# Acifran

> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/Acifran
> Markdown URL: https://mediated.wiki/source/Acifran.md
> Source: https://en.wikipedia.org/wiki/Acifran
> Source revision: 1294436103
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)

{{Chembox
| Name =
| ImageFile = acifran.svg
| ImageSize = 150px
| IUPACName = 5-Methyl-4-oxo-5-phenyl-4,5-dihydro-2-furancarboxylic acid
| SystematicName = 5-Methyl-4-oxo-5-phenyl-4,5-dihydro-2-furancarboxylic acid
| OtherNames =
|Section1={{Chembox Identifiers
| IUPHAR_ligand = 1595
| Abbreviations =
| CASNo = 72420-38-3
| CASNo_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = B1X701S0MV
| EINECS =
| PubChem = 51576
| ChemSpiderID = 46712
| ChEMBL = 278488
| SMILES = CC1(C(=O)C=C(O1)C(=O)O)C2=CC=CC=C2
| InChI = 1/C12H10O4/c1-12(8-5-3-2-4-6-8)10(13)7-9(16-12)11(14)15/h2-7H,1H3,(H,14,15)
| InChIKey = DFDGRKNOFOJBAJ-UHFFFAOYAE
| StdInChI = 1S/C12H10O4/c1-12(8-5-3-2-4-6-8)10(13)7-9(16-12)11(14)15/h2-7H,1H3,(H,14,15)
| StdInChIKey = DFDGRKNOFOJBAJ-UHFFFAOYSA-N
| RTECS =
| MeSHName =
| ChEBI =
| KEGG = D02753
  }}
|Section2={{Chembox Properties
| C=12 | H=10 | O=4
| Appearance =
| Density =
| MeltingPt =
| MeltingPt_notes =
| BoilingPt =
| BoilingPt_notes =
| Solubility =
| SolubleOther =
| Solvent =
  }}
|Section5={{Chembox Pharmacology
| AdminRoutes =
| Bioavail =
| Metabolism =
| HalfLife =
| ProteinBound =
| Excretion =
| Legal_status =
| Legal_US =
| Legal_UK =
| Legal_AU =
| Legal_CA =
| PregCat =
| PregCat_AU =
| PregCat_US =
  }}
|Section7={{Chembox Hazards
| ExternalSDS =
| MainHazards =
| NFPA-H =
| NFPA-F =
| NFPA-R =
| NFPA-S =
| FlashPt =
| AutoignitionPt =
| ExploLimits =
| LD50 =
| PEL =
  }}
|Section8={{Chembox Related
| OtherAnions =
| OtherCations =
| OtherFunction =
| OtherFunction_label =
| OtherCompounds =
  }}
}}

'''Acifran''' is a [niacin receptor](/source/niacin_receptor) [agonist](/source/agonist).<ref>{{cite journal | pmid = 17358052 | title = Analogues of acifran: agonists of the high and low affinity niacin receptors, GPR109a and GPR109b | doi=10.1021/jm070022x | volume=50 | issue=7 | date=April 2007 | journal=J. Med. Chem. | pages=1445–8| last1 = Jung | first1 = J. K. | last2 = Johnson | first2 = B. R. | last3 = Duong | first3 = T | last4 = Decaire | first4 = M | last5 = Uy | first5 = J | last6 = Gharbaoui | first6 = T | last7 = Boatman | first7 = P. D. | last8 = Sage | first8 = C. R. | last9 = Chen | first9 = R | last10 = Richman | first10 = J. G. | last11 = Connolly | first11 = D. T. | last12 = Semple | first12 = G }}</ref>

==References==
{{reflist}}

Category:Receptor agonists
Category:Carboxylic acids
Category:Enones

{{OrganicAcid-stub}}

---
Adapted from the Wikipedia article [Acifran](https://en.wikipedia.org/wiki/Acifran) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/Acifran?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.
