4</sup>,2<sup>3</sup>,2<sup>6</sup>,3<sup>4</sup>-Tetrahydroxy[1<sup>1</sup>,2<sup>1</sup>:2<sup>4</sup>,3<sup>1</sup>-terphenyl]-2<sup>2</sup>,2<sup>5</sup>-dione
| OtherNames = 2,5-Dihydroxy-3,6-bis(4-hydroxyphenyl)-1,4-benzoquinone
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 519-67-5
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 59557692U6
| RTECS = 
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C18H12O6/c19-11-5-1-9(2-6-11)13-15(21)17(23)14(18(24)16(13)22)10-3-7-12(20)8-4-10/h1-8,19-21,24H
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = FKQQKMGWCJGUCS-UHFFFAOYSA-N
| PubChem = 99148
| ChEBI = 149660 
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 89570
| EINECS = 
| InChI = 1S/C18H12O6/c19-11-5-1-9(2-6-11)13-15(21)17(23)14(18(24)16(13)22)10-3-7-12(20)8-4-10/h1-8,19-21,24H
| InChIKey = FKQQKMGWCJGUCS-UHFFFAOYSA-N 
| SMILES = C1=CC(=CC=C1C2=C(C(=O)C(=C(C2=O)O)C3=CC=C(C=C3)O)O)O
  }}
|Section2={{Chembox Properties
| C=18 | H=12 | O=6
| Appearance = 
| Density =
| MeltingPt =
| BoilingPt =
| Solubility = 
  }}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
  }}
}}

'''Atromentin''' is a natural chemical compound found in [Agaricomycetes](/source/Agaricomycetes) fungi in the orders [Agaricales](/source/Agaricales) and [Thelephorales](/source/Thelephorales). It can also be prepared by [laboratory synthesis](/source/organic_synthesis).<ref>{{Cite journal 
| last1 = Ye | first1 = Y. Q. 
| last2 = Koshino | first2 = H. 
| last3 = Abe | first3 = N. 
| last4 = Nakamura | first4 = T. 
| last5 = Hashizume | first5 = D. 
| last6 = Takahashi | first6 = S. 
| title = Synthesis of atromentin and its O-alkylated natural products 
| journal = Bioscience, Biotechnology, and Biochemistry 
| volume = 74 
| issue = 11 
| pages = 2342–2344 
| year = 2010 
| pmid = 21071857 | doi=10.1271/bbb.100451
| doi-access = free 
}}</ref> Chemically, it is a [polyphenol](/source/polyphenol) and a [benzoquinone](/source/benzoquinone).<ref>{{Cite journal |last1=Chandra |first1=Sonia |last2=De Mejia Gonzalez |first2=Elvira |date=2004-06-02 |title=Polyphenolic compounds, antioxidant capacity, and quinone reductase activity of an aqueous extract of Ardisia compressa in comparison to mate (Ilex paraguariensis) and green (Camellia sinensis) teas |journal=Journal of Agricultural and Food Chemistry |volume=52 |issue=11 |pages=3583–3589 |doi=10.1021/jf0352632 |issn=0021-8561 |pmid=15161234 |bibcode=2004JAFC...52.3583C }}</ref>

== Occurrences ==
Atromentin has been found in cultures of ''[Clitocybe subilludens](/source/Clitocybe_subilludens)''<ref>{{Cite journal | last1 = Sullivan | first1 = G. | last2 = Garrett | first2 = R. D. | last3 = Lenehan | first3 = R. F. | doi = 10.1002/jps.2600601134 | title = Occurrence of atromentin and thelephoric acid in cultures ofclitocybe subilludens | journal = Journal of Pharmaceutical Sciences | volume = 60 | issue = 11 | pages = 1727–1729 | year = 1971 | pmid = 4332377 | bibcode = 1971JPhmS..60.1727S }}</ref> and in extracts of ''[Hydnellum peckii](/source/Hydnellum_peckii)''.  The first enzymes in its biosynthesis have been characterized in ''[Tapinella panuoides](/source/Tapinella_panuoides)''.<ref name=Schneider>{{Cite journal | last1 = Schneider | first1 = P. | last2 = Bouhired | first2 = S. | last3 = Hoffmeister | first3 = D. | doi = 10.1016/j.fgb.2008.08.009 | title = Characterization of the atromentin biosynthesis genes and enzymes in the homobasidiomycete ''Tapinella panuoides''| journal = Fungal Genetics and Biology | volume = 45 | issue = 11 | pages = 1487–1496 | year = 2008 | pmid = 18805498}}</ref> One of those is called [atromentin synthetase](/source/atromentin_synthetase).<ref>[https://www.uniprot.org/uniprot/B7STY1 Atromentin synthetase on www.uniprot.org]</ref>

