# Aloracetam

> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/Aloracetam
> Markdown URL: https://mediated.wiki/source/Aloracetam.md
> Source: https://en.wikipedia.org/wiki/Aloracetam
> Source revision: 1329595391
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)

{{Short description|Chemical compound}}
{{Drugbox
| verifiedrevid = 451558531
| IUPAC_name = ''N''-[2-(3-Formyl-2,5-dimethylpyrrol-1-yl)ethyl]acetamide
| image = Aloracetam.svg
| image_class = skin-invert-image
| width = 220

<!--Clinical data-->
| tradename =  
| pregnancy_category =  
| legal_US = unscheduled
| legal_US_comment = Not FDA approved
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability =  
| metabolism =  
| excretion =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 119610-26-3
| ATC_prefix = none
| PubChem = 178134
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 155069
| ChEMBL = 2104637
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = U0RKZ75D0T

<!--Chemical data-->
| C=11 | H=16 | N=2 | O=2 
| smiles = CC1=CC(=C(N1CCNC(=O)C)C)C=O
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C11H16N2O2/c1-8-6-11(7-14)9(2)13(8)5-4-12-10(3)15/h6-7H,4-5H2,1-3H3,(H,12,15)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = ZUQSGZULKDDMEW-UHFFFAOYSA-N
}}

'''Aloracetam''' ([INN](/source/International_Nonproprietary_Name)) is a [drug](/source/drug) described as a [nootropic](/source/nootropic) which is closely related to, but technically not of (as it lacks a [pyrrolidone](/source/2-Pyrrolidone) ring), the [racetam](/source/racetam) family of compounds.<ref name="WHO2011">{{cite web | title = The Use of Stems in the Selection of International Nonproprietary Names (INN) for Pharmaceutical Substances | year = 2011 | publisher = World Health Organization | url =https://www.who.int/medicines/services/inn/StemBook_2011_Final.pdf | accessdate = 22 May 2015}}</ref><ref name="George1998">{{cite book| vauthors = George CF |title=Drug Therapy in Old Age|url=https://books.google.com/books?id=pTVsAAAAMAAJ|date=7 July 1998|publisher=Wiley|isbn=978-0-471-94149-1}}</ref><ref name="GanellinTriggle1996">{{cite book| vauthors = Ganellin CR, Triggle DJ |title=Dictionary of Pharmacological Agents|url=https://books.google.com/books?id=Z_mfTTIApVEC&pg=PA615|date=21 November 1996|publisher=CRC Press|isbn=978-0-412-46630-4|pages=615–}}</ref> It was studied by [Aventis](/source/Sanofi-Aventis) for the treatment of [Alzheimer's disease](/source/Alzheimer's_disease),<ref name="pmid16908974">{{cite journal | vauthors = Fischer F, Matthisson M, Herrling P | title = List of drugs in development for neurodegenerative diseases | journal = Neuro-Degenerative Diseases | volume = 1 | issue = 1 | pages = 50–70 | date = 2004 | pmid = 16908974 | doi = 10.1159/000077879 | doi-access = free }}</ref> but was never marketed.

==See also==
* [Piracetam](/source/Piracetam)

==References==
{{Reflist}}

{{Racetams}}

Category:Racetams
Category:Pyrroles
Category:Acetamides
Category:Nootropics
Category:Abandoned drugs

{{nervous-system-drug-stub}}

---
Adapted from the Wikipedia article [Aloracetam](https://en.wikipedia.org/wiki/Aloracetam) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/Aloracetam?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.