# Anazocine

> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/Anazocine
> Markdown URL: https://mediated.wiki/source/Anazocine.md
> Source: https://en.wikipedia.org/wiki/Anazocine
> Source revision: 1329170544
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)

{{Short description|Chemical compound}}
{{Drugbox
| IUPAC_name               = 9-Methoxy-3-methyl-9-phenyl-3-azabicyclo[3.3.1]nonane
| image                    = Anazocine structure.svg
| image_class = skin-invert-image
| CAS_number               = 15378-99-1
| CAS_supplemental         = <br />21650-02-2 ([citrate](/source/citrate))
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = K2S5VMM2SG
| ATC_prefix               = None
| ATC_suffix               = 
| PubChem                  = 27213
| ChemSpiderID             = 25327
| ChEMBL = 2105792
| C = 16 | H = 23 | N = 1 | O = 1
| smiles                   = O(C2(c1ccccc1)C3CCCC2CN(C3)C)C
| StdInChI                 = 1S/C16H23NO/c1-17-11-14-9-6-10-15(12-17)16(14,18-2)13-7-4-3-5-8-13/h3-5,7-8,14-15H,6,9-12H2,1-2H3
| StdInChIKey              = YFFNPIAPUDUYAU-UHFFFAOYSA-N
| bioavailability          = 
| protein_bound            = 
| metabolism               = 
| elimination_half-life    = 
| excretion                = 
| pregnancy_category       = 
| legal_status             = 
| routes_of_administration = 
}}

'''Anazocine''' ([INN](/source/International_Nonproprietary_Name); also known as '''azabicyclane''' or '''CS-307''') is an [opioid](/source/opioid) [analgesic](/source/analgesic) of the [morphan](/source/morphan)/benzomorphan family developed in the middle 1960s in the United States which was never marketed.<ref name="Macdonald1997">{{cite book | vauthors = Macdonald F | veditors = Ganellin CR, Triggle DJ | title = Dictionary of Pharmacological Agents | url = https://books.google.com/books?id=DeX7jgInYFMC&pg=PA146 | access-date = 22 April 2012 | year = 1997 | publisher = CRC Press | isbn = 978-0-412-46630-4 | page = 146}}</ref><ref name="pmid5528556">{{cite journal | vauthors = Kobayashi S, Hasegawa K, Oshima T, Takagi H | title = The pharmacology of azabicyclane, a new analgesic agent | journal = Toxicology and Applied Pharmacology | volume = 17 | issue = 2 | pages = 344–354 | date = September 1970 | pmid = 5528556 | doi = 10.1016/0041-008X(70)90191-2 }}</ref>  It is listed by some sources as a [teratogen](/source/teratology).<ref>{{Cite web |url=https://www.purdue.edu/ehps/rem/ih/terat.htm | title = Teratogens | work = Radiological and Environmental Management | publisher = Purdue University |access-date=2016-03-01 |archive-url=https://web.archive.org/web/20160215025937/https://www.purdue.edu/ehps/rem/ih/terat.htm |archive-date=2016-02-15 |url-status=dead }}</ref>

The structure and properties of several related α- and β-azabicyclane opioids was explored.<ref>{{cite journal | doi=10.1002/jcc.540050403 | volume=5 | issue=4 | title=Conformational properties of α- and β-azabicyclane opiates. The effect of conformation on pharmacological activity | journal=Journal of Computational Chemistry | pages=291–298| year=1984 | vauthors = Froimowitz M, Salva P, Hite GJ, Gianutsos G, Suzdak P, Heyman R | s2cid=97334125 }}</ref> Anazocine's chemical and structural relatives include opioid partial agonists, mixed agonist-antagonists, pure agonists, antagonists, and atypical non-opioid analgesics.  It was tested in pigeons and in other experiments which contrasted and compared its analgesic effects to those of the phenazepine opioid [ethoheptazine](/source/ethoheptazine) and the phenalkoxam open chain opioid [propoxyphene](/source/propoxyphene),<ref>{{cite journal | vauthors = Kobayashi S, Hasegawa K, Oshima T, Takagi H | title = The pharmacology of azabicyclane, a new analgesic agent | journal = Toxicology and Applied Pharmacology | volume = 17 | issue = 2 | pages = 344–354 | date = September 1970 | pmid = 5528556 | doi = 10.1016/0041-008X(70)90191-2 }}</ref> and [pethidine](/source/pethidine) as well.<ref>{{cite journal | vauthors = Leander JD | title = Effects of propoxyphene, ethoheptazine, and azabicyclane on schedule-controlled responding: attenuation by pentobarbital but not naloxone | journal = Psychopharmacology | volume = 66 | issue = 1 | pages = 19–22 | year = 1979 | pmid = 44372 | doi = 10.1007/BF00431983 | s2cid = 29627833 }}</ref>

== See also ==
* [Benzomorphan](/source/Benzomorphan)
* [P-7521](/source/P-7521)

== References ==
{{Reflist|2}}

{{Analgesics}}
{{Opioidergics}}

Category:Opioids

---
Adapted from the Wikipedia article [Anazocine](https://en.wikipedia.org/wiki/Anazocine) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/Anazocine?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.