== Biological activities ==
A number of potential biological activities of atromentin have been studied ''[in vitro](/source/in_vitro)''.  Atromentin possesses ''in vitro'' antibacterial activity, inhibiting the enzyme [enoyl-acyl carrier protein reductase](/source/enoyl-acyl_carrier_protein_reductase) (essential for the [biosynthesis](/source/Fatty_acid_metabolism) of [fatty acid](/source/fatty_acid)s) in the bacteria ''[Streptococcus pneumoniae](/source/Streptococcus_pneumoniae)''.<ref name=Zheng2006>{{cite journal |vauthors=Zheng CJ, Sohn MJ, Kim WG |year=2006 |title=Atromentin and leucomelone, the first inhibitors specific to enoyl-ACP reductase (FabK) of ''Streptococcus pneumoniae'' |journal=Journal of Antibiotics |volume=59 |issue=12 |pages=808–12 |doi=10.1038/ja.2006.108 |pmid=17323650|doi-access=free }}</ref>  Atromentin has been shown to be a [smooth muscle](/source/smooth_muscle) [stimulant](/source/stimulant).<ref>{{Cite journal 
| last1 = Sullivan | first1 = G. 
| last2 = Guess | first2 = W. L. 
| title = Atromentin: A smooth muscle stimulant in Clitocybe subilludens 
| journal = Lloydia 
| volume = 32 
| issue = 1 
| pages = 72–75 
| year = 1969 
| pmid = 5815216
}}</ref>  It also induces [apoptosis](/source/apoptosis) in isolated human [leukemia](/source/leukemia) [U937 cells](/source/U937_cells).<ref>Atromentin-Induced Apoptosis in Human Leukemia U937 Cells. Kim Jin Hee and Choong Hwan Lee, Journal of microbiology and biotechnology, 2009, vol. 19, no9, pages 946-950, {{INIST|21945937}}</ref>  It is also an [anticoagulant](/source/anticoagulant).<ref name=Khanna1965>{{cite journal |vauthors=Khanna JM, Malone MH, Euler KL, Brady LR |year=1965 |title= Atromentin – anticoagulant from '' Hydnellum diabolus'' |journal=Journal of Pharmaceutical Sciences |volume=54 |issue=7 |pages=1016–20 |pmid=5862512 |doi=10.1002/jps.2600540714 |bibcode=1965JPhmS..54.1016K }}</ref>

