# 3F-NEH

> Mediated Wiki article. Canonical URL: https://mediated.wiki/source/3F-NEH
> Markdown URL: https://mediated.wiki/source/3F-NEH.md
> Source: https://en.wikipedia.org/wiki/3F-NEH
> Source revision: 1328689543
> License: Creative Commons Attribution-ShareAlike 4.0 International (https://creativecommons.org/licenses/by-sa/4.0/)

{{Short description|Substituted cathinone stimulant drug}}
{{Drugbox
| IUPAC_name = 2-(ethylamino)-1-(3-fluorophenyl)hexan-1-one
| image = 3F-NEH.svg
| image_class = skin-invert-image
| width = 220

<!--Clinical data-->
| pregnancy_category =  
| legal_status =  
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability =  
| metabolism =  
| excretion =

<!--Identifiers-->
| CAS_number = 
| PubChem = 163195773
| ChemSpiderID = 
| ChEMBL =
| ChEBI =
| UNII = J86LFK6UP6 

<!--Chemical data-->
| C=14 | H=20 | F=1 | N=1 | O=1
| smiles = O=C(c1cc(F)ccc1)C(CCCC)NCC
| StdInChIKey = 
}}

'''3F-NEH''' ('''3-Fluoro-N-Ethylhexedrone''') is a recreational [designer drug](/source/designer_drug) from the [substituted cathinone](/source/substituted_cathinone) family, with [stimulant](/source/stimulant) effects. It was first identified in Sweden in October 2020.<ref>{{cite book | url = https://www.emcdda.europa.eu/system/files/publications/13464/20205648_TD0320796ENN_PDF_rev.pdf | title = New psychoactive substances: global markets, glocal threats and the COVID-19 pandemic. An update from the EU Early Warning System | author = European Monitoring Center for Drugs and Drug Addiction | location = Luxembourg | publisher = Publications Office of the European Union | date = December 2020 | doi = 10.2810/921262 | isbn = 9789294975584 }}</ref>

==See also==
* [3-Fluoromethamphetamine](/source/3-Fluoromethamphetamine)
* [3-Fluoromethcathinone](/source/3-Fluoromethcathinone)
* [3F-NEB](/source/3F-NEB)
* [3F-PiHP](/source/3F-PiHP)
* [3F-PVP](/source/3F-PVP)
* [3F-Phenmetrazine](/source/3F-Phenmetrazine)
* [N-Ethylhexedrone](/source/N-Ethylhexedrone)
* [N-Ethylhexylone](/source/N-Ethylhexylone)

== References ==
{{Reflist}}

{{Stimulants}}

Category:Cathinones
Category:Designer drugs
Category:Serotonin-norepinephrine-dopamine releasing agents
Category:3-Fluorophenyl compounds

{{nervous-system-drug-stub}}

---
Adapted from the Wikipedia article [3F-NEH](https://en.wikipedia.org/wiki/3F-NEH) by Wikipedia contributors ([contributor history](https://en.wikipedia.org/wiki/3F-NEH?action=history)). Available under [Creative Commons Attribution-ShareAlike 4.0 International](https://creativecommons.org/licenses/by-sa/4.0/). Changes may have been made.