# 3F-PiHP

> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/3F-PiHP
> Markdown URL: https://mediated.wiki/source/3F-PiHP.md
> Source: https://en.wikipedia.org/wiki/3F-PiHP
> Source revision: 1328689774
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)

{{Short description|Substituted cathinone stimulant drug}}
{{Drugbox
| IUPAC_name = 1-(3-fluorophenyl)-4-methyl-2-(pyrrolidin-1-yl)pentan-1-one
| image = 3F-α-PiHP.svg
| image_class = skin-invert-image
| width = 220

<!--Clinical data-->
| pregnancy_category =  
| legal_CA =Schedule I
| legal_DE = NpSG
| legal_UK = Class B
| legal_US = Unscheduled
| legal_status =  
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability =  
| metabolism =  
| excretion =

<!--Identifiers-->
| CAS_number = 
| PubChem = 163192825
| ChemSpiderID = 
| ChEMBL =
| ChEBI =
| UNII = XZF8YZF3PN 

<!--Chemical data-->
| C=16 | H=22 | F=1 | N=1 | O=1
| smiles = O=C(C(CC(C)C)N1CCCC1)C2=CC(F)=CC=C2
| StdInChI = 
| StdInChIKey = 
}}

'''3F-PiHP''' ('''3F-α-PiHP''') is a recreational [designer drug](/source/designer_drug) from the [substituted cathinone](/source/substituted_cathinone) family, with [stimulant](/source/stimulant) effects. It was first identified in both Sweden and Finland in mid-2019,<ref>{{cite report | url = https://www.emcdda.europa.eu/system/files/publications/13464/20205648_TD0320796ENN_PDF_rev.pdf | title = New psychoactive substances: global markets, glocal threats and the COVID-19 pandemic. An update from the EU Early Warning System | author = European Monitoring Center for Drugs and Drug Addiction | location = Luxembourg | publisher = Publications Office of the European Union | date = December 2020 | doi = 10.2810/921262 }}</ref> and was made illegal in Finland in August 2019.<ref>{{cite web | url = https://finlex.fi/fi/lainsaadanto/2014/1130 | title = Valtioneuvoston asetus kuluttajamarkkinoilta kielletyistä psykoaktiivisista aineista | trans-title = Government Decree on Psychoactive Substances Banned from the Consumer Market | language = Finnish | work = Finlex Data Bank }}</ref>

==See also==
* [3-Fluoromethcathinone](/source/3-Fluoromethcathinone)
* [3F-NEH](/source/3F-NEH)
* [3F-PVP](/source/3F-PVP)
* [3F-PHP](/source/3F-PHP)
* [4F-PHP](/source/4F-PHP)
* [α-PHiP](/source/%CE%B1-PHiP)
* [α-PCyP](/source/%CE%B1-PCyP)
* [Isohexylone](/source/Isohexylone)

== References ==
{{Reflist}}

{{Stimulants}}

Category:Pyrrolidinophenones
Category:Designer drugs
Category:Serotonin-norepinephrine-dopamine releasing agents
Category:3-Fluorophenyl compounds

{{psychoactive-stub}}

---
Adapted from the Wikipedia article [3F-PiHP](https://en.wikipedia.org/wiki/3F-PiHP) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/3F-PiHP?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.