==Genetic and enzymatic basis of atromentin==
Atromentin is biosynthesized from two units of [4-hydroxyphenylpyruvic acid](/source/4-hydroxyphenylpyruvic_acid) (4-HPP) via a [nonribosomal peptide](/source/nonribosomal_peptide) synthetase-like enzyme (atromentin synthetase), containing the domain architecture adenylation-thiolation-thioesterase (A-T-TE). 4-HPP is produced from a deamination via an aminotransferase. The genetic basis of these two genes is clustered (i.e., adjacent to one another). These enzymes were first characterized in ''Tapinella panuoides'' by overexpressing the respective genes (AtrA and AtrD) in ''E. coli'' and incubating the holo-enzyme with 4-HPP to observe the formation of atromentin.<ref name=Schneider/> This was followed by characterization of the enzyme GreA in ''Suillus grevillei'',<ref name=Wackler>{{cite journal | doi = 10.1002/cbic.201200187| pmid = 22730234| title = Characterization of the Suillus grevillei Quinone Synthetase GreA Supports a Nonribosomal Code for Aromatic α-Keto Acids| journal = ChemBioChem| volume = 13| issue = 12| pages = 1798–804| year = 2012| last1 = Wackler| first1 = Barbara| last2 = Lackner| first2 = Gerald| last3 = Chooi| first3 = Yit Heng| last4 = Hoffmeister| first4 = Dirk| s2cid = 10457901}}</ref> six (InvA1-6, of which InvA1, 2 and 5 were functional) in ''Paxillus involutus'',<ref name=Braesel>{{Cite journal | doi = 10.1016/j.chembiol.2015.08.016| pmid = 26496685| title = Three Redundant Synthetases Secure Redox-Active Pigment Production in the Basidiomycete Paxillus involutus| journal = Chemistry & Biology| volume = 22| issue = 10| pages = 1325–1334| year = 2015| last1 = Braesel| first1 = Jana| last2 = Götze| first2 = Sebastian| last3 = Shah| first3 = Firoz| last4 = Heine| first4 = Daniel| last5 = Tauber| first5 = James| last6 = Hertweck| first6 = Christian| last7 = Tunlid| first7 = Anders| last8 = Stallforth| first8 = Pierre| last9 = Hoffmeister| first9 = Dirk| doi-access = }}</ref> and NPS3 from ''Serpula lacrymans''.<ref name=Tauber2016>{{cite journal | doi = 10.1111/1462-2920.13558| pmid = 27699944| title = Bacteria induce pigment formation in the basidiomycete Serpula lacrymans| journal = Environmental Microbiology| volume = 18| issue = 12| pages = 5218–5227| year = 2016| last1 = Tauber| first1 = James P| last2 = Schroeckh| first2 = Volker| last3 = Shelest| first3 = Ekaterina| last4 = Brakhage| first4 = Axel A| last5 = Hoffmeister| first5 = Dirk| bibcode = 2016EnvMi..18.5218T}}</ref><ref>{{Cite journal | doi = 10.1126/science.1205411| pmid = 21764756| title = The Plant Cell Wall-Decomposing Machinery Underlies the Functional Diversity of Forest Fungi| journal = Science| volume = 333| issue = 6043| pages = 762–5| year = 2011| last1 = Eastwood| first1 = D. C| last2 = Floudas| first2 = D| last3 = Binder| first3 = M| last4 = Majcherczyk| first4 = A| last5 = Schneider| first5 = P| last6 = Aerts| first6 = A| last7 = Asiegbu| first7 = F. O| last8 = Baker| first8 = S. E| last9 = Barry| first9 = K| last10 = Bendiksby| first10 = M| last11 = Blumentritt| first11 = M| last12 = Coutinho| first12 = P. M| last13 = Cullen| first13 = D| last14 = De Vries| first14 = R. P| last15 = Gathman| first15 = A| last16 = Goodell| first16 = B| last17 = Henrissat| first17 = B| last18 = Ihrmark| first18 = K| last19 = Kauserud| first19 = H| last20 = Kohler| first20 = A| last21 = Labutti| first21 = K| last22 = Lapidus| first22 = A| last23 = Lavin| first23 = J. L| last24 = Lee| first24 = Y.-H| last25 = Lindquist| first25 = E| last26 = Lilly| first26 = W| last27 = Lucas| first27 = S| last28 = Morin| first28 = E| last29 = Murat| first29 = C| last30 = Oguiza| first30 = J. A| display-authors = 29| bibcode = 2011Sci...333..762E| s2cid = 11022844| url = https://escholarship.org/uc/item/7dq3n3h2}}</ref> In addition, there is another adjacent and conserved gene encoding for an [alcohol dehydrogenase](/source/alcohol_dehydrogenase)/oxidoreductase whose function is unclear. In most cases the clustered biosynthetic genes are found orthologous in basidiomycetes. A common promoter motif was found shared between the atromentin synthetase and aminotransferase of 23 different atromentin-producing basidiomycetes that was in almost all cases absent from the alcohol dehydrogenase, indicating co-regulation of the two essential genes that ensure atromentin production by a common [transcription factor](/source/transcription_factor).<ref name="Tauber2016"/><ref name="Tauber2017"/> Additional promoter motifs were identified preceding the atromentin genes for ectomycorrihzae that were absent from brown rotters, indicating dissimilar genetic regulation of atromentin.<ref name="Tauber2017"/> The genes for the atromentin synthetase and aminotransferase from ''S. lacrymans'' were up-regulated during co-incubation with bacteria.<ref name="Tauber2017">{{cite journal | title=Dissimilar pigment regulation in Serpula lacrymans and Paxillus involutus during inter-kingdom interactions | journal=Microbiology| volume=164| issue=1| pages=65–77| doi=10.1099/mic.0.000582| pmid=29205129| url=http://orbit.dtu.dk/ws/files/140313728/61_Tauber_2018_Microbiology.pdf| year=2018| last1=Tauber| first1=James P.| last2=Gallegos-Monterrosa| first2=Ramses| last3=Kovács| first3=Ákos T.| last4=Shelest| first4=Ekaterina| last5=Hoffmeister| first5=Dirk| doi-access=free}}</ref>

==Amino acid nonribosomal code for biosynthesis==
The nonribosomal peptide synthetase-like enzyme (atromentin synthetase) that symmetrically condenses two monomers of 4-HPP has an adenylation domain that accepts the substrates before catalysis. The acceptor domain contains a 10 amino acid code known as the [nonribosomal code](/source/nonribosomal_code) (NRPS code). Here, the example of the atromentin synthetase from ''Suills grevillei'', GreA, is used. The code is found at amino acid positions 235 (V), 236 (A), 239 (E), 278 (F), 299 (S), 301 (G), 322 (G), 320 (A), 331 (C), 517 (K).<ref name=Wackler/> The code aligns with atromentin synthetases from ''S. lacrymans'' (NPS3), ''Tapinella panuoides'' (AtrA), and ''Paxillus involutus'' (InvAs). Similarly, the NRPS code for atromentin production supports the universal code for other aromatic alpha-keto acid-derived compounds, such those from <small>L</small>-phenylalanine like ralfuranone B via phenylpyruvic acid, and from <small>L</small>-tryptophane like didemethyl asterriquinone D via [indole-3-pyruvic acid](/source/indole-3-pyruvic_acid) (note atromentin is derived from the aromatic alpha-keto acid L-tyrosine via 4-hydroxyphenylpyruvic acid).{{cn|date=January 2022}}

For InvAs from ''Paxillus involutus'', a common amino acid motif was also found in the thioesterase domain (last domain) that supported biochemical data of either the enzyme being functional to complete atromentin formation or not.<ref name=Braesel/>

==Biosynthesis of atromentin==
The aromatic amino acid <small>L</small>-tyrosine is the precursor to 4-hydroxyphenylpyruvic acid, and 2 units of 4-HPP are condensed to form atromentin. The initial step is deamination via an aminotransferase. The second step is catalyzed by a nonribosomal peptide synthetase-like enzyme (NRPS-like, because it does not have a canonical condensation domain, called the atromentin/quinone synthetase). The adenylation domain of this NRPS-like enzyme accepts 4-HPP as determined by the ATP-PPi-exchange assay. The enzyme, when produced in ''E. coli'', needs to be primed to its holo form via a phosphopantetheinyl transferase (Ppant), although E. coli can in vivo prime the apo-enzyme (e.g. via EntD). Ppants have been successfully used from cDNA derived from ''A. nidulans'' (e.g. NpgA), ''Streptomyces verticillus'' (Svp), and ''Paxillus involutus'' (PptA). A few studies, notably from the bacterium ''Burkholderia thailandensis'' by Biggins et al., have shown that the aminotransferase gene may be absent, and this activity can be supplied via its primary metabolism.{{cn|date=January 2022}}

==Congener pigments==
Atromentin is the precursor to various other pigments, including the pulvinic acids such as [variegatic acid](/source/variegatic_acid), [xerocomic acid](/source/xerocomic_acid), [homoxerocomic acid](/source/homoxerocomic_acid), [isoxerocomic acid](/source/isoxerocomic_acid), [atromentic acid](/source/atromentic_acid), [variegatorubin](/source/variegatorubin), [xerocomorubin](/source/xerocomorubin), and other modified derivatives. The main pulvinic acid type pigments were found secreted during co-incubation with bacteria or introduction to high organic nitrogen content (compared to growth on a non-inducing medium containing inorganic nitrogen). Diarylcyclopentenones include involutin, involuton, [gyrocyanin](/source/gyrocyanin), gyroporin (oxidized variant of gyrocyanin), anhydroinvolutin, and chamonixin. Although structurally similar, [grevillins](/source/grevillins) (A-D) are derived from 4-HPP, the precursor to atromentin. The grevillins are a chemotaxonomic marker for the genus ''Suillus.'' Modifications of atromentin include leucoatromentin, leucomentin-3, leucomentin-4, and cylcoleucomelone. Additionally, thelephoric acid is a derivative that is from the thelephoroid clade. The various enzymes involved in the formation of these pigments aside from the genetic and enzymatic basis for the production of its precursor atromentin is unknown.

==Redundant biosynthesis==
In ''Paxillus involutus'', six nonribosomal peptide synthetase-like enzymes were identified in the annotated genome that is available via the JGI MycoCosm portal. These genes, termed InvA1,2,3,4,5 and 6, were overexpressed in ''E. coli'' and the genes were characterized by co-incubating the apo-enzyme with 4-HPP to determine the formation of atromentin as noted by its characteristic UV-Vis spectrum and monoisotopic mass. Three of the six enzymes were found to be functional. This showed an unprecedented redundancy for atromentin production in a basidiomycete.<ref name=Braesel/>

== References ==
{{reflist|30em}}

Category:Anticoagulants
Category:Antimicrobials
Category:Oxidoreductase inhibitors
Category:Hydroxybenzoquinones
Category:Polyphenols
Category:4-Hydroxyphenyl compounds

---
Adapted from the Wikipedia article [Atromentin](https://en.wikipedia.org/wiki/Atromentin) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/Atromentin?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.
